find an expression for t1 , the tension in cable 1, that does not depend on t2 . express your answer in terms of some or all of the variables m , θ1 , and θ2 , as well as the magnitude of the acceleration due to gravity g . you must use parentheses around θ1 and θ2 , when they are used as arguments to any trigonometric functions in your answer.

Answers

Answer 1

The expression for tension T₁ in cable 1 is calculated to be mgcosθ₁/(sinθ₁ + sinθ₂).

The angle made by strings 1 and 2 are θ₁ and θ₂ respectively. Tension in the strings 1 and 2 are T₁ and T₂ respectively.

Considering the diagram attached, the following tension components are written as,

The energy is directed downward by the weight of the block pressing against the body.

Vertical component of T₁ is T₁ sinθ₁ which acts upwards.

Horizontal component of T₁ is T₁ cosθ₁ which acts to the left.

Vertical component of T₂ is T₂ sinθ₂ which acts upwards.

Horizontal component of T₂ is T₂ cosθ₂ acting towards right.

To maintain an equilibrium, the upward forces and downwards forces must be equal even as the forces on the right and left hand side must be balanced.

Therefore, balancing the vertical components we obtain,

T₁ sinθ₁ + T₂ sinθ₂ = mg

For horizontal forces, T₁ cosθ₁ = T₂ cosθ₂

Re-arranging the above equation and making T₂ the subject of the formula, we can write it as,

T₂ = T₁ cosθ₁/cosθ₂

Substituting T₂ into the vertical component we get,

T₁ sinθ₁ + (T₁ cosθ₁/cosθ₂)sinθ₂ = mg

Multiply by cosθ₂ on both sides, we obtain,

T₁ sinθ₁ cosθ₂ + T₁ cosθ₁ sinθ₂ = mg cosθ₂

T₁ (sinθ₁ cosθ₂ + cosθ₁ sinθ₂) = mg cosθ₂

As we know the formula for sin(a + b) as sin(a)cos(b)+sin(b)cos(a), we get the above equation as,

T₁ sin(θ₁ + θ₂) = mg cosθ₂

Making T₁ as subject, we have,

T₁ = mg cosθ₂/sin(θ₁ + θ₂)

Thus, the equation for T₁ is deduced.

The given question is incomplete without the diagram. The diagram is attached in the attachment below.

To know more about tension:

https://brainly.com/question/30264095

#SPJ4

Find An Expression For T1 , The Tension In Cable 1, That Does Not Depend On T2 . Express Your Answer

Related Questions

If Alex wishes to rotate his skateboard, then he must apply a- pause before bearing down on the board.- torque- rotational maneuver

Answers

If Alex wishes to rotate his skateboard, he must apply a torque where the axis is the central axis of the skateboard.

If Alex wishes to rotate his skateboard, he must apply a torque. Torque is the twisting force that causes an object to rotate around an axis. In this case, the axis is the central axis of the skateboard.

To apply torque, Alex needs to apply a force to the skateboard that is perpendicular to the axis of rotation. This force will cause the skateboard to start rotating. However, just applying a force may not be enough to complete the rotation. Alex also needs to control the direction and speed of the rotation.

To do this, he may need to pause before bearing down on the board. This pause allows him to position his body and feet properly for the maneuver. Once he is in the right position, he can then apply the necessary force to initiate the rotation.

The rotational maneuver involves shifting the weight of the body and the position of the feet while the skateboard is rotating. By controlling the direction and speed of the rotation with the torque, Alex can perform various types of rotational maneuvers such as a kickflip, heelflip, or 360 spin.

Learn more about torque here:

https://brainly.com/question/28220969

#SPJ4

a carnot engine operates between a high temperature reservoir at 435k and a reservoir with water at 280k. if it absorbs 3700j of heat each cycle, how much work per cycle does it perform?

Answers

The required Carnot engine performs 1318.31 J of work per cycle.

What is the Carnot engine?

The Carnot engine is an idealized heat engine that operates between two thermal reservoirs and is the most efficient engine possible for a given set of thermal reservoirs. The efficiency of a Carnot engine is given by the formula:

[tex]Efficiency = 1 - (T_{low} / T_{high})[/tex]

In this problem, the high-temperature reservoir is at 435 K and the low-temperature reservoir is at 280 K. Therefore, the efficiency of the Carnot engine is:

Efficiency = 1 - (280/435) = 0.3563 or 35.63%

The Carnot engine absorbs 3700 J of heat each cycle. Therefore, the work performed per cycle by the engine is:

Work = Efficiency * Heat absorbed
          = 0.3563 * 3700 J = 1318.31 J

Therefore, the Carnot engine performs 1318.31 J of work per cycle.

