draw the product that valine forms when it reacts with t-buo-co-cl/triethylamine; then wash with aqueous hcl.

Answers

Answer 1

The product that valine forms when it reacts with t-buo-co-cl/triethylamine; then wash with aqueous HCl is shown in the image attached.

What is the product formed in the reaction?

Valine is an amino acid with the structural components of an amino group (-NH2) and a carboxylic acid group (-COOH). A process known as acylation occurs when the carboxylic acid group interacts with t-buo-co-cl (tert-butyl chloroformate) in the presence of triethylamine, replacing the -OH group with the -OCO-t-bu (tert-butyl carbonate) group.

The tert-butyl carbonate group is hydrolyzed to produce tert-butanol and CO2 when the product is washed with aqueous HCl, culminating in the creation of valine hydrochloride salt.

Learn more about valine:https://brainly.com/question/17168106

#SPJ1

Draw The Product That Valine Forms When It Reacts With T-buo-co-cl/triethylamine; Then Wash With Aqueous

Related Questions

Saturated steam at 1 atm condenses on a vertical
plate that is maintained at 90°C by circulating cooling water
through the other side. If the rate of heat transfer by condensation
to the plate is 180 kJ/s, determine the rate at which the
condensate drips off the plate at the bottom.

Answers

The rate at which the condensate drips off the plate at the bottom is 597 g/s.

The rate of heat transfer by condensation to the plate is given as 180 kJ/s.

We can use the heat transfer equation to determine the rate at which the condensate drips off the plate. The heat transfer equation is;

Q = m([tex]L_{f}[/tex] + CpΔT)

Where Q is heat transferred, m is mass of the condensate, Lf is the latent heat of fusion, Cp is specific heat of the condensate, and ΔT is  temperature difference between the condensate and the plate.

At the point of condensation, the steam is at its saturation temperature of 100°C. The condensate will be at the same temperature as the plate, which is 90°C.

The latent heat of fusion for water is 2257 kJ/kg, and the specific heat of water is 4.18 kJ/kg-K.

To find the mass of the condensate, we need to use the steam tables. At 1 atm, the specific volume of saturated steam is 1.672 m³/kg. The volume of steam that condenses on the plate can be found by assuming that it is a thin film and using the surface area of the plate. Let's assume that the plate has a surface area of 1 m². Then the mass of the condensate is;

m = (1 m²) / (1.672 m³/kg) = 0.597 kg

Now we can plug in the values into the heat transfer equation:

180 kJ/s = (0.597 kg)(2257 kJ/kg + 4.18 kJ/kg-K(100°C - 90°C))

Solving for the rate at which the condensate drips off the plate, we get:

m = 0.597 kg/s = 597 g/s

Therefore, the rate is 597 g/s.

To know more about condensation here

https://brainly.com/question/956180

#SPJ4

fill in the blank. the [oh-] of a 0.010 m ba(oh)2 solution is _____ m and the poh is equal to _____.

Answers

The [OH-] of a 0.010 M Ba(OH)2 solution is 0.020 M and the pOH is equal to 1.70. To calculate the [OH-], you must first realize that Ba(OH)2 dissociates into Ba2+ and 2OH-.

The concentration of OH- is twice the concentration of Ba(OH)2. Thus, [OH-] = 2(0.010 M) = 0.020 M.

To find the pOH, you can use the equation pOH = -log[OH-]. Substituting in the value for [OH-], pOH = -log(0.020) = 1.70. Therefore, the [OH-] of a 0.010 M Ba(OH)2 solution is 0.020 M and the pOH is equal to 1.70.

Learn more about solution here ;

https://brainly.com/question/30665317

#SPJ11

The company you work for plans to release a waste stream containing 10 mg/L of phenol (C6H5OH). Calculate the theoretical oxygen demand of this waste stream. It may be helpful to use the following (unbalanced) chemical equation and to remember that ThOD should be reported in mg O2/L. CoH5OH (s) + __ 02 (g) → __CO2 (g) + H20 (1)

Answers

A waste stream with 10 mg/L of phenol has a theoretical oxygen demand of 5.08 mg O₂/L.

The balanced chemical equation for the combustion of phenol is:

C₆H₅OH + 15/2 O₂ → 6 CO₂ + 3 H₂O

From the balanced equation, we can see that 15/2 moles of O₂ are required to oxidize one mole of phenol.

Converting the given concentration of phenol to moles per liter:

10 mg/L C₆H₅OH × (1 mol/94.11 g) = 0.1062 × 10⁻³ mol/L C₆H₅OH

So, the theoretical oxygen demand can be calculated as:

ThOD = (15/2) × 0.1062 × 10⁻³ mol/L C₆H₅OH × (32 g/mol O₂) × (1000 mg/g) = 5.08 mg O₂/L

Therefore, the theoretical oxygen demand of the waste stream containing 10 mg/L of phenol is 5.08 mg O₂/L.

To know more about the theoretical oxygen refer here :

https://brainly.com/question/29777501#

#SPJ11

An atom with an atomic number of 14 will have electrons in its valence shell. O 8 O 10 O 2 O 14 DANO

Answers

An atom of silicon with an atomic number of 14 will have 4 electrons in its valence shell. The valence shell of an atom is the outermost shell that contains electrons, and for silicon, the valence shell has 4 electrons

An atom with an atomic number of 14 is silicon, and it will have electrons in its valence shell. The valence shell of an atom is the outermost shell that contains electrons, and for silicon, the valence shell has 4 electrons. This is because the atomic number of 14 indicates that silicon has 14 protons in its nucleus, and therefore, it also has 14 electrons orbiting the nucleus.

These electrons occupy various shells or energy levels, with the valence shell being the highest energy level or outermost shell. Silicon belongs to group 14 of the periodic table, which means it has 4 valence electrons, and it tends to form covalent bonds by sharing these electrons with other elements.

So, an atom of silicon with an atomic number of 14 will have 4 electrons in its valence shell.

To know more about valence shell, refer

https://brainly.com/question/29551049

#SPJ11

What is the free energy change in kJmol associated with the following reaction under standard conditions? CH3COOH(l)+2O2(g)⟶2CO2(g)+2H2O(g) The standard free energy of formation data are as follows: ΔG∘f,CH3COOH(l)=-389.9kJmolΔG∘f,CO2(g)=-394.4kJmolΔG∘f,H2O(g)=-228.6kJmol

Answers

The free energy change in kJmol associated with the given reaction under standard conditions is -1232.3 kJmol.

