assuming the reaction is first order in sucrose, determine the mass of sucrose that is hydrolyzed when 2.60 l of a 0.160 m sucrose solution is allowed to react for 200 min.

The pH of a 1.10 x 1[tex]0^{-3}[/tex] M solution of phenol (HC6H5O) is 9.89.

To calculate the pH of a solution, you need to know the concentration of the H+ ions in the solution. This can be determined using the following equation:

H+ = [H+]standard x 10-pH

Where [H+]standard is the concentration of H+ ions in a standard solution, which is 1 M in this case. So, rearranging the equation, we get:

pH = -log[H+]standard + log [H+]

Therefore, the pH of a 1.10 x 1[tex]0^{-3}[/tex] M solution of phenol (HC6H5O) can be calculated as follows

pH = -log (1 M) + log (1.10 x 1[tex]0^{-3}[/tex]  M)
pH = 9.89

More examples of questions on pH calculation can be obtained here: https://brainly.com/question/29840209

#SPJ11

The reaction in the cold pack is an endothermic reaction

The question is incomplete but I will explain generally the reaction in a cold pack

The reaction in a cold pack is typically endothermic. Cold packs are designed to absorb heat from their surroundings in order to create a cooling effect. This is achieved through a chemical reaction that takes place inside the pack.

Most cold packs contain two separate compartments, one containing water and the other containing a solid or powdered substance, such as ammonium nitrate. When the pack is activated, the barrier between the two compartments is broken and the water and solid/powdered substance are mixed together. This reaction is typically endothermic, meaning it absorbs heat from its surroundings in order to proceed.

Learn more about endothermic:https://brainly.com/question/23184814

#SPJ1

Iodine is not as effective an oxidizer as bromine. In order to produce iodine, bromine can strip iodide ions of their electrons, and the iodine cannot recover its electrons from the resulting bromide ions.

Sulfuric acid concentration working as an oxidizing agent

containing chloride or fluorine

The oxidizing power of concentrated sulfuric acid is insufficient to oxidize fluorine or chloride. Only the steamy vapors of the hydrogen halide—hydrogen fluoride or hydrogen chloride—are generated in those circumstances. Fluoride and chloride are not powerful enough reducing agents to decrease sulfuric acid in terms of the halide ions. For iodides and bromides, this is not the situation.

with bromine

Sulfuric acid can be reduced by bromide because it is a powerful reducing substance. In the procedure, bromine is produced from bromide.

The oxidation state of sulfur changes from +6 to +4 when bromide converts sulfuric acid to sulfur dioxide gas.

In actuality, the steamy hydrogen bromide fumes tainted with brown bromine vapor serve as evidence of this interaction. Since sulfur dioxide is an invisible vapor, it is impossible to see it.

Using iodide

Iodide is a more potent reduction agent than bromide, and sulfuric acid converts it to iodine.

Sulfuric acid reduction is trickier than bromine reduction. It can be lowered in three stages using iodide.

(Sulfur oxidation state = +4) sulfuric acid to sulfur dioxide

pure sulfur to sulfur dioxide (oxidation state = 0)

hydrogen sulfide from sulfur (sulfur oxidation state = -2).

To know more about bromide:

https://brainly.com/question/13992609

#SPJ4

The equation that is correct is TC + or - WCA = TH.  The correct option is

A.

The given equations are related to the magnetic compass errors.

The full form for the  above equation is as follows :

T is the concerning TRUE North  it is use to plotter and the latitude

M is Regarding the MAGNETIC North that is the True North +/- Deviation.

C is  to the COMPASS North that is the Magnetic North +/- Compass card deviation in the system

C is Plotted COURSE in the map that is no wind correction is applied.

The order is as :

TC = True course

VAR = Variation

MC = Magnetic course

WCA = Wind correction angle

MH = Magnetic heading

DEV = Deviation

CH = Compass heading

To learn more about magnetic compass here

https://brainly.com/question/29870686

#SPJ4

The Alka-Seltzer experiment's experimental group is the group of volunteers who are given Alka-Seltzer pills to ingest.

The experiment's goal is to test the hypothesis that Alka-Seltzer pills will shorten the time it takes for stomach discomfort to go away. The control group consists of volunteers who were given a placebo, or a false drug, instead of the Alka-Seltzer pills.