Learn more about the Carnot engine here:

https://brainly.com/question/14680478

#SPJ1

what properties define a mineral? (select all that apply) naturally occurring solid element or compound definite crystalline structure definite chemical composition

Answers

The properties that define a mineral include being a naturally occurring solid with a definite crystalline structure and a definite chemical composition.

Therefore, the correct options are:

Naturally occurringSolidDefinite crystalline structureDefinite chemical composition

Naturally occurring means that the mineral is formed by natural processes, rather than being artificially created. Being a solid means that the mineral has a fixed shape and volume, and is not a liquid or gas. The crystalline structure of a mineral refers to the specific arrangement of atoms or molecules that make up its crystal lattice. Finally, the definite chemical composition of a mineral means that it has a specific set of chemical elements in a fixed proportion, which gives it distinct physical and chemical properties.

Overall, these properties help to distinguish minerals from other types of materials and allow them to be identified and studied based on their unique characteristics.

Learn more about crystal lattice :

https://brainly.com/question/10281663

#SPJ4

a fishing pole is 2.00m long and inclined to the horizontal at an angle of 20 degrees. what is the torque exerted by the fish about an axis perpendicular to the page and passing through the hand of the person holding the pole?

Answers

The torque exerted by the fish about an axis perpendicular to the page and passing through the hand of the person holding the pole is approximately 6.84 N·m.

What is Torque?

It is commonly denoted by the symbol τ (tau) and is given by the product of the force .

The torque exerted by the fish about an axis perpendicular to the page and passing through the hand of the person holding the pole can be calculated using the formula:

τ = r × F × sin(θ)

where τ is the torque, r is the lever arm or the distance between the axis of rotation and the point where the force is applied, F is the force applied, and θ is the angle between the lever arm and the direction of the force.

In this case, the force applied is the force exerted by the fish on the fishing line, and the lever arm is the distance between the axis of rotation (the hand of the person holding the pole) and the point where the force is applied (the end of the fishing pole).

We can find the lever arm using trigonometry:

r = L × sin(θ)

where L is the length of the fishing pole.

Substituting the given values, we get:

r = 2.00 m × sin(20°) ≈ 0.684 m

Now we need to determine the force applied by the fish on the fishing line. This will depend on the weight of the fish and the tension in the fishing line. Without more information, we cannot calculate this force.

Assuming a force of 10 N, for example, we can calculate the torque as:

τ = 0.684 m × 10 N × sin(90°) = 6.84 N·m

Learn more about Torque from given link

https://brainly.com/question/17512177

#SPJ1

The dielectric in a capacitor serves two purposes. It increases the capacitance, compared to an otherwise identical capacitor with an air gap, and it increases the maximum potential difference the capacitor can support. If the electric field in a material is sufficiently strong, the material will suddenly become able to conduct, creating a spark. The critical field strength, at which breakdown occurs, is 3.0 MV/m for air, but 60 MV/m for Teflon.A parallel-plate capacitor consists of two square plates 18cm on a side, spaced 0.60mm apart with only air between them. What is the maximum energy that can be stored by the capacitor?Express your answer using two significant figures.Uair = 7.7

Answers

when just air is present between the plates, the capacitor can hold a maximum amount of energy of about 0.00029 J, or 2.87 x 10-4 J.

To get the greatest amount of energy the parallel-plate capacitor can hold, we must use the following formula:

C = ε0A/d

where 0 is the permittivity of free space (a constant equal to 8.85 x 1012 F/m), A is the area of each plate, d is the distance between the plates, and C is the capacitance.

Next, we can use the formula for the energy stored in a capacitor:

U = (1/2)CV^2

Vmax = Ed = (3.0 x 10^6 V/m)(0.0006 m) = 1800 V

Now we can calculate the maximum energy stored by the capacitor:

U = (1/2)(9.96 x 10^-11 F)(1800 V)^2 = 2.87 x 10^-4 J

Therefore, when just air is present between the plates, the capacitor can hold a maximum amount of energy of about 0.00029 J, or 2.87 x 10-4 J.

Learn more about capacitor:
https://brainly.com/question/29100869

#SPJ4

CHALLENGE A stationary billiard ball with mass 0.17 kg is
struck by an identical ball moving 4.0 m/s. Afterwards, the
second ball moves 60.0° to the left of its original direc-
tion. The stationary ball moves 30.0° to the right of the
moving ball's original direction. What is the velocity of
each ball after the collision?

Answers

After even a collision, each ball's velocity throughout the given equation is 0.52 m/s.

What is called a collision?

During physics, collision, which is also known as impact, is the abrupt, powerful coming together in close proximity of two bodies, such as two pool cues, a golf club as well as a ball, a hammering and a nail, two railcars when linked, or a tumbling object as well as a floor.