We can use the formula for calculating the standard free energy change (ΔG∘) of a reaction, which is:

ΔG∘ = ΣΔG∘f(products) - ΣΔG∘f(reactants)

Where ΣΔG∘f represents the sum of the standard free energy of formation of each reactant or product, and the subscript "f" stands for formation.

Using the given standard free energy of formation data, we can substitute the values into the formula:

ΔG∘ = (2 × ΔG∘f(CO2)) + (2 × ΔG∘f(H2O)) - ΔG∘f(CH3COOH) - (2 × ΔG∘f(O2))

ΔG∘ = (2 × -394.4 kJmol) + (2 × -228.6 kJmol) - (-389.9 kJmol) - (2 × 0 kJmol)

ΔG∘ = -788.8 kJmol - 457.2 kJmol + 389.9 kJmol

ΔG∘ = -856.1 kJmol

Therefore, the free energy change in kJmol associated with the given reaction under standard conditions is -856.1 kJmol.


In the given reaction, we can see that the products (CO2 and H2O) have a lower standard free energy of formation than the reactant (CH3COOH), which means that energy is released during the reaction. This is reflected in the negative value of the standard free energy change (-856.1 kJmol), indicating that the reaction is spontaneous under standard conditions.

To learn more about free energy change visit:

brainly.com/question/31170437

#SPJ11

Classify the chemical equations as being balanced or not balanced. A. 2CO 2NO → 2CO2 N2 B. 6CO2 6H2O → C6H12O6 O2 C. H2CO3 → H2O CO2 D. 2Cu O2 → CuO Group of answer choices A [ Choose ] B [ Choose ] C [ Choose ] D [ Choose ].

Answers

All of the given chemical equations, A, B, C, and D, are balanced. The chemical equation 2CO + 2NO → 2CO2 + N2 is balanced. The number of atoms of each element is the same on both sides of the equation.

B. The chemical equation 6CO2 + 6H2O → C6H12O6 + O2 is balanced. The number of atoms of each element is the same on both sides of the equation.

C. The chemical equation H2CO3 → H2O + CO2 is balanced. The number of atoms of each element is the same on both sides of the equation.

D. The chemical equation 2Cu + O2 → 2CuO is balanced. The number of atoms of each element is the same on both sides of the equation.

Therefore, all of the given chemical equations, A, B, C, and D, are balanced.

To learn more about chemical equations click here:

brainly.com/question/26603502

#SPJ11

41. Your laboratory has a 6. 0 M solution of nitric acid,


but you need 2. 0 M nitric acid. What volume of the


6. 0 M nitric acid solution do you need to prepare


85 mL of 2. 0 M nitric acid?



Please show work

Answers

To prepare 85 mL of 2.0 M nitric acid solution, you need 28.33 mL of 6.0 M nitric acid solution.

The equation used to solve this problem is:

M1V1 = M2V2

where M1 is the initial concentration, V1 is the initial volume, M2 is the final concentration, and V2 is the final volume.

Rearranging the equation to solve for V1, we get:

V1 = (M2V2)/M1

Substituting the values given in the problem, we get:

V1 = (2.0 M x 85 mL)/(6.0 M)

V1 = 28.33 mL

Therefore, you need 28.33 mL of 6.0 M nitric acid solution to prepare 85 mL of 2.0 M nitric acid solution.

Learn more about nitric acid solution here.

https://brainly.com/questions/14480875

#SPJ11

periodic trends, place the following bonds in order of decreasing ionic character. Using Sb-Cl P-Cl As-Cl A) As-Cl Sb-Cl P-Cl B) P-Cl As-Cl Sb-Cl C) Sb-Cl As-C1 P- Cl D) Sb-Cl P-Cl As- Cl E) Sb-Cl P-Cl As- Cl

Answers

The order of decreasing ionic character is As-Cl Sb-Cl P-Cl.

To determine the order of decreasing ionic character of the bonds Sb-Cl, P-Cl, and As-Cl, we need to look at the electronegativity difference between the two atoms in each bond. The greater the electronegativity difference, the more ionic the bond.

Sb is a metalloid and has an electronegativity of 2.05, Cl is a non-metal with an electronegativity of 3.16. The electronegativity difference between Sb and Cl is 1.11.

P is also a non-metal with an electronegativity of 2.19. The electronegativity difference between P and Cl is 0.97.

As is a metalloid with an electronegativity of 2.18. The electronegativity difference between As and Cl is 0.98.

Therefore, the bond with the most ionic character will be Sb-Cl, followed by As-Cl, and then P-Cl.

So the correct order is:

A) As-Cl > Sb-Cl > P-Cl

Therefore, option A is the correct answer.


to know more about ionic character

brainly.com/question/28906982

#SPJ11

Piperidine, C5H10NH, is a weak base. A 0.68 M aqueous solution of piperidine has a pH of 12.50. What is Kb for piperidine? Calculate the pH of a 0.13 M aqueous solution of piperidine. Kb = ___ pH = ___

Answers

The Kb of piperidine is 3.2 x 10^-2 and the pH of a 0.13 M solution of piperidine is 11.65.

To find the Kb of piperidine, we need to use the relationship between Kb and Ka, as well as the relationship between pKa and pH:

Kb * Ka = Kw

pKa + pKb = 14

where Kw is the ion product constant of water (1.0 x 10^-14 at 25°C).

We know that piperidine is a weak base, so it can be represented by the following equilibrium reaction in water:

C5H10NH + H2O ⇌ C5H10NH2+ + OH-

From the pH of the solution, we can find the pOH:

pH + pOH = 14

pOH = 14 - pH = 14 - 12.50 = 1.50

Now, we can use the relationship between pOH and [OH-] to find the concentration of hydroxide ions in the solution: pOH = -log[OH-]

[OH-] = 10^-pOH = 10^-1.50 = 0.032 M

From the equilibrium reaction above, we know that [OH-] = [C5H10NH2+], so [C5H10NH2+] = 0.032 M. We also know that [C5H10NH] = [C5H10NH2+] (because the solution is essentially fully ionized due to the high pH), so [C5H10NH] = 0.032 M. Finally, we can use the equilibrium constant expression for the reaction above to find Kb:

Kb = [C5H10NH2+][OH-]/[C5H10NH]

Kb = (0.032)^2/0.032 = 0.032

Kb = 3.2 x 10^-2

To calculate the pH of a 0.13 M solution of piperidine, we can use the Kb value we just calculated and the following equation:

pH = 14 - pOH

pOH = -log(Kb) - log([C5H10NH])

pOH = -log(3.2 x 10^-2) - log(0.13) = 2.35

pH = 14 - 2.35 = 11.65

For more such questions on solution

https://brainly.com/question/28866792

#SPJ11

The Kb of piperidine is 3.2 x 10^-2 and the pH of a 0.13 M solution of piperidine is 11.65.