The experimental group is critical to the experiment because it allows for a comparison of the outcomes seen in subjects given Alka-Seltzer pills vs those given a placebo. The hypothesis could not be tested and the results could not be appropriately understood in the absence of an experimental group.

Learn more about the Alka-seltzer experiment at

https://brainly.com/question/29106242

#SPJ4

Answer:

hydrogen + oxygen is equal to water Potassium Chloride + oxygen there are reaction

Answer: It is a alkaline substance/base and it is an antacid

Explanation: Neutralisation is the reaction between an acid and a base, in this scenario, it is the stomach acid and the indigestion tablets (base). They react to form salt and water

an explanation to all steps within this problem are as follows:

A. To calculate the thickness of the monolayer, we need to use the formula:

thickness = volume/area

where the area is the surface area of the watch glass. The area of a circle is given by:

area = [tex]\pi r^2[/tex]

where r is the radius of the watch glass. In this case, the diameter of the watch glass is 5 cm, so the radius is 2.5 cm or 0.025 m. Therefore, the area is:

area =[tex]\pi (0.025)^2 = 0.00196 m^2[/tex]

Now, we can plug in the values to find the thickness:

thickness = [tex]7.43*10^{-6} mL / 0.00196 m^2 = 0.00379 nm[/tex]

B. To determine the number of moles of oleic acid in the monolayer, we need to use the formula:

moles = mass/molar mass

where the mass is given and the molar mass of oleic acid is 282.47 g/mol. Therefore:

moles = [tex]7.52*10^{-6} g / 282.47 g/mol = 2.66*10^{-8} mol[/tex]

C. To calculate the surface area of one molecule assuming it is shaped like a cylinder, we need to use the formula:

surface area = [tex]2\pi rh + 2\pi r^2[/tex]

where r is the radius of the cylinder and h is the height. In this case, we know that the height is 10 times larger than the radius. Therefore, we can write:

h = 10r

Now, we can substitute h in the formula:

surface area = [tex]2\pi r(10r) + 2\pi r^2 = 22\pi r^2[/tex]

D. To determine the area of the surface covered by the molecules assuming they have a circular surface, we need to use the formula:

area = [tex]\pi r^2[/tex]

where r is the radius of the circular surface. We are given that the molecules can cover at most 90.6% of the surface, so we can write:

area covered = 0.906 × area

E. To calculate the number of molecules in the surface, we need to use the formula:

number of molecules = (surface area covered)/(surface area of one molecule)

We already calculated the surface area of one molecule in part C, and we found the surface area covered in part D. Therefore, we can plug in the values to find the number of molecules.

F. To calculate the number of molecules in 1 mole of oleic acid, we need to use Avogadro's number, which is 6.022×10^23 molecules/mol. Therefore:

number of molecules in 1 mol

= [tex]2.66*10^{-8} mol * 6.022*10^{23}[/tex]molecules/mol

= [tex]1.6*10^{16}[/tex] molecules

G. To find the percent error, we need to use the formula:

% error = |(experimental value - theoretical value)/theoretical value| × 100%

The theoretical value is the value we calculated using Avogadro's number, which is 1.6×10^16 molecules. The experimental value is the number of molecules we calculated in part E. Therefore:

% error = |(number of molecules in the surface - number of molecules in 1 mol of oleic acid)/number of molecules in 1 mol of oleic acid| × 100%

We can plug in the values to find the percent error.

For more question on Avogadro's number click on

https://brainly.com/question/1513182

#SPJ4

correct form of question is

Multi-Part Question For My Lab That I Just Can't Figure Out. Can You Please Give Me An Explanation To All Steps Within This Problem. A. Calculate The Thickness Of The Monolayer Assuming That The Volume Of The Monolayer Is 7.43×10−6 ML And The Diameter Of The Watch Glass Is 5 Cm.B. B. Determine The Number Of Moles Of Oleic Acid In The Monolayer. Assume The

Multi-part question for my lab that I just can't figure out. Can you please give me an explanation to all steps within this problem.

A. Calculate the thickness of the monolayer assuming that the volume of the monolayer is 7.43×10−6 mL and the diameter of the watch glass is 5 cm.B.

