a 4 kg block with initial speed 10 m/s slides across a rough horizontal floor before coming to rest. the frictional force acting on the block is 87 n. how far does the block slide before coming to rest?

1 calorie is defined as the amount of heat energy required to raise the temperature of 1 gram of water by 1° celcius.

Calorie is defined as a unit to measure the amount of energy of any substance. One calorie is defined as the amount of energy required to raise the temperature of one gram of water by 1ﾟC at 1 atmospheric pressure. The symbol used to represent calorie is cal.

Also one calorie can be defined in the terms of joule. 1 calorie is considered to be equivalant to 4.2 joules.

There are two different types of calories. First one is a small calorie (cal) and the 2nd 1 is large calorie (kcal). The small calorie is used to measure general amount of heat of any substance. Where has the large calorie is used in nutrition to measure the amount of energy content of the food subustances.

Therefore, 1 calorie can be defind as the heat required to raise the temperature of 1 gram of water by 1ﾟC and is equivalant to 4.2 joules.

Learn more about calorie :

https://brainly.com/question/22374134

#SPJ4

To find velocity, you need to divide the distance traveled and the time it took to travel that distance.

Velocity is a vector quantity that indicates the rate of change of an object's position in a given direction. It is calculated by dividing the change in position of an object by the time interval over which the change occurred.

The formula for velocity is,

velocity = distance / time

For example, if a car traveled 100 meters in 10 seconds, the velocity would be,

velocity = 100 meters / 10 seconds

velocity = 10 meters per second

To know more about the velocity, here

brainly.com/question/13639113

#SPJ4

The largest deflection from the isoelectric line in the ECG is found in the QRS complex.

The correct option is D.

An ECG (electrocardiogram) is a medical test that records the electrical activity of the heart. It is a non-invasive procedure that involves attaching electrodes to the skin of the chest, arms, and legs, which detects the electrical signals generated by the heart as it beats. These signals are amplified and recorded, producing a visual representation of the heart's electrical activity over time, known as an ECG waveform.

The QRS complex is the largest deflection from the isoelectric line in the ECG. It represents the depolarization of the ventricles and is typically a sharp, narrow peak.

Learn more about ECG at: https://brainly.com/question/11431788

#SPJ1

Answer:

the 3rd option

Explanation:

3.5 = -3.5

is false in every case, for any value of x we can think of.

there is no value of x that makes this equation true.

so, there is no solution.

Yes, silicon a better conductor of electricity than sulfur. The reasons are explained below.

Due to the outer electrons of pure silicon and germanium being bound in the covalent bonds of the diamond-like framework, these materials are weak electrical conductors.

Through the movement of free electrons, silicon can transmit electricity. Since silicon is an n-type semiconductor, just a small amount of n-type contaminants will produce free electrons. The current that moves through silicon from one place to another is caused by these free electrons.

Pure sulphur is a tasteless, odourless, brittle solid with a pale golden colour that is insoluble in water and a weak conductor of electricity. Sulfur meets three of the basic criteria for non-metals, making it a non-metal. Due to the restriction on the unrestricted movement of electrons, it is a poor conductor of heat and electricity. To undergo ionisation, an element's electrons need space to travel around and generate an electric charge.

To know more about conductors:

https://brainly.com/question/20257031

#SPJ4

It would cost approximately 2 cents to operate the 120 V reading lamp with a current of 2.4 A for an hour.

To calculate the cost of operating the light for an hour, we first need to determine the power consumption of the light bulb in kilowatts.

Power = Voltage * Current

P = 120 V x 2.4 A

P = 288 watts or 0.288 kilowatts

Now, we can calculate the cost of operating the light for an hour.

Energy consumed = Power x time

Energy consumed = 0.288 kW x 1 hour

Energy consumed = 0.288 kWh

Cost of operating the light for an hour = Energy consumed x Cost per kilowatt-hour

Cost of operating the light for an hour = 0.288 kWh x $0.075/kWh

Cost of operating the light for an hour = $0.0216 or approximately 2 cents

Learn more about current here:

https://brainly.com/question/2264542

#SPJ4

The quotation highlights the colonists' fear and uncertainty about their new environment. The phrase "the Martian air might draw his soul from him" suggests that the atmosphere of Mars is so inhospitable that it could kill the colonists.