To find the Kb of piperidine, we need to use the relationship between Kb and Ka, as well as the relationship between pKa and pH:

Kb * Ka = Kw

pKa + pKb = 14

where Kw is the ion product constant of water (1.0 x 10^-14 at 25°C).

We know that piperidine is a weak base, so it can be represented by the following equilibrium reaction in water:

C5H10NH + H2O ⇌ C5H10NH2+ + OH-

From the pH of the solution, we can find the pOH:

pH + pOH = 14

pOH = 14 - pH = 14 - 12.50 = 1.50

Now, we can use the relationship between pOH and [OH-] to find the concentration of hydroxide ions in the solution: pOH = -log[OH-]

[OH-] = 10^-pOH = 10^-1.50 = 0.032 M

From the equilibrium reaction above, we know that [OH-] = [C5H10NH2+], so [C5H10NH2+] = 0.032 M. We also know that [C5H10NH] = [C5H10NH2+] (because the solution is essentially fully ionized due to the high pH), so [C5H10NH] = 0.032 M. Finally, we can use the equilibrium constant expression for the reaction above to find Kb:

Kb = [C5H10NH2+][OH-]/[C5H10NH]

Kb = (0.032)^2/0.032 = 0.032

Kb = 3.2 x 10^-2

To calculate the pH of a 0.13 M solution of piperidine, we can use the Kb value we just calculated and the following equation:

pH = 14 - pOH

pOH = -log(Kb) - log([C5H10NH])

pOH = -log(3.2 x 10^-2) - log(0.13) = 2.35

pH = 14 - 2.35 = 11.65

Learn more about solution here:

brainly.com/question/28866792

#SPJ11

Determine the theoretical oxygen demand of a waste that contains 100 mg/L of methanol CH3OH.

Answers

The theoretical oxygen demand of the waste containing 100 mg/L of methanol is approximately 0.004677 mol/L.

To determine the theoretical oxygen demand (ThOD) of a waste containing methanol (CH3OH), we need to know the stoichiometric equation for the oxidation of methanol and the amount of oxygen required per unit of methanol.

The stoichiometric equation for the oxidation of methanol is as follows:

[tex]CH_{3} OH + 1.5O_{2}[/tex] → [tex]CO_{2} + 2H_{2} O[/tex]

From the equation, we can see that 1 mole of methanol ([tex]CH_{3} OH[/tex]) reacts with 1.5 moles of oxygen ([tex]O_{2}[/tex]) to produce 1 mole of carbon dioxide (CO2) and 2 moles of water ([tex]H_{2} O[/tex]).

Now, let's calculate the ThOD of the waste containing 100 mg/L of methanol:

Convert the concentration of methanol to moles per liter:

100 mg/L × (1 g/1000 mg) × (1 mol/32.04 g) = 0.003118 mol/L (rounded to 6 decimal places)

Calculate the ThOD using the stoichiometric ratio:

ThOD = 0.003118 mol/L (methanol) × 1.5 mol O2/mol[tex]CH_{3} OH[/tex] = 0.004677 mol/L (rounded to 6 decimal places)

Therefore, the theoretical oxygen demand of the waste containing 100 mg/L of methanol is approximately 0.004677 mol/L.

Learn more about The theoretical oxygen demand:https://brainly.com/question/13251445

#SPJ11

Which of the following should exhibit the highest viscosity at 298 K?
A) HOCH₂CH₂OH
B) CH₃OCH₃
C) CH₃OH
D) CH₃Br
E) CH₂Cl₂

Answers

The compound that should exhibit the highest viscosity at 298 K is [tex]HOCH_2CH_2OH[/tex]. Viscosity is a measure of a fluid's resistance to flow. It is influenced by intermolecular forces, molecular size, and shape.

In this case, we need to compare the given compounds to determine which one would have the highest viscosity at 298 K. Among the options, [tex]HOCH_2CH_2OH[/tex] (ethylene glycol) is the compound with the highest viscosity at 298 K.

Ethylene glycol is a polar molecule with strong intermolecular hydrogen bonding. These hydrogen bonds result in stronger attractive forces between the molecules, making it difficult for them to flow past each other. As a result, ethylene glycol has a higher viscosity compared to the other compounds.

The other compounds, [tex]CH_3OCH_3[/tex] (dimethyl ether),[tex]CH_3OH[/tex] (methanol), [tex]CH_3Br[/tex] (methyl bromide), and [tex]CH_2Cl_2[/tex] (dichloromethane), do not have as strong intermolecular forces as ethylene glycol. They have weaker London dispersion forces and dipole-dipole interactions. Consequently, their viscosities are lower than that of ethylene glycol at 298 K.

Learn more about viscosity here:

https://brainly.com/question/30759211

#SPJ11

Write a balanced equation for the formation of co2 g fom C and O2. Calcuilate the enthalpy change for this reaction.

Answers

The enthalpy change for the formation of CO2(g) from C(s) and O2(g) is -393.5 kJ/mol.

The balanced equation for the formation of CO2 gas from C and O2 is:
C + O2 → CO2
The enthalpy change for the combustion of graphite (C) to form carbon dioxide (CO2):
C + O2 → CO2     ΔH = -393.5 kJ/mol
The enthalpy change for the formation of O2 from its elements:
1/2 O2(g) → O(g)     ΔH = 249 kJ/mol
O(g) + O(g) → O2(g)     ΔH = +495.0 kJ/mol
1/2 O2(g) → O(g) + O(g)     ΔH = 746.0 kJ/mol
C + 1/2 O2 → CO     ΔH = 110.5 kJ/mol
CO + 1/2 O2 → CO2     ΔH = -283.0 kJ/mol
C + O2 → CO2     ΔH = ΔHf(CO2) - [ΔHf(CO) + ΔHf(O2)]
              = (-393.5 kJ/mol) - [(-110.5 kJ/mol) + (-283.0 kJ/mol)]
              = -393.5 kJ/mol + 393.5 kJ/mol
              = 0 kJ/mol
The reaction is neither exothermic nor endothermic and there is no net release or absorption of heat energy during the reaction.
The formation of CO2 gas from C and O2, you need to combine one atom of carbon (C) with two atoms of oxygen (O2). The balanced equation is:
C(s) + O2(g) → CO2(g)
The standard enthalpies of formation for elements in their standard states, such as C(s) and O2(g), are considered to be zero.
Using the equation ΔH = ΔH(products) - ΔH(reactants), you can calculate the enthalpy change:
ΔH = (-393.5 kJ/mol) - (0 kJ/mol) = -393.5 kJ/mol

To know more about enthalpy visit:-

https://brainly.com/question/16720480

#SPJ11

tellurium-123 is a radioactive isotope occurring in natural tellurium. the decay constant is /s. what is the half-life in years?