B. Determine the number of moles of oleic acid in the monolayer. Assume the number of grams of oleic acid in the monolayer is 7.52×10−6 g .

C. Calculate the surface area of one molecule if we assume the molecule is shaped like a cylinder that the hight is 10x larger than the radius.

D. Determine the area of the surface covered by the molecules assuming they have a circular surface which at most can cover 90.6%.

E. Calculate the number of molecules in the surface.

F. Calculate the number of molecules in 1 mole of calculated oleic acid.

G. Compare this number based on the Avogadro's number finding the % error.

Both the molecules of CH3CH2OH and CH3CH2NH2 exhibit dispersion forces, dipole-dipole forces, and intermolecular hydrogen bonds.

Because dispersion forces exist between every molecule, two CF3CF3 molecules will have them. Due to the non-polar nature of this molecule, dipole-dipole interactions are not possible.

Due to the existence of H atoms bound to electronegative O atoms, CH3CH2OH and H2O exhibit powerful intermolecular H-bonds. They have greater boiling points as a result. With two H atoms and two lone pairs on O that can form H bonds, water can form an average of four H bonds per molecule.

To know more about dispersion forces visit :-

https://brainly.com/question/20514601

#SPJ4

A metallic bond refers to the electrostatic attraction between positively charged metal ions and delocalized electrons in a metal. Option A is correct.

In a metallic bond, the valence electrons of the metal atoms become delocalized and are free to move throughout the metal lattice. The metal cations are held together by the surrounding sea of delocalized electrons.

This results in a strong bond between the metal atoms that gives rise to the characteristic properties of metals, such as high electrical conductivity, high thermal conductivity, and malleability. The metallic bond is a type of chemical bond that is found only in metals and their alloys.

Hence, A. The attraction of a metallic cation for delocalized electrons is the correct option.

To know more about metallic bond here

https://brainly.com/question/29766835

#SPJ4

If the reactants of a chemical reaction contain three total carbon atoms the products of the chemical equation will have 3 carbon atoms.

Since matter cannot be created or destroyed, the rule of conservation of mass states that no matter is synthesized or degraded during a chemical reaction. It is only transformable.

As a result, atoms are preserved in chemical reactions. This means that the elements that are forming a compound in a specific ratio will reorganize to create new compounds with the same number and kind of atoms as the reactants.

In conclusion, if a molecular equation's reactants contain 3 carbon atoms, 6 oxygen atoms, and 4 hydrogen atoms, its products will also contain 3 carbon atoms, 6 oxygen atoms, and 4 hydrogen atoms.

Learn more about carbon atoms:

https://brainly.com/question/30507533

#SPJ4

The complete question is:

If the reactants of a chemical equation have 3 carbon atoms, 6 oxygen atoms, and 4 hydrogen atoms. In order to follow the conservation of matter, the products of the chemical equation will have

Therefore, the internal pressure of the gas in the can when its temperature reaches 433°C is approximately 52.9 atm.

In physics, pressure is defined as the force applied per unit area. It is a scalar quantity and is expressed in units such as pascals (Pa), pounds per square inch (psi), or atmospheres (atm). Pressure can be exerted by a gas or a liquid, and it is related to the density and temperature of the substance. It is an important concept in many areas of science and engineering, including fluid dynamics, thermodynamics, and materials science.

Here,

To solve this problem, we can use the combined gas law, which relates the pressure, volume, and temperature of a gas:

P1V1/T1 = P2V2/T

where P1, V1, and T1 are the initial pressure, volume, and temperature, and P2, V2, and T2 are the final pressure, volume, and temperature.

We can assume that the volume of the can is constant, so V1 = V2. We also need to convert the temperatures to Kelvin by adding 273.15 to them.

Plugging in the given values, we get:

(3.2 atm)(V) / (38°C + 273.15) = P2(V) / (433°C + 273.15)

Simplifying and solving for P2, we get:

P2 = (3.2 atm)(433°C + 273.15) / (38°C + 273.15)

= 52.9 atm

To know more about pressure,

https://brainly.com/question/18431008

#SPJ1

The force of attraction that binds oppositely charged ions together is called an electrostatic force or an ionic bond.

