a 183 g 183 g sample of bleach contains 14.0 g naocl 14.0 g naocl . calculate the mass percent of naocl naocl in the bleach.

Answer:

The mass of the steel wool before burning can be calculated by finding the difference between the mass of the steel wool and the mass of the iron oxide produced.

If the mass of the iron oxide produced is 715 g, then the mass of the steel wool before burning was:

Mass of steel wool before burning = Mass of steel wool + Mass of iron oxide produced

Since the steel wool was entirely converted to iron oxide, we know that the mass of iron in the steel wool is equal to the mass of iron in the iron oxide produced. Since iron has an atomic mass of 56 g/mol, we can use this to find the mass of iron in the 715 g of iron oxide:

Number of moles of iron = mass of iron oxide produced / atomic mass of iron

Number of moles of iron = 715 g / 56 g/mol

Number of moles of iron = 12.77 mol

Since the mass of iron in the steel wool is the same as the mass of iron in the iron oxide produced, we can use the same number of moles of iron to find the mass of steel wool before burning:

Mass of steel wool before burning = Number of moles of iron x (atomic mass of iron / molar mass of steel wool)

The molar mass of steel wool is the sum of the atomic masses of its constituent elements (iron and carbon) multiplied by their respective stoichiometric coefficients:

Molar mass of steel wool = (atomic mass of iron x 1) + (atomic mass of carbon x 1)

Molar mass of steel wool = (56 g/mol x 1) + (12.01 g/mol x 1)

Molar mass of steel wool = 68.01 g/mol

Substituting the known values into the equation, we get:

Mass of steel wool before burning = 12.77 mol x (56 g/mol / 68.01 g/mol)

Mass of steel wool before burning = 10.49 mol

Therefore, the mass of the steel wool before burning was:

Mass of steel wool before burning = Mass of steel wool + Mass of iron oxide produced

Mass of steel wool before burning = 715 g + (10.49 mol x 68.01 g/mol)

Mass of steel wool before burning = 1,428 g (rounded to the nearest whole number)

Explanation:

Answer:

not specific

Explanation:

The force of attraction that binds oppositely charged ions together is called an electrostatic force or an ionic bond.

This type of bond results from the transfer of electrons from one atom to another, resulting in the formation of ions with opposite charges. The positively charged ion (cation) is attracted to the negatively charged ion (anion), and this attraction results in the formation of an ionic bond. Ionic bonds are typically strong and can be found in many types of compounds, including salts and minerals.

The electrostatic force is an important fundamental force in nature and plays a crucial role in many physical and chemical phenomena, such as the binding of atoms to form molecules, the behavior of charged particles in electric and magnetic fields, and the behavior of materials with electrical conductivity.

To know more about electrostatic force here

https://brainly.com/question/9774180

#SPJ4

an explanation to all steps within this problem are as follows:

A. To calculate the thickness of the monolayer, we need to use the formula:

thickness = volume/area

where the area is the surface area of the watch glass. The area of a circle is given by:

area = [tex]\pi r^2[/tex]

where r is the radius of the watch glass. In this case, the diameter of the watch glass is 5 cm, so the radius is 2.5 cm or 0.025 m. Therefore, the area is:

area =[tex]\pi (0.025)^2 = 0.00196 m^2[/tex]

Now, we can plug in the values to find the thickness:

thickness = [tex]7.43*10^{-6} mL / 0.00196 m^2 = 0.00379 nm[/tex]

B. To determine the number of moles of oleic acid in the monolayer, we need to use the formula:

moles = mass/molar mass

where the mass is given and the molar mass of oleic acid is 282.47 g/mol. Therefore:

moles = [tex]7.52*10^{-6} g / 282.47 g/mol = 2.66*10^{-8} mol[/tex]