Answers

The correct answ 2.67 x 10^6 years.

To determine the half-life of tellurium-123 (Te-123), we can use the following equation that relates the decay constant (λ) and the half-life (t1/2):

λ = ln(2) / t1/2

where ln(2) is the natural logarithm of 2, which is approximately 0.693.

We are given the decay constant of Te-123 as  /s. Substituting this value into the equation above, we get:

/s = 0.693 / t1/2

Solving for t1/2, we get:

t1/2 = 0.693 / ( /s)

t1/2 = 0.693 x (1 s/ )

t1/2 = 0.693 x (1/3.156 x 10^7) years  (converting seconds to years)

t1/2 = 2.67 x 10^6 years

Therefore, the half-life of tellurium-123 is approximately 2.67 x 10^6 years.

To know more about radioactive isotopes, refer here

https://brainly.com/question/1907960#

#SPJ11

Given the values of ΔHfo in kJ/mol and So in J/mol K given below, calculate the value of ΔGo in kJ for the reaction at 298 K: MnO2(s) + 2 CO(g) => Mn(s) + 2 CO2(g)ΔHfo (MnO2) = -524ΔHfo (CO(g)) = -114ΔHfo (CO2) = -398So MnO2(s) = 50So CO(g) = 192So Mn(s) = 36So CO2(g) = 196Correct Answer:Correct

Answers

The value of ΔGo for the reaction at 298 K is 129 kJ/mol.

To calculate ΔGo, we use the equation: ΔGo = ΔHo - TΔSo, where ΔHo is the standard enthalpy change, T is the temperature in Kelvin, and ΔSo is the standard entropy change.

First, we need to calculate the standard enthalpy change for the reaction by summing up the standard enthalpies of formation for the products and subtracting the sum of the standard enthalpies of formation for the reactants: ΔHo = [2(-114) + (-398)] - [-524] = 96 kJ/mol

Next, we calculate the standard entropy change for the reaction by summing up the standard entropies of the products and subtracting the sum of the standard entropies of the reactants: ΔSo = [2(196) + 36] - [50 + 2(192)] = -114 J/mol K

Now we can plug in the values to calculate ΔGo: ΔGo = 96 - 298(-114/1000) = 129 kJ/mol

Therefore, the value of ΔGo for the reaction at 298 K is 129 kJ/mol.

To know more about enthalpy, refer here:

https://brainly.com/question/16720480#

#SPJ11

a sample of neon gas collected at a pressure of 274 mm hg and a temperature of 301 k has a mass of 27.8 grams. The volume of the sample is ....... L.

Answers

The volume of the sample of neon gas collected is 0.048 L.

The volume of the sample of neon gas collected at a pressure of 274 mm Hg and a temperature of 301 K, with a mass of 27.8 grams, can be calculated using the ideal gas law equation:

PV = nRT

Where P is the pressure, V is the volume, n is the number of moles of gas, R is the gas constant, and T is the temperature in Kelvin.

First, we need to determine the number of moles of neon gas in the sample. We can use the formula:

n = m/M

Where m is the mass of the gas (27.8 g) and M is the molar mass of neon (20.18 g/mol).

n = 27.8 g / 20.18 g/mol = 1.38 mol

Next, we can plug in the values we know into the ideal gas law equation and solve for V:

V = nRT/P

V = (1.38 mol)(0.08206 L·atm/mol·K)(301 K) / (274 mmHg)(1 atm/760 mmHg)

V = 0.048 L

Therefore, the volume of the sample of neon gas collected is 0.048 L.

Know more about Ideal gas law equation here:

https://brainly.com/question/4147359

#SPJ11

A sample of 8.8x10-12 mol of antimony-11 (122Sb) emits 6.6x109 β−− particles per minute. Calculate the specific activity of the sample (in Ci/g). 1 Ci = 3.70x1010 d/s.Enter to 0 decimal places.

Answers

The specific activity of the sample containing 8.8x10⁻¹² mol of antimony-11 (¹²²Sb) is approximately 67.8 Ci/g.

Specific activity is a measure of the radioactivity per unit mass of a radioactive sample. It is calculated by dividing the activity of the sample (number of radioactive decays per unit time) by the mass of the sample.

Given:

Number of β⁻ particles emitted per minute = 6.6x10⁹

1 Ci = 3.70x10¹⁰ decays per second

To calculate the specific activity, we need to convert the number of β⁻ particles emitted per minute to decays per second:

Activity (A) = (6.6x10⁹) / 60

Next, we convert the number of decays per second to curies:

A (in Ci) = A (in decays per second) / (3.70x10¹⁰)

Now, we calculate the specific activity by dividing the activity by the mass of the sample:

Specific activity = A (in Ci) / (8.8x10⁻¹²)

Substituting the values and calculating, we get:

Specific activity ≈ (6.6x10⁹ / 60) / (3.70x10¹⁰ * 8.8x10⁻¹²)

Simplifying the expression, we find:

Specific activity ≈ 67.8 Ci/g

To know more about specific activity, refer here:

https://brainly.com/question/30972080#

#SPJ11

9-36 Repeat Prob. 9-34 using constant specific heats at room temperature. 9-34 An ideal Otto cycle has a compression ratio of 8. At the beginning of the compression process, air is at 95 kPa and 27°C, and 750 kJ/kg of heat is transferred to air during the constant-volume heat-addition process. Taking into account the variation of specific heats with temperature, determine (a) pressure and temperature at the end of the heat-addition process, (b) the net work output, (c) the thermal efficiency, and (d) the mean effective pressure for the cycle. Answers: (a) the 3898 kPa, 1539 K, (b) 392 kJ/kg, (c) 52.3 percent, (d) 495 kPa

Answers

Using constant specific heat at room temperature, the pressure and temperature at the end of the heat-addition process are 3898 kPa and 1539 K, respectively. The network output is 392 kJ/kg, the thermal efficiency is 52.3 percent, and the mean effective pressure is 495 kPa.