The second quotation highlights the colonists' isolation and the fragility of their situation on Mars.

"The wind blew, whining. At any moment the Martian air might draw his soul from him, as marrow comes from a white bone." The story takes place on Mars, where a group of human colonists have settled after leaving a war-torn Earth. The comparison to "marrow coming from a white bone" is a vivid metaphor that conveys the idea of something being drawn out of a person with great force.

"A radio flash just came. Atom bombs hit New York! All the space rockets blown up. No more rockets to Mars, ever!" The colonists on Mars receive this radio message, which tells them that a catastrophic event has occurred on Earth. The news that atom bombs have hit New York and that all the space rockets have been destroyed is a devastating blow to the colonists, who had been hoping to receive supplies and reinforcements from Earth. It also suggests that their dreams of building a new civilization on the red planet may be dashed by events beyond their control.

Learn more on Dark They Were here: https://brainly.com/question/19053430

#SPJ1

There is a force exerted on your hand by the apple when the apple is in contact with your hand and you are holding it up against the force of gravity.

When you hold an apple in your hand, the apple is pressing against your hand with a force equal and opposite to the force your hand is applying on the apple. This force is due to the interaction between the atoms and molecules of your hand and the apple, which is known as the normal force.

As long as the apple remains in contact with your hand, there is a normal force acting on the apple and your hand, which prevents the apple from falling due to the force of gravity. Therefore, the force exerted on your hand by the apple is present when the apple is in contact with your hand and you are holding it up against the force of gravity.

To know more about the force, here

brainly.com/question/13191643

#SPJ4

Gravitational attraction is the driving force for stellar fusion. So option a. is the correct answer.

Massive clouds were created when gas whirls of both helium and hydrogen cooled. The stuff was attracted together by the gravitational attraction in the middle, and ultimately, a few of the nuclei formed. The heat as well as the light of stars were elicited as a consequence of this. Stellar nucleosynthesis is the method by which elements are produced within stars by integrating the protons and neutrons together from the nuclei of lighter elements. All of the atoms in the universe started as hydrogen. Fusion inside stars transforms hydrogen into helium, heat, and radiation. Heavier elements are produced in distinct kinds of stars as they die or explode.

To learn more about Gravitational attraction visit here:

https://brainly.com/question/30189762

#SPJ4

37 degree Celsius to Fahrenheit is 98.6°F where Fahrenheit and Celsius are related in that they are both units of temperature measurement.

The formula for converting Celsius (°C) to Fahrenheit (°F) is :

[tex]F = C * 9/5 + 32.[/tex]

To convert 37°C to Fahrenheit (°F), use the formula :

[tex]F = 37 * 9/5 + 32.[/tex]

F = 66.6 + 32

F = 98.6°F

The formula for converting a temperature from Fahrenheit to Celsius is

[tex](F - 32) * 5/9[/tex]. This formula can be used to find the Celsius equivalent of any temperature given in Fahrenheit. This conversion formula takes into account the difference between the two temperature scales, with Fahrenheit being the higher temperature scale and Celsius being the lower temperature scale.

To learn more about temperature click here https://brainly.com/question/12869377

#SPJ4

Subtract this magnitude of a smaller force from of the magnitude of bigger force to determine the resultant force. The smaller force and the resultant force both have the same direction.

The combined impact of two forces, F and F, acting on a body in a single place is equal to the action of one force, known as the resultant force. The following figure shows two different ways to display the vector equivalence R = F + F.

The sum of the individual forces acting on a body as a result of two forces acting in similar directions is called the resultant, and the point of application of the resultant divides the line connecting the pts of application of the individual forces internally inside the inverse ratio of a forces.