Thus, let u be the starting velocity & v be the ending velocity.

Then, m1 u1+ m2 u2 = m1 v1 + m1 v2

m1 =  0.17 kg

u1 = 4 m/s

m2 = 0.17 kg

u2 = 0

following initial momentum = 0.17 × 4 m/s + 0 = 0.68 kg m/s

v1 = 3.5 m/s

0.68 kg/s = (0.17 3.5 m/s) plus (0.17 v2)

then v2 = 0.52 m/s.

Ball B will therefore collide with ball A at a speed of 0.52 m/s.

To know more about collision visit:

brainly.com/question/29298796

#SPJ1

if a satellite is in orbit around jupiter and an identical satellite is in orbit around the earth, which satellite would experience a greater attractive force?

Answers

Answer:

This is a somewhat difficult question:

the acceleration at the surface of Jupiter is about 26 m/s^2 while the acceleration at the surface of earth is 9.8 m/s^2 - however Jupiter has a density of only 1/4 that of earth while its diameter is about 11 times that of earth - one needs to consider the distance of the satellite from the center of rotation

Near the surface of each planet the acceleration of Jupiter would be greater, but Jupiter has most of its mass outside of this radius (of Earth)

M is proportional to R^3 so one can see that even tho density of Jupiter is less than that of Earth almost all of Jupiter's volume occurs at a radius greater that of Earth

F = K M m / R^2         describes the force of attraction on a mass m, but one needs to consider R and at the surface R is 11X greater for Jupiter  

as the atoms move even closer which force is the strongest

Answers

The electromagnetic force is the most powerful force that is present as atoms come together.

One of the four fundamental forces of nature, the electromagnetic force governs interactions between electrically charged particles like electrons and protons. Electrostatic forces can grow quite strong as atoms approach closer to one another and their individual electron clouds start to overlap.

Compared to other fundamental forces like gravitation and the weak nuclear force, which are weaker as particle distance rises, the electromagnetic force is much stronger. The strong nuclear force is superior than the electromagnetic force across distances of the order of the size of atomic nuclei, although it is only strong over very short distances.

To learn more about Electromagnetic force :

https://brainly.com/question/807785

#SPJ4

4. when a person passes you on the street, you do not feel a gravitational pull. explain.

Answers

Their mass is small enough to produce a significant gravitational pull on your body due to inverse square law of gravity.

All objects in the universe exert a gravitational pull on each other, as described by Newton's law of universal gravitation. The magnitude of this force is proportional to the masses of the objects and the distance between them. However, in most cases, the force of gravity between everyday objects is too small to be noticeable.

The force of gravity between two people is determined by their masses and the distance between them. Since the masses of two people are relatively small compared to, say, the mass of the Earth, the gravitational force between them is negligible.

Furthermore, the distance between two people passing each other on the street is relatively large compared to their masses. The gravitational force between two objects decreases rapidly with distance, becoming very small at distances much larger than the size of the objects. Hence, the gravitational pull between two people passing each other on the street is too small to be felt or noticed.

Learn more about gravitational pull here:

https://brainly.com/question/13467280

#SPJ4

A force of 100 N was necessary to lift a rock. A total of 150 J of work was done, How far was the rock lifted?

Answers

Answer:1.5m

Explanation:

Equation:

Work= F(d)

Data:

Work= 150J

Force= 100N

Distance= ?

Work:

150J=100N(d)

150/100= d

d=1.5m


Record your data for each trial in the table below.
Size of Wire
(Gauge)
Material of Wire
Voltage
Number of
Winds
Resulting Paper
Clips Picked Up

Answers

One of the most important relationships between electric and magnetic fields is that a changing electric field produces a magnetic field, and a changing magnetic field produces an electric field.

What is the relationship that exists between the electric and magnetic fields?

Electric and magnetic fields are two fundamental components of the electromagnetic force, which is one of the four fundamental forces of nature. The electric field is created by electric charges, while the magnetic field is created by moving electric charges or current.

One of the most important relationships between electric and magnetic fields is that a changing electric field produces a magnetic field, and a changing magnetic field produces an electric field. This is known as electromagnetic induction and is the basis for many technologies, including electric generators and transformers.

Additionally, electric and magnetic fields are intimately related through Maxwell's equations, which describe how electric and magnetic fields interact with each other and with electric charges. These equations show that a changing electric field produces a magnetic field, while a changing magnetic field produces an electric field.

Read more on magnetic fields here:https://brainly.com/question/14411049

#SPJ1

what causes distinct life zones as you ascend in elevation up a mountain

Answers

As you move higher up a mountain, differences in are what primarily lead to the formation of various living zones.

What is the meaning of life zones?