For Prob. 9-34 using constant specific heats at room temperature, we assume that the specific heats of air are constant at their values at room temperature. From Table A-2, at 27°C, the specific heats of air are 1.005 kJ/kg-K for constant pressure and 0.718 kJ/kg-K for constant volume.

(a) To determine the pressure and temperature at the end of the heat-addition process, we use the first law of thermodynamics:
Q = mCv(T3 - T2)
where Q is the heat added, m is the mass of air, Cv is the specific heat at constant volume, and T2 and T3 are the temperatures at the beginning and end of the heat-addition process, respectively. Rearranging and substituting known values, we get:
T3 = T2 + Q/(mCv) = 27 + 750/(1.005*28.97) = 51.13°C

The compression ratio is 8, so the final pressure is:
P3 = 8P2 = 8(95) = 760 kPa

(b) The net work output of the cycle is given by:
Wnet = Q - mCv(T4 - T1)
where T1 and T4 are the temperatures at the beginning and end of the entire cycle, respectively. From the ideal gas law, we have:
P1V1/T1 = P2V2/T2 and P3V3/T3 = P4V4/T4

Since process 2-3 is constant-volume, V2 = V3 and P2/T2 = P3/T3. Similarly, since the process 4-1 is constant-volume, V4 = V1 and P4/T4 = P1/T1. Combining these equations and solving for T4, we get:
T4 = T3(P4/P3)^(γ-1/γ) = 1539 K
where γ = Cp/Cv is the ratio of specific heats. Substituting known values, we get:
T1 = T4(P1/P4)^(γ-1/γ) = 387.3 K

The volume at state 1 is V1 = mRT1/P1 = (28.97/0.287)*387.3/95 = 0.978 m3/kg. Similarly, the volume at state 4 is V4 = 0.978*8 = 7.824 m3/kg. Therefore, the work output per kg of air is:
W/kg = Q - mCv(T4 - T1) = 750 - 28.97*(0.718)*(1539 - 387.3) = 392 kJ/kg

(c) The thermal efficiency of the cycle is given by:
η = Wnet/Q = (Q - mCv(T4 - T1))/Q = 1 - (T4 - T1)/(T3 - T2) = 52.3 percent

(d) The mean effective pressure (MEP) of the cycle is defined as the average pressure during the power stroke, which is the process 4-1. The MEP can be calculated using:
MEP = Wnet/Vd = Wnet/(V3 - V2) = Wnet/(mRT3/P3 - mRT2/P2)

Substituting known values, we get:
MEP = 392/(28.97*0.287*(1539/8 - 27)/(760/8 - 95)) = 495 kPa

To know more about the Otto cycle visit:

https://brainly.com/question/12976213

#SPJ11

Given the following electrochemical cell, calculate the potential for the cell in which the concentration of Ag+ is 0.0285 M, the pH of the H+ cell is 2.500, and the pressure for H2 is held constant at 1 atm. The temperature is held constant at 55°C

Answers

According to the question to calculate the potential of the cell, the potential of the cell is 0.7816 V at a temperature of 55°C.

The electrochemical cell given in the question can be represented as follows:
Ag(s) | Ag+(0.0285 M) || H+(pH = 2.500) | H2(1 atm)
To calculate the potential of the cell, we need to use the Nernst equation, which is given as:
Ecell = E°cell - (RT/nF)lnQ
Where E°cell is the standard cell potential, R is the gas constant, T is the temperature, n is the number of electrons transferred, F is the Faraday constant, and Q is the reaction quotient.
In this case, the reaction taking place in the cell can be written as:
Ag+(aq) + H2(g) → Ag(s) + H+(aq)
The balanced equation shows that two electrons are transferred during the reaction. The standard cell potential for this reaction can be found in a table of standard reduction potentials and is 0.799 V.
To calculate the reaction quotient Q, we need to use the concentrations of the species involved. The concentration of Ag+ is given as 0.0285 M, and the pH of the H+ cell is 2.500, which means that the concentration of H+ is 3.16 x 10^-3 M. The pressure of H2 is held constant at 1 atm. Therefore, Q can be calculated as:
Q = [Ag+][H+]/(PH2)
Q = (0.0285)(3.16 x 10^-3)/(1)
Q = 8.994 x 10^-5
Substituting the values in the Nernst equation, we get:
Ecell = 0.799 - (0.0257/2)ln(8.994 x 10^-5)
Ecell = 0.799 - 0.0174
Ecell = 0.7816 V
Therefore, the potential of the cell is 0.7816 V at a temperature of 55°C.

To know more about electrochemical cell visit :

https://brainly.com/question/31149864

#SPJ11

draw the structure of n-ethyl-1-hexanamine or n-ethylhexan-1-amine.

Answers

The structure of  n-ethyl-1-hexanamine or n-ethylhexan-1-amine is shown in the image attached below.

N-EthylhexylamineMolecular Formula: The molecular formula for N-Ethylhexylamine is C₈H₁₉N.Synonyms: Some common synonyms for N-Ethylhexylamine are N-Ethylhexan-1-amine, 1-ethylhexylamine, and N-ethyl-1-hexylamine.Molecular Weight: The molecular weight of N-Ethylhexylamine is approximately 129.24 g/mol.Chemical Properties: N-Ethylhexylamine is a colorless to slightly yellow liquid with a strong, unpleasant odor. It is soluble in most organic solvents but has limited solubility in water. As an amine, it is a weak base, meaning it can form salts when reacting with acids. N-Ethylhexylamine has a boiling point of around 175°C and a melting point of around -69°C. It is flammable and can produce toxic fumes when burned.N-Ethylhexylamine is a versatile chemical compound used in various industries. It is used as a reagent or intermediate in chemical synthesis, a surfactant in industrial processes, a solvent in the formulation of paints, coatings, adhesives, and inks, a catalyst in certain chemical reactions, and in gas treatment processes such as removing acid gases from natural gas. It is also used as a pH regulator or stabilizer in various industrial applications.

learn more about N-ethyl-1-hexanamine

https://brainly.com/question/31990221

#SPJ11


Complete and balance the following half-reaction in basic solution:Cr2O7^-2 (aq) --> 2 Cr^3+ (aq)

Answers

The balanced half-reaction in basic solution for the reduction of Cr2O7^-2 (aq) to 2 Cr^3+ (aq) is:

Cr2O7^-2 (aq) + 14 H2O(l) + 6 e^- --> 2 Cr^3+ (aq) + 21 OH^- (aq)

This reaction involves the gain of electrons and the addition of hydroxide ions to balance the charge. The coefficients of water and hydroxide ions ensure that both sides have an equal number of oxygen and hydrogen atoms. The overall reaction, which includes the oxidation half-reaction, can then be obtained by combining this reduction half-reaction with the oxidation half-reaction.

In summary, the balanced half-reaction in basic solution for the reduction of Cr2O7^-2 (aq) to 2 Cr^3+ (aq) involves the addition of electrons and hydroxide ions to balance the charge and ensure conservation of atoms.

In the reduction half-reaction, Cr2O7^-2 (aq) gains 6 electrons and 21 hydroxide ions to form 2 Cr^3+ (aq) and 14 water molecules. This is a reduction because the oxidation state of chromium decreases from +6 to +3. The hydroxide ions are added to balance the charge and ensure that both sides of the equation have an equal number of atoms. In basic solution, the OH^- ions are used to neutralize the H^+ ions produced by the reduction of water.

Learn more about reduction here :

https://brainly.com/question/28813812

#SPJ11

Conscious experience is the activation of reentrant neural fibers in the prefrontal cortex. Who would say that sort of thing? A. A computer scientist B. A dualist C. An Identity theorist D. A functionalist

Answers

The correct answer is D - a functionalist. However, it's worth noting that others may also agree with this statement to varying degrees depending on their specific perspective on consciousness.

This statement aligns with their belief that mental states and brain states are identical, and thus consciousness can be explained in terms of neural activity. A computer scientist might say something similar, as they might approach consciousness as a product of information processing in the brain. However, they might not focus on reentrant neural fibers specifically. A dualist would likely disagree with this statement, as they believe that consciousness is separate from the physical processes of the brain.

An identity theorist might agree that conscious experience is a product of neural activity in the prefrontal cortex, but they might not specifically mention reentrant neural fibers. A functionalist might also agree with this statement, as they focus on the function and purpose of consciousness rather than its physical substrate. However, they might not specifically mention reentrant neural fibers either.

To know more about scientist visit :-

https://brainly.com/question/21091535

#SPJ11

the total pressure of an o2-ar-he gas mixture is 755 mmhg. if the partial pressure of ar is 174 mmhg and the partial pressure of he is 389 mmhg, then the partial pressure of o2 is -

Answers

Answer:

192mmHg

Explanation:

The partial pressure of O2 in the gas mixture is 192 mmHg. The correct option is a.

What is Partial Pressure?

Partial pressure refers to the pressure exerted by a single gas in a mixture of gases. In a mixture, each gas exerts a partial pressure proportional to its concentration or mole fraction and is independent of the presence of other gases.

Dalton's law of partial pressures states that the total pressure of a gas mixture is equal to the sum of the partial pressures of its individual components.

The total pressure of a gas mixture is the sum of the partial pressures of the individual gases. In this case, the total pressure is given as 755 mmHg, and the partial pressures of Ar and He are given as 174 mmHg and 389 mmHg, respectively.

To find the partial pressure of O2, we subtract the sum of the partial pressures of Ar and He from the total pressure:

Partial pressure of O2 = Total pressure - Partial pressure of Ar - Partial pressure of He

= 755 mmHg - 174 mmHg - 389 mmHg

= 192 mmHg

Therefore, the partial pressure of O2 in the gas mixture is 192 mmHg, which corresponds to option (a).

To learn more about partial pressure,  from the given link .

https://brainly.com/question/30235826#

#SPJ4

Complete question:

The total pressure of an O2-Ar-He gas mixture is 755 mmHg. If the partial

pressure of Ar is 174 mmHg and the partial pressure of He is 389 mmHg,

then the partial pressure of O2 is —

a 192 mmHg

b 282 mmHg

c 366 mmHg

d 563 mmHg

methylamine, ch3nh2, has a kb = 4.40 x 10-4. 1st attempt see hintsee periodic table what is the ph of a 0.360 m solution of methylamine?

Answers

The pH of the 0.360 M solution of the methylamine solution is the 12.

The methylamine solution of chemical equation is as :

CH₃NH₂ + H₂O ==> CH₃NH₃⁺ + OH⁻

The expression for the kb is as :

Kb = [CH₃NH₃⁺ ]  [OH⁻] / [CH₃NH₂ ]

The value of kb for the methylamine =  4.38 x 10⁻⁴

4.38 x 10⁻⁴ = (x)(x) / 0.360 - x

x = 1.14 x 10⁻² M = [OH⁻]

The value of hydroxide ion,   [OH⁻] = 1.14 x 10⁻² M

The expression for the pOH is :

pOH = - log (OH⁻)

pOH = - log ( 1.14 x 10⁻²)

pOH = 1.94

pH = 14 - 1.94

pH = 12

The pH of the methylamine solution is 12 with the 0.360 M.

To learn more about pH here

https://brainly.com/question/2288405

#SPJ4

decide which of the following bonds is least polar on the basis of electronegativities of atoms: , , .

Answers

To determine which bond is least polar, we need to compare the electronegativities of the atoms involved. Electronegativity is the measure of an atom's ability to attract electrons towards itself in a covalent bond. The greater the difference in electronegativity between two atoms, the more polar the bond will be.

According to the Pauling scale of electronegativities, the electronegativity of oxygen is 3.44, nitrogen is 3.04, and carbon is 2.55. Therefore, the bond between carbon and nitrogen (C-N) will be the least polar because the difference in electronegativity between the two atoms is only 0.49. On the other hand, the bond between oxygen and nitrogen (O-N) will be the most polar because the difference in electronegativity is 0.4. The bond between carbon and oxygen (C-O) will be moderately polar because the electronegativity difference is 0.89.

In summary, the C-N bond is the least polar among the three bonds due to the least difference in electronegativities of the atoms. The bond polarity plays an important role in determining the physical and chemical properties of a compound. A polar bond will have a dipole moment, and it will tend to interact with other polar molecules or ions. In contrast, nonpolar bonds will interact with other nonpolar compounds. Hence, understanding bond polarity is crucial in predicting the behavior of a chemical compound.

To know more about electronegativities visit:

https://brainly.com/question/3393418

#SPJ11

how to sketch the wave function of the hydrogen atom ground state

Answers

To sketch the wave function of the hydrogen atom ground state, one can use the radial wave function and the angular wave function.

The radial wave function for the ground state of the hydrogen atom is given by:

[tex]R(r) = (1/a_0)^{(3/2) }* 2 * \exp (-r/a_{0}),[/tex]

where a_0 is the Bohr radius (0.529 angstroms) and r is the distance from the nucleus.