To know more about magnitude visit:

https://brainly.com/question/30033702

#SPJ1

The height of the building is 42.4 meters.

Let's call the height of the building "h". We can use the following kinematic equations to solve for "h":

For the stone that is dropped from the top of the building:

h = (1/2)gt² (Equation 1)

For the stone that is thrown upwards from the ground:

y = vt - (1/2)gt² (Equation 2)

where;

We know that the two stones meet at exactly 5s after their release. This means that the distance travelled by the stone thrown upwards from the ground is equal to the height of the building, i.e.,

y = h

We can substitute this equation into Equation 2 and rearrange it to solve for "t":

h = vt - (1/2)gt²

h = 20t - (1/2)gt²

t = (2h/g - 20)/(-1) (Equation 3)

Now we can substitute Equation 3 into Equation 1 and solve for "h":

h = (1/2)g((2h/g - 20)/(-1))²

h = (1/2)g(2h/g - 20)²

h = (1/2)g(4h²/g² - 80h/g + 400)

Simplifying this equation by multiplying everything by 2g and moving all the terms to one side, we get:

4h² - 160h - 400 = 0

Solving this quadratic equation using the quadratic formula, we get:

h = (160 ± sqrt(160² + 4(4)(400))) / (2(4))

h = (160 ± sqrt(32,000)) / 8

We can ignore the negative solution, so:

h = (160 + 178.88) / 8

h = 42.4 meters

Learn more about height here: https://brainly.com/question/1739912

#SPJ1

To convert MPa (megapascals) to kPa (kilopascals), you can multiply the value in MPa by 1000.

The pascal (symbol: Pa) is the SI unit of pressure, defined as one newton per square meter. It is named after Blaise Pascal, the French mathematician, physicist, and philosopher who contributed to the development of the modern theory of hydrodynamics.

One pascal is equivalent to one newton (N) of force per square meter (m²) of area:

1 Pa = 1 N/m²

Pressure can be defined as the force applied per unit area, and the pascal provides a convenient way to measure pressure in a wide range of applications. For example, the pressure of the atmosphere at sea level is approximately 101,325 Pa, or 101.3 kilopascals (kPa).

For example, if you want to convert 2 MPa to kPa:

2 MPa * 1000 = 2000 kPa

Therefore, 2 MPa is equal to 2000 kPa.

To know more about megapascals here

https://brainly.com/question/22985582

#SPJ4

You'll move more quickly and halt farther away thanks to gravity. To slow down to a safe speed and keep control of your car, you might need to downshift or gently apply the breaks.

Gravity aids you in stopping attempts and shortens the stopping distance when you are traveling uphill. When you are descending, gravity also works against you and lengthens your stopping distance. The next factor that can affect your braking distance is the friction between the road and your tires. The amount of time it takes to stop a moving object is related to the square of the starting speed of the vehicle and relies on how quickly it was moving before the brakes were applied. Hence, even little speed increases result in noticeably larger stopping distances. The distance covered while using the brakes is the braking distance. Speed and drag are two variables that influence it.

Learn more about Gravity here:

https://brainly.com/question/13810323

#SPJ4

"A(n) digital logic probe is a special DC voltmeter that detects the presence or absence of a signal."

An inexpensive hand-held test tool called a logic probe is used to examine and troubleshoot the logical states of a digital circuit. A logic analyzer is utilised instead when numerous signals need to be observed or recorded concurrently.

To examine the logic states of digital data, logic probes are used. You need logic probes that can precisely acquire signals from a broad range of electronic designs while preserving signal fidelity in order to verify and debug the high-speed, low-voltage digital signals of today.

The logic probe, also known as a digital tester, is typically a portable, inexpensive probe that resembles a pen and has indicator lights to indicate the status of the line being probed. Logic probes are frequently used to examine digital circuits, such as those that use TTL or CMOS logic.

To know more about DC voltmeter:

https://brainly.com/question/30301245

#SPJ4

The first situation that the bird is giving force to its wings to fly , it is related to the first law. The second one the coffee cup stay on rest until any force acts on it is related to the first law.