Any significant region of the Earth's surface with a typically consistent climate and soil, and consequently a high degree of uniformity in the species composition, is referred to as a life zone (plural life zones); numerous different classifications have been put up by various authors. An ecosystem's life zone is a region with distinctive plant and animal communities. Certain temperature and moisture conditions are correlated with different life zones. Average air temperatures drop and average yearly precipitation (snow and rain) amounts rise as elevation rises.

Why are life zones important?

For instance, by using the life zones as an ecological map, we can forecast where specific plants would flourish as the climate changes, and thus, we may forecast where significant water sources may be found.

To know more about Life Zones visit:

https://brainly.com/question/30409144

#SPJ1

1) What is the relationship between fs max and f k? same?

Answers

Maximum static friction is usually greater than the kinetic friction of the SAME object.

What is friction?

Friction is the pressure that opposes the movement of a stable item over another. There are in particular 4 forms of friction: static friction, sliding friction, rolling friction, and fluid friction.  

Static friction is pressure that maintains an item at rest.

Static friction definition may be written as:

Friction is skilled when people try and flow a desk-bound item on a floor, without truly triggering any relative movement between the frame and the floor on which it is.

Kinetic friction is a pressure that acts among shifting surfaces. A frameshifting at the floor stories a pressure withinside the contrary route of its movement.

The importance of the pressure will rely upon the coefficient of kinetic friction between the 2 materials.

Since the maximum Static friction might be executed when the body is about to move

Thus,

we can conclude that the maximum static function will be greater than the kinetic friction of the same object and same surface.

Learn more about friction here:

https://brainly.com/question/13000653

#SPJ1

Why is Kepler's second law important?

Answers

Kepler's second law is important because it explains how planets move at different speeds at different points in their orbit around the sun.

Kepler's second law, also known as the law of equal areas, is important because it describes the speed at which a planet travels around the Sun. This law states that a planet will travel faster when it is closer to the Sun and slower when it is farther away, but will always sweep out equal areas in equal times. This means that the planet's orbit will be elliptical rather than circular.

The significance of this law is that it provides insight into the dynamics of the solar system and how planets move in their orbits. It also played a crucial role in the development of Newton's laws of motion and the law of universal gravitation.

To know more about the Kepler's second law, here

brainly.com/question/1608361

#SPJ4

How to convert 110c to f?

Answers

110 °C is equivalent to 230 °F. The conversion formula between Celsius and Fahrenheit is:

°F = (°C x 9/5) + 32 °C = (°F - 32) x 5/9

To convert 110 degrees Celsius (°C) to Fahrenheit (°F), you can use the following formula:

°F = (°C x 9/5) + 32

Plugging in the given value of 110 °C, we get:

°F = (110 x 9/5) + 32 = 198 + 32 = 230 °F (rounded to two decimal places)

Therefore, 110 °C is equivalent to 230 °F.

Two popular temperature scales used around the world are the Celsius and Fahrenheit systems. The majority of nations in the globe use the metric temperature scale of Celsius (°C), however a small number of other nations also use the Fahrenheit (°F) measure.

The formula for converting between degrees Fahrenheit and degrees Celsius is: °F = (°C x 9/5) + 32 °C = (°F - 32) x 5/9.

The Celsius temperature is multiplied by 9/5 and 32 is added to convert it to Fahrenheit. By deducting 32 from the Fahrenheit temperature and multiplying the result by 5/9, you can convert a temperature from Fahrenheit to Celsius.

Learn more about conversions here:

https://brainly.com/question/30451535

#SPJ4

an object is thrown vertically upward with a certain initial velocity in a world where the acceleration due to gravity is 19.6 m/s2. neglecting air resistance, the height to which this object will rise in this world is

Answers

Answer:

S = H = V0 t + 1/2 g t^2       this is a vector equation with V0 positive and

                                             g is negative - this will give height H

Another way to look at this is to find t if one knows V0

t = V0 / g would be the time for an object to "fall" from zero speed to the speed it originally had (conservation  of energy - rise time = fall time)

Then S = 1/2 g t^2

how many days pass between seeing a full moon and then seeing a full moon again?

Answers

The time it takes for the Moon to complete one full cycle of its phases, on average, a lunar month lasts about 29.5 days.

A lunar month, also known as a synodic month, is the period of time it takes for the Moon to complete one full cycle of its phases as viewed from Earth. The lunar cycle is the regular and predictable sequence of changes in the Moon's appearance, as it orbits around the Earth including going from full moon to full moon, is called a lunar month or synodic month.

So, if you see a full moon tonight, you can expect to see the next full moon in approximately 29.5 days, although the exact number of days can vary slightly due to the Moon's orbit and other factors.