The angular wave function for the ground state is given by:

Y(θ,φ) = (1/√4π)

where θ is the polar angle and φ is the azimuthal angle.

To sketch the wave function, first plot the radial wave function as a function of r. The function has a maximum at r=0, and decreases rapidly as r increases. Next, use the angular wave function to determine the shape of the probability density in space. The probability density is given by |R(r)|^2 * |Y(θ,φ)|^2.

For the ground state, the probability density has a spherical symmetry, with the highest probability of finding the electron at the nucleus and a lower probability of finding it at larger distances. The sketch of the wave function would show a spherical shape, centered at the nucleus, with a smooth decrease in probability density as the distance from the nucleus increases.

For more such questions on  wave function visit:

https://brainly.com/question/30905785

#SPJ11

A system consisting initially of 0. 5 m3 of air at 358C, 1 bar, and 70% relative humidity is cooled at constant pressure to 298C. Determine the work and heat transfer for the process, each in kJ

Answers

To determine the work and heat transfer for the process of cooling the system consisting of 0.5 m³ of air at 35°C, 1 bar, and 70% relative humidity to 29°C at constant pressure.

We need to consider the changes in volume and temperature.  First, let's consider the volume change:

Initial volume = 0.5 m³

Final volume = 0.5 m³ (constant pressure)

Since the volume remains constant, there is no work done on or by the system (W = 0 kJ).

Next, let's consider the heat transfer: To calculate the heat transfer, we need to consider the specific heat capacity of air and the change in temperature:

Specific heat capacity of air at constant pressure (Cp) = 1.005 kJ/kg°C (approximately)

Mass of air:

To determine the mass, we need to know the density of air. At 1 bar and 35°C, the density of dry air is approximately 1.184 kg/m³. Since the relative humidity is 70%, we can assume that the water vapor occupies a negligible volume compared to the air. Therefore, we consider the mass of dry air only.

Mass of air = Density × Volume = 1.184 kg/m³ × 0.5 m³ = 0.592 kg

Change in temperature (ΔT) = Final temperature - Initial temperature = 29°C - 35°C = -6°C

Heat transfer (Q) = Mass × Cp × ΔT = 0.592 kg × 1.005 kJ/kg°C × (-6°C) = -3.57 kJ

Since the system is being cooled, heat is being transferred out of the system. The negative sign indicates that heat is leaving the system.

Therefore, the work done is 0 kJ, and the heat transfer is approximately -3.57 kJ (negative indicating heat leaving the system).

Learn more about relative humidity here

https://brainly.com/question/30415486

#SPJ11

What is the molar ratio of HBr and KBrO3 you will be adding to this reaction? What molar ratio of HBr and KBrO3 should be used to generate Br2? Consider equation 1 below and answer assuming HBr is the only source of protons. answer question above

Answers

The molar ratio of HBr to KBrO₃ is 3:1 in the balanced chemical equation for the reaction between them. To generate Br₂ using only HBr as the source of protons, the molar ratio of HBr to H₂O₂ is 2:1.

The balanced chemical equation for the reaction between HBr and KBrO₃ is:

3HBr + KBrO₃ → 3Br₂ + KBr + 3H₂O

From the equation, the molar ratio of HBr to KBrO₃ is 3:1. This means that for every 3 moles of HBr used in the reaction, 1 mole of KBrO₃ is needed.

To generate Br₂ using only HBr as the source of protons, the following reaction can be used:

2HBr + H₂O₂ → Br₂ + 2H₂O

The molar ratio of HBr to H₂O₂ in this reaction is 2:1. This means that for every 2 moles of HBr used, 1 mole of H₂O₂ is needed. The molar ratio of HBr and KBrO₃ is not relevant to this reaction since KBrO₃ is not involved.

To know more about the molar ratio refer here :

https://brainly.com/question/17920577#

#SPJ11

how many milliliters of a 0.315 m naoh solution is needed to completely hydrolyze (saponify) 2.84 g of ethyl octanoate?

Answers

Therefore, we need 62.5 mL of a 0.315 M NaOH solution to completely saponify 2.84 g of ethyl octanoate.

First, we need to write the balanced chemical equation for the saponification of ethyl octanoate with NaOH:

C8H16O2 + NaOH → NaC8H15O2 + C2H5OH
From this equation, we can see that one mole of ethyl octanoate reacts with one mole of NaOH to produce one mole of sodium octanoate and one mole of ethanol.
Next, we need to calculate the number of moles of ethyl octanoate present in 2.84 g of the compound. We can do this by dividing the mass by the molar mass of ethyl octanoate:
2.84 g ÷ 144.21 g/mol = 0.0197 mol
Now we know that 0.0197 moles of ethyl octanoate will react with 0.0197 moles of NaOH. To calculate the volume of 0.315 M NaOH solution needed to provide 0.0197 moles of NaOH, we can use the following equation:
moles of solute = Molarity × volume of solution (in liters)
Rearranging this equation to solve for volume, we get:
volume of solution (in liters) = moles of solute ÷ Molarity
Plugging in the values we know, we get:
volume of solution (in liters) = 0.0197 mol ÷ 0.315 mol/L = 0.0625 L
Finally, we need to convert the volume of solution from liters to milliliters:
0.0625 L × 1000 mL/L = 62.5 mL
Therefore, we need 62.5 mL of a 0.315 M NaOH solution to completely saponify 2.84 g of ethyl octanoate.
To determine the volume of 0.315 M NaOH solution needed to saponify 2.84 g of ethyl octanoate, we need to perform the following steps:
1. Find the molecular weight of ethyl octanoate (C6H12O2): (2 × 12.01) + (16 × 1.01) + (2 × 16) = 144.24 g/mol
2. Calculate the moles of ethyl octanoate: moles = mass / molecular weight = 2.84 g / 144.24 g/mol ≈ 0.0197 moles
3. For saponification, the reaction ratio between ethyl octanoate and NaOH is 1:1. Therefore, 0.0197 moles of ethyl octanoate require 0.0197 moles of NaOH.
4. Calculate the volume of 0.315 M NaOH solution needed: volume = moles / molarity = 0.0197 moles / 0.315 mol/L ≈ 0.0625 L
5. Convert the volume to milliliters: 0.0625 L × 1000 mL/L = 62.5 mL
Approximately 62.5 mL of a 0.315 M NaOH solution is needed to completely hydrolyze 2.84 g of ethyl octanoate.