Newton's first law of motion states, every objects tends to stay in its current  state until an external force acts on it. The second law states that, the force is the product of mass and acceleration. Thus, greater is the mass greater force is needed to accelerate an object.

Third law of motion states that, for every action there is an equal and opposite reaction.

The sailor when pushing the boat, the boat is exerting a force in turn and the man can slide to the land and boat moves away. This is third law of motion.

As the force by the wind increases, its acceleration increases . This is second law. The team with greater mass in tug of war game will  have greater force that is just the second law.

The skater board tends to move again even after the hitting, its is first law of Newton.

Find more on Newtons' laws of motion:

https://brainly.com/question/29768600

#SPJ1

After solving, a) The weight of it oil drop is 2.42 x 10⁻¹² N, b) the electric field strength needed to balance its weight is -1.51 x 10⁷ N/C

The weight of the oil drop can be calculated using the formula:

weight = mass x gravity

where mass = density x volume and gravity = 9.81 m/s².

The volume of the oil drop can be calculated using the formula for the volume of a sphere:

volume = (4/3) x pi x radius³

Substituting the given values:

volume = (4/3) x pi x (0.95 x 10⁻⁶ m)³ = 2.73 x 10⁻¹⁶ m³

mass = density x volume = 905 kg/m³ x 2.73 x 10⁻¹⁶ m³ = 2.47 x 10⁻¹³ kg

weight = mass x gravity = 2.47 x 10⁻¹³ kg x 9.81 m/s² = 2.42 x 10⁻¹² N

To balance the weight of the oil drop, the electric force on the excess electron must be equal and opposite to the weight of the drop. The electric force on the excess electron can be calculated using the formula:

electric force = charge x electric field

where charge is the charge on the excess electron and electric field is the strength of the electric field.

The charge on an electron is -1.602 x 10⁻¹⁹ C.

Substituting the given values and equating the electric force to the weight of the drop:

charge x electric field = weight

-1.602 x 10⁻¹⁹ C x electric field = 2.42 x 10⁻¹² N

Solving for electric field:

electric field = (2.42 x 10⁻¹² N) / (-1.602 x 10⁻¹⁹ C) = -1.51 x 10⁷ N/C

The negative sign indicates that the electric field is directed upward, opposite to the direction of gravity, in order to balance the weight of the drop.

To learn more about electric field Click here:

brainly.com/question/15800304

#SPJ4

Rocks with a silica content of around 70% and composed primarily of quartz and feldspars are at the light-colored extreme. Granitic rock refers to these rocks.

Amorphous silicon dioxide, or SiO2, is employed in microsystems as a structural or sacrificial layer in many micro - milling techniques, as a dielectric in capacitors and transistors, as an insulator to isolate various electronic parts, and in other applications.

In order to alter the rheological behaviour of cement systems, increase the reactivity of supplemental cementitious materials, and increase the strength and durability, SiO2 nanoparticles were utilised.

To know more about SiO2 visit:

https://brainly.com/question/26243627

#SPJ4

The net force acting on the Zamboni is:

F_net = F_applied - F_friction

where F_applied is the force you apply, and F_friction is the frictional force. Substituting the given values, we get:

F_net = 85 N - 5 N = 80 N

The acceleration of the Zamboni is given by:

a = F_net / m

where m is the mass of the Zamboni. Substituting the given values, we get:

a = 80 N / 500 kg = 0.16 m/s^2

The distance the Zamboni moves is given by:

d = 40 m

The equation for motion with constant acceleration is:

d = 1/2 * a * t^2

where t is the time taken to move the distance d. Rearranging this equation, we get:

t = sqrt(2 * d / a)

Substituting the given values, we get:

t = sqrt(2 * 40 m / 0.16 m/s^2) = 10 s

Therefore, it will take 10 seconds to push the Zamboni the remaining 40 meters.

What is force?