C. To calculate the surface area of one molecule assuming it is shaped like a cylinder, we need to use the formula:

surface area = [tex]2\pi rh + 2\pi r^2[/tex]

where r is the radius of the cylinder and h is the height. In this case, we know that the height is 10 times larger than the radius. Therefore, we can write:

h = 10r

Now, we can substitute h in the formula:

surface area = [tex]2\pi r(10r) + 2\pi r^2 = 22\pi r^2[/tex]

D. To determine the area of the surface covered by the molecules assuming they have a circular surface, we need to use the formula:

area = [tex]\pi r^2[/tex]

where r is the radius of the circular surface. We are given that the molecules can cover at most 90.6% of the surface, so we can write:

area covered = 0.906 × area

E. To calculate the number of molecules in the surface, we need to use the formula:

number of molecules = (surface area covered)/(surface area of one molecule)

We already calculated the surface area of one molecule in part C, and we found the surface area covered in part D. Therefore, we can plug in the values to find the number of molecules.

F. To calculate the number of molecules in 1 mole of oleic acid, we need to use Avogadro's number, which is 6.022×10^23 molecules/mol. Therefore:

number of molecules in 1 mol

= [tex]2.66*10^{-8} mol * 6.022*10^{23}[/tex]molecules/mol

= [tex]1.6*10^{16}[/tex] molecules

G. To find the percent error, we need to use the formula:

% error = |(experimental value - theoretical value)/theoretical value| × 100%

The theoretical value is the value we calculated using Avogadro's number, which is 1.6×10^16 molecules. The experimental value is the number of molecules we calculated in part E. Therefore:

% error = |(number of molecules in the surface - number of molecules in 1 mol of oleic acid)/number of molecules in 1 mol of oleic acid| × 100%

We can plug in the values to find the percent error.

For more question on Avogadro's number click on

https://brainly.com/question/1513182

#SPJ4

correct form of question is

Multi-Part Question For My Lab That I Just Can't Figure Out. Can You Please Give Me An Explanation To All Steps Within This Problem. A. Calculate The Thickness Of The Monolayer Assuming That The Volume Of The Monolayer Is 7.43×10−6 ML And The Diameter Of The Watch Glass Is 5 Cm.B. B. Determine The Number Of Moles Of Oleic Acid In The Monolayer. Assume The

Multi-part question for my lab that I just can't figure out. Can you please give me an explanation to all steps within this problem.

A. Calculate the thickness of the monolayer assuming that the volume of the monolayer is 7.43×10−6 mL and the diameter of the watch glass is 5 cm.B.

B. Determine the number of moles of oleic acid in the monolayer. Assume the number of grams of oleic acid in the monolayer is 7.52×10−6 g .

C. Calculate the surface area of one molecule if we assume the molecule is shaped like a cylinder that the hight is 10x larger than the radius.

D. Determine the area of the surface covered by the molecules assuming they have a circular surface which at most can cover 90.6%.

E. Calculate the number of molecules in the surface.

F. Calculate the number of molecules in 1 mole of calculated oleic acid.

G. Compare this number based on the Avogadro's number finding the % error.

Answer:

Below

Explanation:

Find the number of moles of Zn...each mole is Avagadro's Number of atoms (6.022 x 10^23 )

From periodic table Zn = 65.38 g/mole

50 gm / 65.38 gm/mole ) = .765 mole

.765 mole  *   6.022 x 10^23 = 4.61 x 10 ^23  atoms

The mass of the gas released is 3.98 grams - 438 grams = -434.02 grams.

Mass is a measure of the amount of matter present in an object. It is the amount of inertia a body has, meaning it is the measure of the resistance of a body to change in its motion when subjected to an external force. Mass is usually measured in kilograms, grams, or pounds. Mass is distinct from weight, which is a measure of the force of gravity acting on an object.

This result is negative because the mass of the gas is not actually being weighed, but is instead being calculated by subtracting the mass of the tablet after the reaction from the mass of the tablet before the reaction. The negative result indicates that the mass of the gas released is less than the mass of the tablet before the reaction.

To learn more about mass

https://brainly.com/question/1838164

#SPJ1

If the reactants of a chemical reaction contain three total carbon atoms the products of the chemical equation will have 3 carbon atoms.