This type of bond results from the transfer of electrons from one atom to another, resulting in the formation of ions with opposite charges. The positively charged ion (cation) is attracted to the negatively charged ion (anion), and this attraction results in the formation of an ionic bond. Ionic bonds are typically strong and can be found in many types of compounds, including salts and minerals.

The electrostatic force is an important fundamental force in nature and plays a crucial role in many physical and chemical phenomena, such as the binding of atoms to form molecules, the behavior of charged particles in electric and magnetic fields, and the behavior of materials with electrical conductivity.

To know more about electrostatic force here

https://brainly.com/question/9774180

#SPJ4

The concentration of hydrogen ions in the solution is 1.0 x 1[tex]0^{-8}[/tex] M.

To calculate the [H+] for a solution in which [OH-] is 100 times greater than [H+], we can use the equation for the ion product constant for water:

Kw = [H+][OH-]

Where Kw is the ion product constant for water, [H+] is the concentration of hydrogen ions, and [OH-] is the concentration of hydroxide ions. Since we are given that [OH-] is 100 times greater than [H+], we can write:

[OH-] = 100[H+]

Substituting this into the equation for Kw, we get:

Kw = [H+](100[H+])

Rearranging and solving for [H+], we get:

[H+]^2 = Kw/100
[H+] = √(Kw/100)

Since Kw is 1.0 x 1[tex]0^{-14}[/tex] at 25°C, we can substitute this value into the equation and solve for [H+]:

[H+] = √(1.0 x 1[tex]0^{-14}[/tex]/100)
[H+] = √(1.0 x 1[tex]0^{-16}[/tex])
[H+] = 1.0 x 1[tex]0^{-8}[/tex]

More questions involving calculation of concentration can be obtained here: https://brainly.com/question/14652001

#SPJ11

Dissolving a solute such as KOH in a solvent such as water results in a decrease in the vapor pressure of the liquid.

This is because the solute particles occupy some of the solvent space and reduce the number of solvent molecules at the surface of the liquid, which decreases the rate of evaporation and hence the vapor pressure.

The presence of a non-volatile solute also affects the boiling point of the liquid. It causes the boiling point of the solution to be higher than the boiling point of the pure solvent, a phenomenon known as boiling point elevation.

This happens because the solute particles attract solvent molecules and reduce the ability of the solvent molecules to escape from the liquid phase as vapor, which requires an increase in temperature to boil the solution. Therefore, option B ("a decrease in the boiling point of the liquid") is incorrect.

The solute-solvent interaction also affects the melting point of the solvent. In general, the presence of a solute lowers the melting point of the solvent due to the disruption of the solvent-solvent interactions by the solute-solvent interactions. Therefore, option D ("an increase in the melting point of the liquid") is also incorrect.

Option C ("no change in the boiling point of the liquid") is not correct either, as the boiling point of the liquid is affected by the presence of the solute in the solvent, as mentioned earlier.

Hence, the correct answer is option A ("a decrease in the vapor pressure of the liquid").

To learn more about solvent click on,

https://brainly.com/question/15205310

#SPJ4

In the past when the carbon dioxide levels were about the same as they are today. The far back in the Earth's history do we have to go to see this is the correct option is 15 million years.

The Sediment cores that contain evidence that the CO₂ levels were the same as the today  were about the 15 million years ago. There is the no single, and the widely accepted response to this type of the  issues because the research has to produced the wide range of the dates, from the 800,000 to the 15 million years ago.

The atmospheric CO₂ levels is never be so high as they are the presently by digging for the ice cores and the examining the air bubbles that will result.

To learn more about CO₂ here

https://brainly.com/question/30473524

#SPJ4

The branch of physics known as "atomic physics" focuses on the study of atoms as self-contained systems made up of electrons and nuclei.

In general, the term "atomic physics" refers to the study of the structure of atoms and the interactions between atoms. The arrangement of electrons around the nucleus and the mechanisms by which this arrangement changes are major topics of interest. Unless specifically stated to consist of ions and neutral atoms, the term "atom" is meant to include ions.

Atomic physics is a term that can refer to nuclear energy and nuclear weapons.

Atomic physics, which treats an atom as a system consisting of a nucleus and electrons, differs from nuclear physics, which studies nuclear reactions and the unique properties of atomic nuclei.