To learn more about Lunar month :

https://brainly.com/question/29441668

#SPJ4

Some elements are released as part of molecules and some are ions. What is the difference between an ion and a molecule?

If supplies of an element run out in an ecosystem, can living organisms make more by converting another element?

What prevents dead organic matter from decomposing in some wetlands, and peat to accumulate?

How do producers in wetlands such as the venus fly trap obtain nitrogen, despite the lack of nutrient recycling?

What causes Peat to decompose very quickly when it is added to soils in gardens?

What are consequences of draining wetlands, from organisms such as this Raft spider, and for atmospheric carbon dioxide concentration?

Answers

The difference between ions and a molecule is that ions have a net positive or negative charge, whereas molecules have no net charge. Molecules are formed when two or more atoms share electrons to complete an octet, and ions exchange electrons and form ionic compounds through electrostatic interactions.

The atoms that make up the organisms in an ecosystem are cycled repeatedly between the living and nonliving parts of the ecosystem.

Peatlands are ecosystems that are characterized by the accumulation of organic matter that is derived from decaying plant material under permanent water saturation.

Some plants, such as Venus flytraps and pitcher plants, grow in nitrogen-poor soils. They are green and capable of photosynthesis, but to meet their nitrogen needs, they catch and consume insects.

This dead plant matter is slowly decomposed as organisms such as bacteria, fungi, mites and small animals called springtails use this carbon as a food source.

Wetland destruction has increased flood and drought damage, nutrient runoff and water pollution, coastal erosion, and reduced wildlife populations.

To learn more about elements :

https://brainly.com/question/13025901

#SPJ1

how to convert 20 degree c to f?

Answers

20 °C is equivalent to 68 °F. To convert a temperature from Celsius to Fahrenheit, you multiply the Celsius temperature by 9/5 and add 32.

To convert 20 degrees Celsius (°C) to Fahrenheit (°F), you can use the following formula:

°F = (°C x 9/5) + 32

Plugging in the given value of 20 °C, we get:

°F = (20 x 9/5) + 32 = 36 + 32 = 68 °F

Therefore, 20 °C is equivalent to 68 °F.

The Celsius and Fahrenheit scales are two common temperature scales used in different parts of the world. Celsius (°C) is a metric temperature scale used in most countries around the world, while Fahrenheit (°F) is a temperature scale used primarily in the United States and a few other countries.

The conversion formula between Celsius and Fahrenheit is:

°F = (°C x 9/5) + 32 °C = (°F - 32) x 5/9

To convert a temperature from Celsius to Fahrenheit, you multiply the Celsius temperature by 9/5 and add 32. To convert a temperature from Fahrenheit to Celsius, you subtract 32 from the Fahrenheit temperature and then multiply the result by 5/9.

It's important to note that Celsius and Fahrenheit have different freezing and boiling points. In Celsius, water freezes at 0°C and boils at 100°C, while in Fahrenheit, water freezes at 32°F and boils at 212°F. This means that the same temperature can have different meanings depending on the scale used.

Learn more about temperature here;

https://brainly.com/question/15267055

#SPJ4

An elevator, suspended by a single cable, has just left the tenth floor and is speeding up as it descends toward the ground floor. Which of the following is the correct motion diagram for the situation described above? Choose one either (a), (b), (c), or (d) 2. Draw a free-body diagram. Draw the force vectors with their tails at the dot. The orientation of your vectors will be graded. The exact length of your vectors will not be graded but the relative length of one to the other will be graded.

Answers

An elevator, suspended by a single cable, has just left the tenth floor and is speed up as it descends toward the ground floor so the answer will be (b).

What is Acceleration?

Acceleration is the rate of change of velocity of an object with the   respect to the time. In other words, it is the amount by which an object's velocity changes in a given amount of time. Acceleration can be positive (speeding up), negative (slowing down), or zero (constant velocity). It is measured in units of  distance per time squared, such as meters per second squared (m/s^2) or feet per second squared (ft/s^2).

Since the elevator is descending and speeding up, its acceleration is downward and increasing. Therefore, the correct motion diagram would be:

(b)

^

|

|

|

|

| .

| .

| .

| .

| .

| 10

---|-------->

|

|

|

|

|

|

For the free-body diagram, we need to consider all the forces acting on the elevator. The force due to gravity is always present and acts downward, while the tension in the cable acts upward. Since the elevator is speeding up, the tension in the cable must be greater than the force due to gravity. Therefore, the free-body diagram would look like:

     T

  ------

  \     |

   \    |

    \   |

     \  |

      \ |

       \|

        |

       ---

        mg

where T is the tension in the cable and mg is the force due to gravity.

To know more about Velocity visit:

https://brainly.com/question/19979064

#SPJ1

Choose the correct term to complete the sentence. the doppler effect is the change in of a wave due to the motion of the source and/or receiver.

Answers

The Doppler effect is the change in frequency of a wave due to the motion of the source and/or receiver.

The shift in wave frequency that happens when a wave source and its observer move in relation to one another is known as the "Doppler Effect."

The number of waves that pass a fixed place in a unit of time is referred to as frequency in physics. It also indicates how many vibrations or cycles a body during periodic motion makes in a given amount of time.

When a source or receiver moves, a wave's frequency changes, and this is known as the Doppler effect.

The correct term to complete the sentence is "frequency".

For Similar question on Doppler Effect

https://brainly.com/question/3841958

#SPJ4

Question - Complete the sentence.

The Doppler effect is the change in__________ of a wave due to the motion of the source and/or receiver.

Answer:

frequency

Explanation:

That is the answer

Pls help with this question it is giving me headache

Answers

1) The velocity is 5 m/s

2) The final momentum is 25 Kg m/s

What is the momentum?

We must note that the momentum, is the product of the mass and the velocity of the object and that we can be able to obtain the momentum of the object when we look at the values that we have.

1) Given that;

Momentum before collision = Momentum after Collison

(0.5 * 10) + (0.5 * 0) = (0.5 + 0.5) v

5 = v

V = 5 m/s

2) From;

Ft = mv - mu

Ft = mv

Where mv = p2 or the final momentum

p2 = 5 * 5

= 25 Kg m/s

Learn more about momentum:https://brainly.com/question/30677308

#SPJ1

How do I convert joule to eV?

Answers

To convert joules (J) to electronvolts (eV), you can use the conversion factor: 1 eV = 1.6022 x 10^-19 J

An electronvolt (eV) is a unit of energy commonly used in atomic and nuclear physics. It is defined as the amount of energy gained by a single electron when it moves through a potential difference of one volt in a vacuum.

The electronvolt is a very small unit of energy, typically used to describe the energy of subatomic particles such as electrons, protons, and photons. For example, the rest mass of an electron is approximately 511,000 eV/c^2, where c is the speed of light.

Similarly, the energy of visible light is typically measured in electronvolts, with blue light having a higher energy (around 3 eV) than red light (around 1.8 eV).

To convert from joules to electronvolts, divide the value in joules by the conversion factor of 1.6022 x 10^-19. For example, to convert 1 joule to electronvolts:

1 J = (1/1.6022 x 10^-19) eV

1 J = 6.2415 x 10^18 eV

To know more about electronvolts here

https://brainly.com/question/30076657

#SPJ4

Two objects attract each other with a gravitational force of 16 units the mass of both objects was quintupled (x5) and the distance between the objects was doubled what is the gravitational force between the two objects

Answers

The gravitational force between the two objects, after the mass of both objects was quintupled and the distance between the objects was doubled, is 2.56 units.

What is the gravitational force between the two objects?

The gravitational force between two objects is given by the formula:

F = G * (m1 * m2) / r^2

where;

F is the gravitational force, G is the gravitational constant, m1 and m2 are the masses of the two objects, and r is the distance between the centers of the two objects.

If the mass of both objects is quintupled, their new masses become 5 times their original masses. If the distance between the objects is doubled, their new distance becomes 2 times their original distance.

Plugging these values into the formula, we get:

New F = G * [(5m) * (5m)] / (2r)^2

New F = G * (25 * m^2) / (4 * r^2)

New F = (25/4) * (G * m^2 / r^2)

Since the original gravitational force was 16 units, we can set up a proportion:

16 / F = 1 / (25/4)

Multiplying both sides by F, we get:

16 = F * (25/4)

Multiplying both sides by 4/25, we get:

F = 16 * (4/25)

F = 2.56 units

Learn more about gravitational force here: https://brainly.com/question/72250

#SPJ1

The measurement of body temperature is an example of a variable that uses what scale?A. Interval scaleB. Ordinal scaleC. Nominal ScaleD. Ratio scale

Answers

The measurement of body temperature is an example of a variable that uses option A, interval scale.

A scale with an interval has order and a meaningful difference between two values. Temperature (Fahrenheit), temperature (Celsius), pH, SAT score (200-800), and credit score are a few examples of interval variables (300-850).

One variable that uses interval scale is the measurement of body temperature.

Only ratio scales have a genuine zero, even though interval and ratio data can both be categorized, sorted, and spaced equally apart between consecutive values. As 0 is not the lowest attainable temperature, temperature in Celsius or Fahrenheit, for instance, is measured on an interval scale.

To know more about interval scale, visit,

https://brainly.com/question/29518046

#SPJ4

according to dr. hayne, which spacecraft mission was the first to explore the planets in the outer solar system

Answers

According to Dr. Hayne, the spacecraft mission that was the first to explore the planets in the outer solar system is Mariner 9.

On May 30, 1971, Mariner 9 lifted off from Cape Canaveral, Florida. A little over five months later, it entered orbit around Mars, thereby becoming the first spacecraft ever to orbit a planet other than our own Earth. During the initial stages of planetary exploration, it was customary for both these superpowers to launch pairs of spacecraft. The idea behind such an implementation was to ensure that one served as the backup for the other even if one of them failed in their objective completely. In 1965, the U.S. enjoyed its first success with respect to Mars as Mariner 4 flew by Mars, capturing the first close-up images of the planet. Considering this success came hot on the heels of its twin Mariner 3’s failure, the idea of launching in pairs seemed a good one. By 1969, NASA had furthered its accomplishments as Mariners 6 and 7 flew over Mars days within each other, with Mariner 7 even capturing an image of Phobos, one of Mars’s two natural satellites.

For further learning about spacecraft missions, refer to the link: https://brainly.com/question/6978577

#SPJ4

if the temperature outside increased 10 ºc, the dew point would _____.

Answers

If the temperature outside increases by 10ºC, the dew point will increase if the amount of moisture in the air remains the same.

This is because the dew point is the temperature at which the air becomes saturated with water vapor, and the amount of water vapor that air can hold increases as the temperature increases. So, if the temperature goes up by 10ºC, the air can hold more moisture before it becomes saturated, and therefore the dew point will also increase.

However, if the amount of moisture in the air decreases as the temperature increases, then the dew point may not increase or may even decrease. This is because the amount of moisture in the air is a key factor in determining the dew point, and if there is less moisture in the air, it will take a higher temperature for the air to become saturated.

for such more question on temperature

https://brainly.com/question/27944554

#SPJ4

what mass m2 will allow the following mobile to maintain static equilibrium?

Answers

A mass of will allow the following mobile to maintain static equilibrium.

In the given figure, we can clearly see that the rods are horizontal and also it's given that they are in static equilibrium.

Therefore we can conclude that the torque on the points connecting the rods is equal due to 0.1 kg and m1 masses

So,

(0.1 kg) × (0.1 m) = (0.2 m) × (m1)

m1 = 0.05 kg

Applying the same procedure of equating torque with the combined mass of 0.1kg and 0.05 kg and m2,

we get,

(0.15 kg) × (0.2 m) = (0.4 m) × (m2)

m2 = 0.075 kg

Learn more about static equilibrium on

https://brainly.com/question/13241683?referrer=searchResults

#SPJ4

according to scientists,The Great Salt Lake could go dry in the next five years. (true or false)

Answers

The statement is True. according to scientists, The Great Salt Lake could go dry in the next five years.

The term "Great Salt" is not a recognized term in physics, and it is unclear what is meant by it. However, if you are referring to the Great Salt Lake, then it is a large saltwater lake located in Utah, USA. As a physical entity, the Great Salt Lake has several interesting properties due to its high salinity.

For example, it is denser than freshwater and can therefore support heavier objects. Its high salt content also lowers the freezing point of water, which means that the lake's surface remains liquid even in extremely cold temperatures. These properties have practical applications, such as for the extraction of minerals from the lakebed and the testing of buoyancy and flotation devices.

To learn more about Great Salt visit here:

brainly.com/question/23528225

#SPJ4

what is largest moon of saturn

Answers

The largest moon of Saturn is Titan.

What is Saturn?

Saturn is the sixth planet from the Sun and is the second-largest planet in the Solar System after Jupiter. It is a gas giant planet, meaning it is composed mostly of hydrogen and helium and has no solid surface.

Titan is the only moon in the solar system that has a thick atmosphere, and it is larger than the planet Mercury. Titan's atmosphere is primarily composed of nitrogen, with trace amounts of methane and other gases.

The moon's surface is covered in lakes, rivers, and seas of liquid methane and ethane, and it has a thick haze that makes it difficult to study its surface using visible light. Titan is also of interest to scientists because it is believed to have conditions that are similar to those that existed on early Earth, and it may hold clues about the origins of life on our planet.

Hence, The largest moon of Saturn is Titan.

To learn more about Saturn:

https://brainly.com/question/1933746

#SPJ1

Other Questions
in a school orchestra, 2/5 o the students are string players of the string players 5/8 are girls what fractin of all the stuentd in the orchestra are girls who play string instruments. which characteristic best describes malaria? Why was the Missouri Compromise passed? to allow the citizens in Missouri to make decisions about whether their state would allow enslavement to resolve the issue of which states would be free and which states would allow enslavement in the future to provide a way for enslavement to eventually be banned from all states to settle land disputes among territories in the Louisiana Purchase What does the presence of molecular bands in the spectrum of a star indicate?A. The star has a low surface temperature.B. proportional to temperature to the fourth powerC. either more electrons that protons or more protons than electronsD. They never become giants. The presidents cabinet consists ofQuestion 1 options:a) the informal advisers who work with the president to guide and shape their agenda, such as the chief of staff.b) the leaders of organizations within the Executive Office of the President.c) the four top leaders in Congress and the chief justice of the Supreme Court.d) the secretaries (leaders) of the departments of the executive branch. Unanticipated inflation does all of the following EXCEPT:A) cause uncertainty about the future.B) reduce the value of debt.C) cause disinflation.D) reduce the value of money. which of these schedules of drugs has the highest potential for abuse? Necesito q alguien me ayude con la respuesta de:Decgono de 6.8cm de lado y apotema de 9.52cm.Es para pronto Short-term budgets allow management to periodically evaluate performance and take timely corrective action.True False Which natural feature is called "the Apennines? what is medical abbreviation ivp Read the excerpt from "what to the slave is the fourth of july?" are the great principles of political freedom and of natural justice, embodied in that declaration of independence, extended to us? how does this rhetorical question contribute to the passages central idea? a. it encourages black people to discuss the principles set forth in the declaration of independence. b. it reinforces the idea that the rights given to others are not extended to black people. c. it reveals that douglass has an in-depth knowledge of the declaration of independence. d. it gives the rest of the speech importance by referring to a famous historical document. I put the human insulin gene into a plasmid and put that plasmid into a bacteria. But the bacteria doesn't produce the insulin. What should I have put before the human insulin gene on the plasmid to make sure it made insulin? A. CapB. A Promotor siteC. TailD. DNA polymerase can you take bonus depreciation on rental property PLS HELP PLS PLS WILL MARK BRAINIEST There were many effortscreated to solve theimmigration problems.a Which of the following is notrelated to these efforts?A. Jane AddamsB. Hull HouseC. The NAACPD. Finding jobs forimmigrants Consider the following correct implementation of the insertion sort algorithm. The insertionsort method correctly sorts the elements of ArrayList data into increasing order. public static void insertionsort (ArrayList data) { for (int j - 1;) < data.size(); j++) intv - data.get()); int k - j; while (k > DEV data) { for (int ) - 1;) < date.size(); j++) int v - data.get(i); int k = while (k > de liv listo Words; public String word withCommas () String result = ""; int sizeofList - expression / for (int k - 0; i < sizeoflist; k++) result = result + listofwords.get(k): if ( /* condition */ ) ( result = result + , 1 result = result + ": return result; Which of the following can be used to replace /* expression and condition/ so thatwords WithCommas will work as intended? A expression /// A condition/ A listof words.size()-1/k!-0 B A expression/// condition/ listofWards.size(/k!:D C 1 * expression */ // * condition/ listOfWards.sizel - 1/k!= sizeofList - 1 / * expression // /* condition/ D listOfWords.size(/k! sizeofList 1 1 * expression */ // * condition/ result.length/k!-D The following sort method correctly sorts the integers in elements into ascending order public static void sort (int i elements) for (int j = 0; j < elements.length - 1; j++) = 1 int index = ji for (int k = 1 + l; kc elements.length; k++) Line 1: Line 2: Line 3: Line 4: Line 5. Line 6: Line 7: Line & Line 9: TE Line 10 Line 11: Line 12: Line 13: Line 14: Line 15: Line 16: Line 17: Line 18 Line 19 if (elements [k] C elements (index] { index= } int temp = elements (j); elements (] = elements (index); elements index) - temp: 1 Which of the following changes to the sort method would correctly sort the integers in elements into descending order? I. Replace line 9 with: Line 9: if (elements[x] > elements[index]) II. Replace lines 15-17 with: Line 15: int temp = elements (index): Line 16: elements [index] = elements (li Line 17 elements [= temp: III. Replace line 3 with: Line 3: for (int j = elements.length - 1; } > 0; j--) and replace line 7 with: Line 7 for (int k = 0; 1; k++) II. Replace lines 15-17 with: Line 15: int temp = elements (index); Line 16: elements (index] = elements[j; Line 17: elements (j = temp; III. Replace line 3 with: Line 3: for (int j = elements.length - 1; } > 0; i--) and replace line 7 with: Line 7: for (int k = 0; k what are used as top and bottom plates in metal wall framing. which characteristics are true of culture? A) culture is shared. B) culture is dynamic. C) culture is static.D) culture is symbolic.E) culture is integrated. F) culture is learned. A course of action that the government settles on is called:_________