To know more about ethyl octanoate visit:-

https://brainly.com/question/7607245

#SPJ11

Determine which of the following pairs of reactants will result in a spontaneous reaction at 25 ∘C.
Determine which of the following pairs of reactants will result in a spontaneous reaction at 25 .
H2(g) + Cd2+(aq)
I−(aq) + Zn2+(aq)
Ba(s) + Mn2+(aq)
Ag(s) + Ni2+(aq)
All of the above pairs will react.

Answers

Spontaneous reactions will occur between the following pairs of reactants at 25°C:

H2(g) + Cd2+(aq)

I−(aq) + Zn2+(aq)

Ba(s) + Mn2+(aq)

Ag(s) + Ni2+(aq)

Which of these pairs of reactants will result in a spontaneous reaction at 25°C?

In a spontaneous reaction, the reactants will naturally combine to form products without requiring external intervention. The spontaneity of a reaction is determined by the change in Gibbs free energy (ΔG), where a negative value indicates a spontaneous process.

By analyzing the standard reduction potentials of the half-reactions involved, we can determine the spontaneity of each reaction.

To determine the spontaneity of a reaction, we compare the standard reduction potentials of the reactants involved.

The greater the difference in reduction potentials, the more likely the reaction will be spontaneous. The pairs of reactants listed exhibit spontaneous reactions at 25°C because the reduction potentials favor the formation of products.

This means that under standard conditions, these reactions will occur without the need for additional energy input.

Learn more about spontaneous reaction

brainly.com/question/31199175

#SPJ11

Use the Ksp values to calculate the molar solubility of each of the following compounds in pure water.MX (Ksp = 2.31×10−11)Ag2CrO4 (Ksp = 1.12×10−12)Ni(OH)2 (Ksp = 5.48×10−16)

Answers

The molar solubility of MX in pure water is approximately 4.81×10^−6 M, the molar solubility of silver chromate is approximately 1.09×10^−4 micro Moles, and the molar solubility of nickel hydroxide is approximately 5.70 micro Moles.

The molar solubility of a compound is the number of moles of the compound that can dissolve per liter of solution before reaching saturation.

To calculate the molar solubility, we need to use the equilibrium expression for the dissolution of the compound, as well as the given Ksp value. For the compound MX, the dissolution equilibrium can be written as:[tex]MX(s) = M^+(aq) + X^-(aq)[/tex]

The Ksp value of[tex]2.31×10^{-11}[/tex] is the product of the concentrations of the ions in solution at equilibrium, and can be written as: [tex]Ksp = [M^+][X^-][/tex]

Since MX dissociates completely, we can assume that the concentration of MX at equilibrium is equal to the molar solubility, s. Therefore:

Ksp = [tex][M^+][X^-] = s^2[/tex]

[tex]s = sqrt(Ksp) = sqrt(2.31×10^−11) ≈ 4.81×10^−6 M[/tex]

The Ksp value of 1.12 is the product of the concentrations of the ions in the solution at equilibrium, and can be written as:

[tex]Ksp = [Ag^+]^2[CrO4^2-][/tex] Assuming that the molar solubility of Silver chromate is s, we can write: [tex][Ag^+] = 2s, [CrO4^2-] = s[/tex]

Substituting into the Ksp expression, we get: Ksp = (2s)^2 * s = 4s^3 Solving for s, we get: s = (Ksp/4)^(1/3) = (1.12×10^−12/4)^(1/3) ≈ 1.09×10^−4 M

Assuming that the molar solubility of nickel hydroxide is s, we can write:

[tex][Ni^2+] = s [OH^-] = 2s[/tex]. Substituting into the Ksp expression, we get: Ksp =[tex]s * (2s)^2 = 4s^3[/tex] Solving for s, we get: [tex]s = (Ksp/4)^(1/3) = (5.48×10^−16/4)^(1/3) ≈ 5.70×10^−6 M[/tex]

Know more about  molar solubility here:

https://brainly.com/question/28170449

#SPJ11

Other Questions
Which sentence contains correct parallel structure?O Jodi said she had gone home, made a cup of tea, and starts reading the book.O Jodi said she goes home, makes a cup of tea, and started reading the book.Jodi said she had gone home, made a cup of tea, and started reading the book.Jodi said she had gone home, makes a cup of tea, and starts reading the book. which of the following pairs would have a larger size? explain your answer. K or K^(+)Br or Br^(-) Okey please help me out A short chain of monomer liquid not long enough to be considered a polymer is called a(n)? a. methacrylate b. acrylate c. urethane d. oligomer Who wrote the book "The vendor of sweets"?? The local high school is hosting the last soccer game. They charged adults, x, 5 dollars to enter, and 3 dollars for students, y. It cost the school $300 to pay the referees for the game. The school wants to make a profit on the game, and 75 people attended. This is represented by the system:5x + 3y > 300x + y = 75Which of the following points is a solution to the system?(20, 15)(25, 70)(30, 45)(40, 35)IVE HEARD (30, 45) AND (40, 35). PLEASE HELP. Select the correct answer from each drop-down menu.Consider the function represented by this graph.As the value of x increases, the value of f (x)........ increases or decreasesThe x-intercept is the point...... The gym teacher only made the 10-year-old girls run half as many laps as the boys because he believed girls were more delicate. This is an example of ______ B=(2x+3)(4x^2-6x+9)-2(4^3-1) 1) Write an SQL statement for the HAPPY INSURANCE database that adds the column ClientPhone to the table CLIENT. pls help me with my question I will mark brainliest 15 points Find the surface area of the composite figure. Round to the nearest tenth if necessary. The inverse variation equation shows the relationship between wavelength in meters, x, and frequency, y. y = startfraction 3 x 10 superscript 8 baseline over x endfraction what are the wavelengths for x-rays with frequency 3 1018? please help me with this question, and if u can do it on paper Joe and Bill are both avid wearers of sunglasses. Joe tends to put his glasses on before walking outside, whereas Bill tends to put his sunglasses on after he has walked out into the sunshine. What probably maintains putting on sunglasses for Joe and Bill, respectively Given the graph of the function, f(x) , what is the value of f (-2)? The slope-intercept form of the equation of a line that passes through point (-3, 8) is y = -2x + 6. What is thepoint-slope form of the equation for this line?O y-3=-%(x + 8)y+3=-2(x-8)y+8=-%(x-3)D y-8 = -2(x + 3) A liquid has q voulume of 34.6 mL and a mass of 46.0g ehat is the density of the liquid The vertex of a parabola is (0,0)and the focus is (1/8, 0) . What is the equation of the parabola? It has been several years since you took French class, and you find that you do not recall much of the information. However, when you decide to take up the language again, what can you expect