To know more about atomic physics, visit,

https://brainly.com/question/621740

#SPJ4

The reactants, products and energy sources of the photosynthetic reaction are as follows:

Photosynthesis is any process by which plants and other photoautotrophs convert light energy into chemical energy.

Photosynthesis combines carbondioxide and water to produce glucose and oxygen with the dispense of energy.

Carbondioxide and water can be classified as reactants while glucose and oxygen can be regarded as products.

Learn more about photosynthesis at: https://brainly.com/question/29764662

#SPJ1

What exposing potassium t-butoxide to air can cause is;

Lung damage when inhaled

Severe chemical burns when in contact with skin

Potassium t-butoxide is a colorless solid which is a strong base, which is useful in organic synthesis.

Potassium tert-butoxide catalyzes the reaction of hydrosilanes and heterocyclic compounds to give the silyl derivatives, with release of Hydrogen gas.

This potassium t-butoxide when exposed to the air can cause respiratory irritation in some persons.

The body's response to such irritation can cause further lung damage.

Inhaling corrosive bases may irritate the respiratory tract.

The symptoms include cough, choking, pain and damage to the mucous membrane.

Persons with impaired respiratory function, airway diseases and conditions such as emphysema or chronic bronchitis, may incur

further disability if excessive concentrations of particulate are inhaled.

Read more about Impact of chemical substance at; https://brainly.com/question/899775

#SPJ1

At a pressure pf 20.9 kpa as well as a temperature near 37 °C, the mass liquid oxygen gas needed to fill a volume od 6 l is 1.56G.

It all comes together in the celebration of the Eucharist mass, the main act of worship in the Roman Catholic Church. Ite, missa est, the Latin ecclesiastical expression for the congregation's dismissal, is where the word "mass" originates.

A: An object's volume, which is expressed in cubic units, is the space that it takes up in three dimensions. Both cm3 and in3 are examples of cubic units. The quantity of matter in an item is quantified by its mass, on the other hand. How much is a common way of determining mass.

To know more about mass visit:

https://brainly.com/question/15959704

#SPJ4

The mass of the gas released is 3.98 grams - 438 grams = -434.02 grams.

Mass is a measure of the amount of matter present in an object. It is the amount of inertia a body has, meaning it is the measure of the resistance of a body to change in its motion when subjected to an external force. Mass is usually measured in kilograms, grams, or pounds. Mass is distinct from weight, which is a measure of the force of gravity acting on an object.

This result is negative because the mass of the gas is not actually being weighed, but is instead being calculated by subtracting the mass of the tablet after the reaction from the mass of the tablet before the reaction. The negative result indicates that the mass of the gas released is less than the mass of the tablet before the reaction.

To learn more about mass

https://brainly.com/question/1838164

#SPJ1

The heat of combustion per gram of candle for each trial is:

To calculate the heat of combustion per gram of candle for each trial, we  use the formula below:

Heat absorbed, Q = mcΔT

where;

Since the density of water is 1 g/mL, the volume of water = mass of water

Trial 1:

mass of candle burnt = 0.12 g

temperature change of water = 8.1° C

volume of water = 99.9 mL

Q = 99.9 * 4.184 * 8.1

Q = 3390 J or 3.39 kJ

The heat of combustion per gram =  3.39/0.12

The heat of combustion per gram = 28.3 kJ/g

Trial 2:

mass of candle burnt = 0.11 g

temperature change of water = 8.1° C

volume of water = 100 mL

Q = 100 * 4.184 * 8.1

Q = 3390 J or 3.39 kJ

The heat of combustion per gram =  3.39/0.11

The heat of combustion per gram = 30.8 kJ/g

Trial 3:

mass of candle burnt = 0.13 g

temperature change of water = 8.2° C

volume of water = 100.1 mL

Q = 100.1 * 4.184 * 8.2

Q = 3430 J or 3.43 kJ

The heat of combustion per gram =  3.43/0.11

The heat of combustion per gram = 26.4 kJ/g

Learn more about the heat of combustion at: https://brainly.com/question/11573726
#SPJ1

If only 4 moles of ethanoic acid were found in the funnel. the equation for the reaction between ethanol and ethanoic acid to form ethyl ethanoate and water is CH3CH2OH + CH3COOH ⇌ CH3COOCH2CH3 + H2O.