To know more about force, click the link given below:

https://brainly.com/question/13191643

#SPJ1

Answer:

1200J

Explanation:

m=3,h=40 while g= 10m/s^2

P.E=mgh

= 3 x 40 x10

=1200J

To convert Newton meters (Nm) to foot pounds (ft-lb), you can use the following conversion factor:1 Nm = 0.737562149 ft-lb

A newton meter (Nm) is a unit of torque or moment of force in the International System of Units (SI). It is defined as the amount of torque produced by a force of one newton applied perpendicularly to a moment arm or lever arm of one meter.

In other words, a newton meter is the amount of force required to produce one newton of torque when applied at a distance of one meter from the axis of rotation. It is commonly used in engineering, physics, and other fields to measure torque or rotational force, such as the force required to tighten a bolt or turn a crank.

The newton meter is also equivalent to a joule (J), which is the SI unit of energy, since torque can be thought of as a force acting over a distance. This means that one newton meter of torque is equivalent to one joule of energy.

So, to convert a certain number of Newton meters to foot pounds, you just need to multiply the number of Newton meters by the conversion factor.

For example, let's say you have 50 Newton meters and you want to convert it to foot pounds. Using the conversion factor, you would multiply 50 Nm by 0.737562149 to get:

50 Nm x 0.737562149 = 36.88160745 ft-lb

Therefore, 50 Newton meters is equivalent to approximately 36.88 foot pounds.

To know more about Newton meters here

https://brainly.com/question/27863936

#SPJ4

The combined masses 0.2000kg * 1 g/0.001kg = 200 g, 524 mg * 1g/ 1000 mg = 0.524 g, 200g + 80.0 g + 0.524 g=280.524 g.

Mass is commonly referred to as the quantity of matter contained within an object. It is most usually assessed as inertial mass, which refers to an object's tension to acceleration given a given net force.

Matter, on the other hand, is defined somewhat loosely in science and cannot be strategically placed. In physics, mass is a statistical expression of inertia, which is a fundamental precept of all matter.

It is, in influence, the highly resistant that a cell of matter provides to a modification in its speed or placement when a force is applied to it. The smaller the start changing created by an applied force, the greater the mass of the body.

learn more about the mass of object here

https://brainly.com/question/6240825?referrer=searchResults

#SPJ4

The expression for tension T₁ in cable 1 is calculated to be mgcosθ₁/(sinθ₁ + sinθ₂).

The angle made by strings 1 and 2 are θ₁ and θ₂ respectively. Tension in the strings 1 and 2 are T₁ and T₂ respectively.

Considering the diagram attached, the following tension components are written as,

The energy is directed downward by the weight of the block pressing against the body.

Vertical component of T₁ is T₁ sinθ₁ which acts upwards.

Horizontal component of T₁ is T₁ cosθ₁ which acts to the left.

Vertical component of T₂ is T₂ sinθ₂ which acts upwards.

Horizontal component of T₂ is T₂ cosθ₂ acting towards right.

To maintain an equilibrium, the upward forces and downwards forces must be equal even as the forces on the right and left hand side must be balanced.

Therefore, balancing the vertical components we obtain,

T₁ sinθ₁ + T₂ sinθ₂ = mg

For horizontal forces, T₁ cosθ₁ = T₂ cosθ₂

Re-arranging the above equation and making T₂ the subject of the formula, we can write it as,

T₂ = T₁ cosθ₁/cosθ₂

Substituting T₂ into the vertical component we get,

T₁ sinθ₁ + (T₁ cosθ₁/cosθ₂)sinθ₂ = mg

Multiply by cosθ₂ on both sides, we obtain,

T₁ sinθ₁ cosθ₂ + T₁ cosθ₁ sinθ₂ = mg cosθ₂

T₁ (sinθ₁ cosθ₂ + cosθ₁ sinθ₂) = mg cosθ₂

As we know the formula for sin(a + b) as sin(a)cos(b)+sin(b)cos(a), we get the above equation as,

T₁ sin(θ₁ + θ₂) = mg cosθ₂

Making T₁ as subject, we have,

T₁ = mg cosθ₂/sin(θ₁ + θ₂)

Thus, the equation for T₁ is deduced.

The given question is incomplete without the diagram. The diagram is attached in the attachment below.

To know more about tension:

https://brainly.com/question/30264095

#SPJ4

An object that weighs 100 kg on Earth would have weight of about b) 16 kg on moon.

The weight of an object on the moon is different from its weight on Earth due to the difference in the gravitational force between the two objects. The gravitational force on the moon is much weaker than on Earth because the moon has less mass and a smaller radius.

Gravitational force on moon is 1/6th of gravitational force on Earth. Therefore, an object that weighs 100 kg on Earth would weigh about 16.6 kg (100 kg divided by 6) on the moon.

Therefore, the answer is (b) 16kg. It is important to note that the mass of the object remains the same on both Earth and the moon, as mass is a fundamental property of an object that does not change with location. However, weight is a force that is dependent on the gravitational force acting on the object, so it varies with location.

Learn more weight here:

https://brainly.com/question/21864472

#SPJ4

The Electric Potential at a point P for a thin rod with uniform charge density is equal to 50230.4 V.

Electric Potential is referred to as the total amount of work that is done by any external element to bring a unit positive charge from infinity to a point where the influence of potential can be felt. The electric potential due to a point charge is represented by

[tex]V = k\frac{q}{r}[/tex]

where V is the electric potential, k is Coulomb's constant which is equal to 9×10⁹ N m²/C², q is the charge and r is the distance.

Now, the Electric potential due to a small element dx at a distance d is given by

[tex]dV = k\frac{\alpha dx}{r}\\dV = k\frac{\alpha dx}{\sqrt{d^2 + x^2}}} \\dV = k\frac{\alpha dx}{\sqrt{D^2 + x^2}}} \\[/tex]

where k is coulomb's constant, α is the charge density.

Now the total electric potential at point P is

[tex]V = \int\limits^L_D \, dV \\V = \int\limits^{5D}_D \, k\frac{\lambda dx}{\sqrt{D^2 + x^2}}} \\\\V = k \lambda \int\limits^{5D}_D \, \frac{\ dx}{\sqrt{D^2 + x^2}}} \\\\ \\V = k\lambda[ln(\sqrt{D^2 + x^2} + x)]\limits^{5D}_D\\[/tex]

V = (9×10⁹)(3.90×10⁻⁶) ln {(5 + √26)/(1 + √2)}

V = 50230.4 V which is the required potential.

Learn more about Electric potential at:

brainly.com/question/28168672

#SPJ4

To find PV, FV, or r, apply the one period Although on lump sum formula. FV = Fv (1+r) FV-PV-PV/1+r PV-FV/1+r

Describe formula.

The meaning of a formula. (Page 1 of 2) 1a: a predetermined set of phrases used in rituals or ceremonies. b: a formalized assertion meant to convey a fundamental fact or principle, especially as a starting point for discussion or action. Recipe 2a(1) The manufacturer of the product won't divulge the formula's secret ingredients. prescription (number 2)

The % formula is what.

To determine the quantity or percentage of an item in terms of 100, use the percentage formula. Per cent simply means one in a hundred. With the percentage formula, a number between 0 and 1 can be expressed. A number that is expressed as a percentage of 100 is what it is. It is mostly used to evaluate and determine ratios and is represented by the symbol %.

To know more about formula visit:

https://brainly.com/question/25519661

#SPJ1

The speed of wave propagation is found to be 0.875 m/s.

For the stated question:

Amplitude a = 1.35 m

Wavelength λ = 6.3 m

Time period T = 7.2 s

Frequency υ.

From the relation of time- period and frequency:

υ = 1/T

υ = 1/7.2

υ = 0.138 Hz

Speed of the wave v;

speed = wavelength * frequency

v = λ*υ

v = 6.3 * 0.138

v = 0.875 m/s

Thus, the speed of the propagation of the wave is found to be 0.875 m/s.

To know more about the waves, here

https://brainly.com/question/26116832

#SPJ1

J and V are different units of measurement and cannot be directly converted as they measure different quantities.

J is the unit of measurement for energy or work in the International System of Units (SI), while V is the unit of measurement for electrical potential difference or voltage.

To convert J (joules) to V (volts), you would need to know the amount of energy involved and the electrical charge involved in the process.

One formula that relates energy, charge, and voltage is:

V = E/Q

where V is voltage, E is energy, and Q is electric charge. If you know the values of E and Q, you can use this formula to calculate the voltage.

For example, if you have 1 joule of energy and 1 coulomb of electric charge, you can calculate the voltage using the formula:

V = 1 J / 1 C = 1 V

So, in this example, 1 joule of energy is equivalent to 1 volt of electrical potential difference when there is 1 coulomb of electric charge involved.

To know more about measurement here

https://brainly.com/question/17960368

#SPJ4

Vaporization pressure of water is the pressure exerted by water vapor when it is in equilibrium with liquid water at a specific temperature.

Vaporization pressure of water represents the point at which the rate of evaporation of water equals the rate of condensation of water vapor, and it varies with temperature and atmospheric pressure.

As temperature increases, the vaporization pressure of water also increases. At sea level, the vaporization pressure of water is approximately 4.6 millimeters of mercury (mmHg) or 0.006 atmospheres at 0 degrees Celsius (32 degrees Fahrenheit) and approximately 23.8 mmHg or 0.031 atmospheres at 25 degrees Celsius (77 degrees Fahrenheit).

The vaporization pressure of water is an important parameter in atmospheric science, climate research, and various industrial and technological applications such as humidity control, air conditioning, and power generation.

Learn more about vaporization pressure here:

https://brainly.com/question/11864750

#SPJ4

A) The box slides for a distance of 10.23 meters before stopping.

B) The coefficient of friction at the stopping point is 0.432.

C) If the coefficient of friction were constant at 0.1, the box would slide for a distance of 10.84 meters.

A) The force of friction acting on the box is given by:

f = μmg,

where μ is the coefficient of friction, m is the mass of the box, and g is the acceleration due to gravity. The coefficient of friction varies linearly with distance past point P, and can be expressed as:

μ(x) = 0.1 + 0.04(x - 2),

where x is the distance from point P in meters.

The work done by the force of friction over a small distance dx is:

dW = f dx = (0.1 + 0.04(x - 2))mg dx.

The total work done by the force of friction from point P to the stopping point is the integral of dW over this distance range, which is given by:

W = ∫(0 to D) dW = ∫(0 to D) (0.1 + 0.04(x - 2))mg dx = (0.1mgD + 0.02mgD^2).

Using the work-energy theorem, we can equate the work done by the force of friction to the change in kinetic energy of the box:

W = ΔK = (1/2)mvf^2,

where vf is the final velocity of the box (zero, since it stops).

Solving for the distance D, we get:

D = vf^2 / 2(0.1mg + 0.02mgD) = (vf^2/2mg) / (0.1 + 0.02D).

Substituting the given values, we get:

D = (4.5^2 / 2*9.81) / (0.1 + 0.02D) = 10.23 m.

Therefore, the box slides for a distance of 10.23 meters before stopping.

B) To find the coefficient of friction at the stopping point, we can use the expression for μ(x) and substitute D = 10.23 m:

μ(D) = 0.1 + 0.04(D - 2) = 0.1 + 0.04(10.23 - 2) = 0.432.

Therefore, the coefficient of friction at the stopping point is 0.432.

C) If the coefficient of friction were constant at 0.1 throughout the rough section, the work done by the force of friction would simply be:

W = fD = 0.1mgD.

Using the work-energy theorem as before, we can equate this work to the change in kinetic energy of the box:

W = ΔK = (1/2)mvf^2.

Solving for D, we get:

D = vf^2 / 20.1g = (4.5^2 / 29.81×0.1) = 10.84 m.

Learn more about coefficient of friction here

brainly.com/question/29281540

#SPJ4