Since matter cannot be created or destroyed, the rule of conservation of mass states that no matter is synthesized or degraded during a chemical reaction. It is only transformable.

As a result, atoms are preserved in chemical reactions. This means that the elements that are forming a compound in a specific ratio will reorganize to create new compounds with the same number and kind of atoms as the reactants.

In conclusion, if a molecular equation's reactants contain 3 carbon atoms, 6 oxygen atoms, and 4 hydrogen atoms, its products will also contain 3 carbon atoms, 6 oxygen atoms, and 4 hydrogen atoms.

Learn more about carbon atoms:

https://brainly.com/question/30507533

#SPJ4

The complete question is:

If the reactants of a chemical equation have 3 carbon atoms, 6 oxygen atoms, and 4 hydrogen atoms. In order to follow the conservation of matter, the products of the chemical equation will have

The heat of combustion per gram of candle for each trial is:

To calculate the heat of combustion per gram of candle for each trial, we  use the formula below:

Heat absorbed, Q = mcΔT

where;

Since the density of water is 1 g/mL, the volume of water = mass of water

Trial 1:

mass of candle burnt = 0.12 g

temperature change of water = 8.1° C

volume of water = 99.9 mL

Q = 99.9 * 4.184 * 8.1

Q = 3390 J or 3.39 kJ

The heat of combustion per gram =  3.39/0.12

The heat of combustion per gram = 28.3 kJ/g

Trial 2:

mass of candle burnt = 0.11 g

temperature change of water = 8.1° C

volume of water = 100 mL

Q = 100 * 4.184 * 8.1

Q = 3390 J or 3.39 kJ

The heat of combustion per gram =  3.39/0.11

The heat of combustion per gram = 30.8 kJ/g

Trial 3:

mass of candle burnt = 0.13 g

temperature change of water = 8.2° C

volume of water = 100.1 mL

Q = 100.1 * 4.184 * 8.2

Q = 3430 J or 3.43 kJ

The heat of combustion per gram =  3.43/0.11

The heat of combustion per gram = 26.4 kJ/g

Learn more about the heat of combustion at: https://brainly.com/question/11573726
#SPJ1

Answer: It is a alkaline substance/base and it is an antacid

Explanation: Neutralisation is the reaction between an acid and a base, in this scenario, it is the stomach acid and the indigestion tablets (base). They react to form salt and water

In the past when the carbon dioxide levels were about the same as they are today. The far back in the Earth's history do we have to go to see this is the correct option is 15 million years.

The Sediment cores that contain evidence that the CO₂ levels were the same as the today  were about the 15 million years ago. There is the no single, and the widely accepted response to this type of the  issues because the research has to produced the wide range of the dates, from the 800,000 to the 15 million years ago.

The atmospheric CO₂ levels is never be so high as they are the presently by digging for the ice cores and the examining the air bubbles that will result.

To learn more about CO₂ here

https://brainly.com/question/30473524

#SPJ4

Nonpolar molecules are compressed together because they are hydrophobic and do not readily dissolve in water. The water-repellent portions of the molecules are how cells construct their membranes.

What components make up molecules?

Groups of atoms make up molecules. When describing an atom's structure, it is also broken into smaller components. The constituent parts of an atom are protons, electrons, and neutrons. The atom's nucleus houses the protons and neutrons, and the nucleus is surrounded by electrons.

What distinguishes atoms and molecules from one another?

Ionic or covalent bonds are the two types of bonds that hold molecules together. In the environment, a number of non-metal element types only exist as molecules. For instance, the hydrogen molecule is the only form of the element. A compound's molecules are composed from two or more components. Two or more atoms of the same element make into a homonuclear molecule.

To know more about molecules visit:

https://brainly.com/question/19556990

#SPJ4

Therefore, the internal pressure of the gas in the can when its temperature reaches 433°C is approximately 52.9 atm.

In physics, pressure is defined as the force applied per unit area. It is a scalar quantity and is expressed in units such as pascals (Pa), pounds per square inch (psi), or atmospheres (atm). Pressure can be exerted by a gas or a liquid, and it is related to the density and temperature of the substance. It is an important concept in many areas of science and engineering, including fluid dynamics, thermodynamics, and materials science.

Here,

To solve this problem, we can use the combined gas law, which relates the pressure, volume, and temperature of a gas:

P1V1/T1 = P2V2/T

where P1, V1, and T1 are the initial pressure, volume, and temperature, and P2, V2, and T2 are the final pressure, volume, and temperature.

We can assume that the volume of the can is constant, so V1 = V2. We also need to convert the temperatures to Kelvin by adding 273.15 to them.

Plugging in the given values, we get:

(3.2 atm)(V) / (38°C + 273.15) = P2(V) / (433°C + 273.15)

Simplifying and solving for P2, we get:

P2 = (3.2 atm)(433°C + 273.15) / (38°C + 273.15)

= 52.9 atm

To know more about pressure,

https://brainly.com/question/18431008

#SPJ1

Long term (current) utilisation anticoagulants, ICD-10 code Z79. 01, is a medical classification listed by WHO under the range - Factors that affect the medical status and contact with healthcare.

In the United States, acceptance of ICD-10-CM was slow. Since 1979, the United States has required ICD-9-CM codes[2] for Medicare and Medicaid reimbursement claims, and indeed the majority of the American medical industry has followed suit.

ICD-10 (without diagnostic and therapeutic extensions) was implemented for reporting mortality on January 1, 1999, but ICD-9-CM was still in use for morbidity. Meanwhile, the WHO granted the National Center for Health Statistics (National center for education statistics) of the United States permission to develop a clinical modification of the ICD-10.

The US Centers for Medicare and Medicaid Services (HHS) proposed a novel code sets for reporting treatments and methods on healthcare purchases on August 21, 2008. The ICD-9-CM code configurations would be replaced by ICD-10-CM code sets on October 1, 2013, according to the proposal.

Learn more about the ICD-10 code here

https://brainly.com/question/14819864?referrer=searchResults

#SPJ4

The reaction in the cold pack is an endothermic reaction

The question is incomplete but I will explain generally the reaction in a cold pack

The reaction in a cold pack is typically endothermic. Cold packs are designed to absorb heat from their surroundings in order to create a cooling effect. This is achieved through a chemical reaction that takes place inside the pack.

Most cold packs contain two separate compartments, one containing water and the other containing a solid or powdered substance, such as ammonium nitrate. When the pack is activated, the barrier between the two compartments is broken and the water and solid/powdered substance are mixed together. This reaction is typically endothermic, meaning it absorbs heat from its surroundings in order to proceed.

Learn more about endothermic:https://brainly.com/question/23184814

#SPJ1

The one  that describes the physical appearance of the compound when the end of its melting point range is reached is the correct option is B. The compound completely converts to a liquid.

The melting point is the temperature at which the solid and the liquid will forms of the pure substance that can exist in equilibrium. The  heat is applied to the solid, and its temperature will be increase as the melting point will be reached. The more heat then will be convert to the solid into the liquid with the no temperature change.

Thus, the compound will be completely converts to the liquid as the end of its melting point range.

To learn more about melting point here

https://brainly.com/question/29578567

#SPJ4

If only 4 moles of ethanoic acid were found in the funnel. the equation for the reaction between ethanol and ethanoic acid to form ethyl ethanoate and water is CH3CH2OH + CH3COOH ⇌ CH3COOCH2CH3 + H2O.

a) The balanced chemical equation for the reaction between ethanol and ethanoic acid to form ethyl ethanoate and water is:

CH3CH2OH + CH3COOH ⇌ CH3COOCH2CH3 + H2O

b) To determine the number of moles of each component present at equilibrium, we can use the information given in the problem statement. Initially, we have:

5 moles of ethanol

6 moles of ethanoic acid

6 moles of ethyl ethanoate

4 moles of water

At equilibrium, we have:

4 moles of ethanoic acid (so we have lost 2 moles of ethanoic acid)

5 - x moles of ethanol (where x is the number of moles of ethanol that reacted to form ethyl ethanoate)

6 moles of ethyl ethanoate (since it is a product, the amount does not change)

4 + x moles of water (since water is also a product, its amount increases as the reaction proceeds)

Since the reaction is in stoichiometric proportions, the number of moles of ethanoic acid lost is equal to the number of moles of ethyl ethanoate and water produced. Therefore, we can set up the following equation to solve for x:

2x = 2

x = 1

Therefore, at equilibrium, we have:

4 moles of ethanoic acid

4 moles of ethanol (5 - 1)

6 moles of ethyl ethanoate

5 moles of water (4 + 1)

c) The equilibrium constant for the reaction is given by the following expression:

Kc = [CH3COOCH2CH3][H2O]/[CH3CH2OH][CH3COOH]

Plugging in the concentrations at equilibrium, we get:

Kc = [(6 mol)/(L) * 5 mol/L]/[(5 mol/L) * (4 mol/L)]

Kc = 1.5

Therefore, the equilibrium constant for this reaction is 1.5. Note that since the value of Kc is greater than 1, the reaction lies to the right at equilibrium, meaning that the formation of ethyl ethanoate is favored.

Learn more about ethanol and ethanoic acid here:https://brainly.com/question/27918265

#SPJ1

The complete question is:

5 moles of ethanol, 6 moles of ethanoic acid, 6 moles of ethyl ethanoate and 4 moles of water were mixed together in a separatory funnel at 15 ° C. After equilibration was established, only 4 moles of ethanoic acid were found in the funnel. a) Write the equation for the reaction between ethanol and ethanoic acid to form ethyl ethanoate and water. b) How many moles of ethanol, ethyl ethanoate and water are present in the equilibrium mixture? d) What is the value of the equilibrium constant for this reaction?

The pH of a 1.10 x 1[tex]0^{-3}[/tex] M solution of phenol (HC6H5O) is 9.89.

To calculate the pH of a solution, you need to know the concentration of the H+ ions in the solution. This can be determined using the following equation:

H+ = [H+]standard x 10-pH

Where [H+]standard is the concentration of H+ ions in a standard solution, which is 1 M in this case. So, rearranging the equation, we get:

pH = -log[H+]standard + log [H+]

Therefore, the pH of a 1.10 x 1[tex]0^{-3}[/tex] M solution of phenol (HC6H5O) can be calculated as follows

pH = -log (1 M) + log (1.10 x 1[tex]0^{-3}[/tex]  M)
pH = 9.89

More examples of questions on pH calculation can be obtained here: https://brainly.com/question/29840209

#SPJ11

In a molecule, an atom's charges are assigned based on the assumption that the chemical bonds between the atoms are created by an equal distribution of electrons.

There is no regard for the atoms' relative electronegativities. The following is the formula used to determine the formal charges on the atoms: V - N - B/2. The atom's total number of valence electrons is denoted by the letter V. N is the number of electrons that do not form bonds. B is the number of electrons in a bond. Valence electrons are those found in the atom's valence/outermost shell. The oxygen atom contains six valence electrons.

To learn more about oxygen atom click here

brainly.com/question/19532510

#SPJ4

The difference between the number of valence electrons on an atom and the number of electrons it possesses in the molecule or ion is known as the formal charge (FC).

Which is a measurement of the distribution of electrons in a molecule or ion. In a molecule, an atom's charges are assigned based on the assumption that the chemical bonds between the atoms are created by an equal distribution of electrons. There is no regard for the atoms' relative electronegativities. The following is the formula used to determine the formal charges on the atoms: V - N - B/2. The atom's total number of valence electrons is denoted by the letter V. N is the number of electrons that do not form bonds. B is the number of electrons in a bond. Valence electrons are those found in the atom's valence/outermost shell. The oxygen atom contains six valence electrons.

learn more about atom  here

https://brainly.com/question/30898688

#SPJ4

A metallic bond refers to the electrostatic attraction between positively charged metal ions and delocalized electrons in a metal. Option A is correct.

In a metallic bond, the valence electrons of the metal atoms become delocalized and are free to move throughout the metal lattice. The metal cations are held together by the surrounding sea of delocalized electrons.

This results in a strong bond between the metal atoms that gives rise to the characteristic properties of metals, such as high electrical conductivity, high thermal conductivity, and malleability. The metallic bond is a type of chemical bond that is found only in metals and their alloys.

Hence, A. The attraction of a metallic cation for delocalized electrons is the correct option.

To know more about metallic bond here

https://brainly.com/question/29766835

#SPJ4

HCO3, also known as bicarbonate, is an important electrolyte in the body that helps regulate the pH balance of the blood. The normal range for HCO3 in the blood is typically between 22 and 28 mEq/L (milliequivalents per liter).

The pH of the blood is maintained within a narrow range of 7.35 to 7.45, and any significant deviation from this range can have serious health consequences. HCO3 is one of the primary ways that the body regulates the pH of the blood.

When the blood becomes too acidic, HCO3 acts as a buffer by binding to excess hydrogen ions (H+) to form carbonic acid (H2CO3), which then dissociates into water and carbon dioxide. This process helps to neutralize the excess acid and restore the pH of the blood to a normal range.

Likewise, when the blood becomes too alkaline, the body can use HCO3 to release hydrogen ions (H+) and restore the pH balance. This regulatory mechanism is an important aspect of overall health and well-being.

Abnormal levels of HCO3 can be indicative of a number of health conditions. Low levels of HCO3, or metabolic acidosis, can be caused by conditions such as diabetes, kidney disease, or diarrhea, among others. High levels of HCO3, or metabolic alkalosis, can be caused by conditions such as vomiting, the use of certain medications, or excessive intake of antacids.

It is important to note that the normal range for HCO3 can vary slightly depending on the laboratory that is performing the analysis. Additionally, other factors such as age, gender, and overall health status can also affect HCO3 levels.

In summary, the normal range for HCO3 in the blood is typically between 22 and 28 mEq/L. HCO3 is an important electrolyte that helps regulate the pH balance of the blood, and abnormal levels can be indicative of a number of health conditions. Maintaining a normal HCO3 level is important for overall health and well-being.

To know more about bicarbonate: https://brainly.com/question/8560563

#SPJ4

What exposing potassium t-butoxide to air can cause is;

Lung damage when inhaled

Severe chemical burns when in contact with skin

Potassium t-butoxide is a colorless solid which is a strong base, which is useful in organic synthesis.

Potassium tert-butoxide catalyzes the reaction of hydrosilanes and heterocyclic compounds to give the silyl derivatives, with release of Hydrogen gas.

This potassium t-butoxide when exposed to the air can cause respiratory irritation in some persons.

The body's response to such irritation can cause further lung damage.

Inhaling corrosive bases may irritate the respiratory tract.

The symptoms include cough, choking, pain and damage to the mucous membrane.

Persons with impaired respiratory function, airway diseases and conditions such as emphysema or chronic bronchitis, may incur

further disability if excessive concentrations of particulate are inhaled.

Read more about Impact of chemical substance at; https://brainly.com/question/899775

#SPJ1

The most important gaseous element to accumulate in the earth's atmosphere, which had to await the evolution of the photosynthesis in order to exceed its loss to the space, is oxygen. The correct option is 2.

The oxygen is the chemical element with an atomic number of 8 and oxygen atom has the eight protons and eight electrons in its nucleus. The Oxygen forms the chemical compound with formula of O₂ of two atoms which is the colorless gas at the normal temperatures and the pressures.

Thus, the oxygen the most important gaseous element to accumulate in earth's atmosphere. IT had to await evolution of the photosynthesis in order to the exceed its loss to the space.

To learn more about earth's atmosphere here

https://brainly.com/question/6334188

#SPJ4

This question is incomplete , the complete question is :

The most important gaseous element to accumulate in Earth's atmosphere, which had to await the evolution of photosynthesis in order to exceed its loss to space, is ______. multiple choice question.

1)  oceans

2) oxygen

3)  longitude

4)  minor

a-Keratin has heptad repeats, has intrachain hydrogen bonds, has left-handed helices.

Collagen contains hydroxyproline, every third residue is glycine, has interchain hydrogen bonds.

Fibroin every second residue is glycine.

Alpha-keratin is a fibrous protein that is the main component of hair, nails, horns, claws, and hooves of animals. Its role is to provide structure, strength, and resilience to these tissues, which need to withstand mechanical stress and damage.

Alpha-keratin is particularly abundant in hair, where it forms the hair shaft's outer layer, or cuticle. Its structure includes an alpha-helix conformation, stabilized by hydrogen bonds between the peptide backbone's oxygen and hydrogen atoms.

Learn more on a-Keratin here: https://brainly.com/question/10703381

#SPJ1

To determine the enthalpy, use bond energies. The combustion reaction of methanol has an enthalpy of -1295 kJ/mol.

Enthalpy is calculated by adding the internal energy, stress, or volume. Enthalpy in a system cannot be measured, yet variations in enthalpy can be seen. By keeping Pressure constant, we can assure dat H = E + P V, which will make life easier.

In contrast to entropy, which measures the degree of inherent disorder within a chemical, enthalpy measures the amount much inherent energy contained in such a complex. Water's enthalpy is nonzero since elemental molecules like hydrogen gas & oxygen gas have an enthalpy of zero (regardless of phase).

To know more about enthalpy visit:

https://brainly.com/question/13996238

#SPJ4

The typical strong acids are hydrochloric acid (HCl), sulfuric acid (H2SO4), nitric acid (HNO3), hydrobromic acid (HBr), and hydrochloric oxide (HClO4) (perchloric acid)

An acid that entirely dissociates in an aqueous solution is referred to be a strong acid. It is a chemical species that may lose a proton, H+, very quickly. Strong acids lose one proton in water, which the liquid then absorbs to produce the hydronium ion:

HA(aq) + H₂O → H₃O+(aq) + A−(aq)

Although diprotic and polyprotic acids may lose more than one proton, only the first proton is considered to be lost in the "strong acid" pKa value and reaction.

Strong acids have a pH that is low.

There are lots of weak acids but few strong ones. The typical strong acids are hydrochloric acid (HCl), sulfuric acid (H2SO4), nitric acid (HNO3), hydrobromic acid (HBr), and hydrochloric oxide (HClO4) (perchloric acid).

To know more about a strong acid and a weak acid,

visit:https://brainly.com/question/12811944

#SPJ4

The partial pressure of argon would be 26.40 atm.

To find the partial pressure of argon in the mixture, we first need to calculate the total pressure contributed by all the gases other than argon. This can be done using the mole fraction of helium and neon as follows:

Mole fraction of He = 54/100 = 0.54

Mole fraction of Ne = 26/100 = 0.26

Mole fraction of Ar = 1 - 0.54 - 0.26 = 0.20

Partial pressure of He = Mole fraction of He x Total pressure

= 0.54 x 132 atm

= 71.28 atm

Partial pressure of Ne = Mole fraction of Ne x Total pressure

= 0.26 x 132 atm

= 34.32 atm

Partial pressure of Ar = Mole fraction of Ar x Total pressure

= 0.20 x 132 atm

= 26.40 atm

Therefore, the partial pressure of argon in the mixture is 26.40 atm.

More on partial pressure can be found here: https://brainly.com/question/13199169

#SPJ1

LiOH is the most likely identity of this base because it has the highest concentration of hydroxide ions.

Chemical compounds with the potential to neutralize acids are known as bases. A pH value higher than 7 indicates the presence of bases, which contain more hydroxide (OH-) ions than hydrogen (H+). Bases, which come in both organic and inorganic forms, are frequently discovered in items used on a daily basis including cleaning supplies, soaps, and shampoos. Ammonia, potassium hydroxide, and sodium hydroxide are a few typical examples of bases (NH3). Bases play a crucial role in a variety of chemical reactions and processes, such as the creation of fertilizers, the synthesis of medications, and the treatment of wastewater. Along with being used in medicine to neutralize stomach acid, they are also employed in laboratories to change the pH of liquids.

To know more about a base, check out:

https://brainly.com/question/22592658

#SPJ1

The synthesis of CH3CH2CH2CHO from two-carbon starting materials involves the formation of acetylene from calcium carbide and water, followed by hydrogenation to form ethane.

A chlorination reaction is a chemical reaction in which one or more chlorine atoms are introduced into a molecule, either in place of another atom or as an addition to the molecule. The general equation for a substitution chlorination reaction is:

RH + Cl2 -> RCl + HCl

One possible synthesis of CH3CH2CH2CHO, also known as butanal, from two-carbon starting materials is:

Step 1: Formation of acetylene (C2H2) from calcium carbide and water.

CaC2 + 2H2O -> C2H2 + Ca(OH)2

Step 2: Hydrogenation of acetylene to form ethane (C2H6).

C2H2 + 2H2 -> C2H6

Step 3: Reaction of ethane with chlorine (Cl2) to form 1-chloroethane (C2H5Cl).

C2H6 + Cl2 -> C2H5Cl + HCl

Step 4: Reaction of 1-chloroethane with sodium cyanide (NaCN) to form 1-cyanopropane (C3H7CN).

C2H5Cl + NaCN -> C3H7CN + NaCl

Step 5: Hydrolysis of 1-cyanopropane to form butanal (CH3CH2CH2CHO).

C3H7CN + 2H2O -> CH3CH2CH2CHO + NH3

To know more about Hydrolysis, visit:

brainly.com/question/29439050

#SPJ1

Both the molecules of CH3CH2OH and CH3CH2NH2 exhibit dispersion forces, dipole-dipole forces, and intermolecular hydrogen bonds.

Because dispersion forces exist between every molecule, two CF3CF3 molecules will have them. Due to the non-polar nature of this molecule, dipole-dipole interactions are not possible.

Due to the existence of H atoms bound to electronegative O atoms, CH3CH2OH and H2O exhibit powerful intermolecular H-bonds. They have greater boiling points as a result. With two H atoms and two lone pairs on O that can form H bonds, water can form an average of four H bonds per molecule.

To know more about dispersion forces visit :-

https://brainly.com/question/20514601

#SPJ4

The concentration of hydrogen ions in the solution is 1.0 x 1[tex]0^{-8}[/tex] M.

To calculate the [H+] for a solution in which [OH-] is 100 times greater than [H+], we can use the equation for the ion product constant for water:

Kw = [H+][OH-]

Where Kw is the ion product constant for water, [H+] is the concentration of hydrogen ions, and [OH-] is the concentration of hydroxide ions. Since we are given that [OH-] is 100 times greater than [H+], we can write:

[OH-] = 100[H+]

Substituting this into the equation for Kw, we get:

Kw = [H+](100[H+])

Rearranging and solving for [H+], we get:

[H+]^2 = Kw/100
[H+] = √(Kw/100)

Since Kw is 1.0 x 1[tex]0^{-14}[/tex] at 25°C, we can substitute this value into the equation and solve for [H+]:

[H+] = √(1.0 x 1[tex]0^{-14}[/tex]/100)
[H+] = √(1.0 x 1[tex]0^{-16}[/tex])
[H+] = 1.0 x 1[tex]0^{-8}[/tex]

More questions involving calculation of concentration can be obtained here: https://brainly.com/question/14652001

#SPJ11