a) The balanced chemical equation for the reaction between ethanol and ethanoic acid to form ethyl ethanoate and water is:

CH3CH2OH + CH3COOH ⇌ CH3COOCH2CH3 + H2O

b) To determine the number of moles of each component present at equilibrium, we can use the information given in the problem statement. Initially, we have:

5 moles of ethanol

6 moles of ethanoic acid

6 moles of ethyl ethanoate

4 moles of water

At equilibrium, we have:

4 moles of ethanoic acid (so we have lost 2 moles of ethanoic acid)

5 - x moles of ethanol (where x is the number of moles of ethanol that reacted to form ethyl ethanoate)

6 moles of ethyl ethanoate (since it is a product, the amount does not change)

4 + x moles of water (since water is also a product, its amount increases as the reaction proceeds)

Since the reaction is in stoichiometric proportions, the number of moles of ethanoic acid lost is equal to the number of moles of ethyl ethanoate and water produced. Therefore, we can set up the following equation to solve for x:

2x = 2

x = 1

Therefore, at equilibrium, we have:

4 moles of ethanoic acid

4 moles of ethanol (5 - 1)

6 moles of ethyl ethanoate

5 moles of water (4 + 1)

c) The equilibrium constant for the reaction is given by the following expression:

Kc = [CH3COOCH2CH3][H2O]/[CH3CH2OH][CH3COOH]

Plugging in the concentrations at equilibrium, we get:

Kc = [(6 mol)/(L) * 5 mol/L]/[(5 mol/L) * (4 mol/L)]

Kc = 1.5

Therefore, the equilibrium constant for this reaction is 1.5. Note that since the value of Kc is greater than 1, the reaction lies to the right at equilibrium, meaning that the formation of ethyl ethanoate is favored.

Learn more about ethanol and ethanoic acid here:https://brainly.com/question/27918265

#SPJ1

The complete question is:

5 moles of ethanol, 6 moles of ethanoic acid, 6 moles of ethyl ethanoate and 4 moles of water were mixed together in a separatory funnel at 15 ° C. After equilibration was established, only 4 moles of ethanoic acid were found in the funnel. a) Write the equation for the reaction between ethanol and ethanoic acid to form ethyl ethanoate and water. b) How many moles of ethanol, ethyl ethanoate and water are present in the equilibrium mixture? d) What is the value of the equilibrium constant for this reaction?

a-Keratin has heptad repeats, has intrachain hydrogen bonds, has left-handed helices.

Collagen contains hydroxyproline, every third residue is glycine, has interchain hydrogen bonds.

Fibroin every second residue is glycine.

Alpha-keratin is a fibrous protein that is the main component of hair, nails, horns, claws, and hooves of animals. Its role is to provide structure, strength, and resilience to these tissues, which need to withstand mechanical stress and damage.

Alpha-keratin is particularly abundant in hair, where it forms the hair shaft's outer layer, or cuticle. Its structure includes an alpha-helix conformation, stabilized by hydrogen bonds between the peptide backbone's oxygen and hydrogen atoms.

Learn more on a-Keratin here: https://brainly.com/question/10703381

#SPJ1

The frequency of this sound is 2.86 Hz with a wavelength of 4.22 m and having a wave speed of 12.6 m/s.

Wavelength is the distance between repeating units of a waveform, such as points on a wave or crests and troughs. It is commonly measured in meters. The wavelength is related to the frequency of a wave by the formula wavelength = speed of wave/frequency. The speed of a wave is often determined by the medium it is traveling through; for example, sound waves travel much faster through air than through water. Wavelength is an important factor in determining the properties of a wave, such as its energy, direction, and amplitude.

To learn more about wavelength

https://brainly.com/question/29425795

#SPJ1

The one  that describes the physical appearance of the compound when the end of its melting point range is reached is the correct option is B. The compound completely converts to a liquid.

The melting point is the temperature at which the solid and the liquid will forms of the pure substance that can exist in equilibrium. The  heat is applied to the solid, and its temperature will be increase as the melting point will be reached. The more heat then will be convert to the solid into the liquid with the no temperature change.

Thus, the compound will be completely converts to the liquid as the end of its melting point range.

To learn more about melting point here

https://brainly.com/question/29578567

#SPJ4

The most important gaseous element to accumulate in the earth's atmosphere, which had to await the evolution of the photosynthesis in order to exceed its loss to the space, is oxygen. The correct option is 2.

The oxygen is the chemical element with an atomic number of 8 and oxygen atom has the eight protons and eight electrons in its nucleus. The Oxygen forms the chemical compound with formula of O₂ of two atoms which is the colorless gas at the normal temperatures and the pressures.

Thus, the oxygen the most important gaseous element to accumulate in earth's atmosphere. IT had to await evolution of the photosynthesis in order to the exceed its loss to the space.

To learn more about earth's atmosphere here

https://brainly.com/question/6334188

#SPJ4

This question is incomplete , the complete question is :

The most important gaseous element to accumulate in Earth's atmosphere, which had to await the evolution of photosynthesis in order to exceed its loss to space, is ______. multiple choice question.

1)  oceans

2) oxygen

3)  longitude

4)  minor

In a molecule, an atom's charges are assigned based on the assumption that the chemical bonds between the atoms are created by an equal distribution of electrons.

There is no regard for the atoms' relative electronegativities. The following is the formula used to determine the formal charges on the atoms: V - N - B/2. The atom's total number of valence electrons is denoted by the letter V. N is the number of electrons that do not form bonds. B is the number of electrons in a bond. Valence electrons are those found in the atom's valence/outermost shell. The oxygen atom contains six valence electrons.

To learn more about oxygen atom click here

brainly.com/question/19532510

#SPJ4

The difference between the number of valence electrons on an atom and the number of electrons it possesses in the molecule or ion is known as the formal charge (FC).

Which is a measurement of the distribution of electrons in a molecule or ion. In a molecule, an atom's charges are assigned based on the assumption that the chemical bonds between the atoms are created by an equal distribution of electrons. There is no regard for the atoms' relative electronegativities. The following is the formula used to determine the formal charges on the atoms: V - N - B/2. The atom's total number of valence electrons is denoted by the letter V. N is the number of electrons that do not form bonds. B is the number of electrons in a bond. Valence electrons are those found in the atom's valence/outermost shell. The oxygen atom contains six valence electrons.

learn more about atom  here

https://brainly.com/question/30898688

#SPJ4

Answer:

The mass of the steel wool before burning can be calculated by finding the difference between the mass of the steel wool and the mass of the iron oxide produced.

If the mass of the iron oxide produced is 715 g, then the mass of the steel wool before burning was:

Mass of steel wool before burning = Mass of steel wool + Mass of iron oxide produced

Since the steel wool was entirely converted to iron oxide, we know that the mass of iron in the steel wool is equal to the mass of iron in the iron oxide produced. Since iron has an atomic mass of 56 g/mol, we can use this to find the mass of iron in the 715 g of iron oxide:

Number of moles of iron = mass of iron oxide produced / atomic mass of iron

Number of moles of iron = 715 g / 56 g/mol

Number of moles of iron = 12.77 mol

Since the mass of iron in the steel wool is the same as the mass of iron in the iron oxide produced, we can use the same number of moles of iron to find the mass of steel wool before burning:

Mass of steel wool before burning = Number of moles of iron x (atomic mass of iron / molar mass of steel wool)

The molar mass of steel wool is the sum of the atomic masses of its constituent elements (iron and carbon) multiplied by their respective stoichiometric coefficients:

Molar mass of steel wool = (atomic mass of iron x 1) + (atomic mass of carbon x 1)

Molar mass of steel wool = (56 g/mol x 1) + (12.01 g/mol x 1)

Molar mass of steel wool = 68.01 g/mol

Substituting the known values into the equation, we get:

Mass of steel wool before burning = 12.77 mol x (56 g/mol / 68.01 g/mol)

Mass of steel wool before burning = 10.49 mol

Therefore, the mass of the steel wool before burning was:

Mass of steel wool before burning = Mass of steel wool + Mass of iron oxide produced

Mass of steel wool before burning = 715 g + (10.49 mol x 68.01 g/mol)

Mass of steel wool before burning = 1,428 g (rounded to the nearest whole number)

Explanation:

Answer:

not specific

Explanation: