Find the sum or product two different ways. 5+6+7+8
A rectangular field is 120 meters long and 85 meters wide.
Give the length and width of another rectangular field that has the same perimeter but a smaller area.
Answer:
Length: 200
Width: 5
Step-by-step explanation:
The perimeter of 120 and 85 is 410
The perimeter of 200 and 5 is 410
The area of 200 and 5 is 200 times 5 which is 1000
The area of 120 and 85 is 120 times 85 is 10200
-I hope this helps
Reflect the shape A in the line x=1
What are the coordinates of the vertices of the image?
anyone who is amazing at maths please help!!!!!!!!!!!!!!!!!!!!
i am running out of time
Answer:
reflected image shown in red on attached diagram
Step-by-step explanation:
When reflecting an object in the line x = a:
reflected x-values: 2a - xreflected y-values are the same as the original y-valuesSo when reflecting in the line x = 1
given x-value = 2, so reflected x-value = 2(1) - 2 = 0given x-value = 4, so reflected x-value = 2(1) - 4 = -2(2, 7) → (0, 7)
(2, 4) → (0, 4)
(4, 4) → (-2, 4)
|x-b|=c, only one solution is -3
Answer:
x-b=-3
Step-by-step explanation:
1. Simplify
|x-b|=c
x-b=c
If c=-3 then,
Answer= x-b=-3
Find the x-intercept and y-intercept of the line.
=+6x3y−6
constitutional amendment that has significantly changed the structure of congress as written in the original constitution
Given a circle with a radius of 7 inches and a central angle of 140°, find the area of the sector.
Answer: 343pi/18
Step-by-step explanation:
In the Lincoln Grade School, 200 students are in the first grade, 150 are in the second grade, 300 in the third grade, 250 in the fourth grade, 200 in the fifth grade, and 275 in the sixth grade. Construct a bar graph that represents the number of students per grade at Lincoln Grade School. Label the bar graph with a title and the correct, consistent scale.
Answer:
In image
Step-by-step explanation:
-------------------
2/5 10+36-6 ................... HELP PLEASE
Answer:
if it is just the 10+36-6 then that is 40 but then if it is 2/5 10+36-6 then that would be 16
Step-by-step explanation:
add 10 and 36 which is 46 then subtract 6 which is 40 then get the 2/5 which would be 16 hope this helps you
2 is multiplied by the difference of a number and 4.
Answer:
x=3
Step-by-step explanation:
4(x-2)=4. divide both sides by 4
x-2=1. add 2 to both sides
x=3
Answer:
2(x-4)
Step-by-step explanation:
* means multiplied by
2 is multiplied by the difference of a number and 4
multiplied by separates
2 AND "by the difference of a number and 4"
"by the difference of a number and 4" is in a parenthesis
"a number" means x
"the difference" means minus or -
2 is multiplied by the difference of a number and 4 =
2 * (x-4) =
2(x-4)
If you had a coupon for $0.50 off the price for one of your items, would this change your answer for which is a better buy? Give an example
Answer: yes it would change my answer for what is a better buy
Step-by-step explanation: if you buy a $1.98 large soda for 50¢ off you’ll have a $1.48 soda that is only 30¢ more but the size is significantly larger
Find the product.
(5 – 3z)(5 + 3z) =
(Simplify your answer.)
Answer:
25 - 9(z)²
Step-by-step explanation:
Hope this helps :)
what is a pair lines that are parallel
Answer:
The pairs of lines that do not intersect or meet at any point are called parallel lines. These lines lie on the same plane but do not intersect. The line segments or rays that lie on the same plane but do not intersect are also parallel.
Step-by-step explanation:
Answer
A parallel line is a position of two lines on a plane that does not have a point of intersection even though the two lines are extended.Geometrically, parallel lines will never meet each other because they have the same slope (gradient). Parallel lines do not have to be the same length
PLS HELP ME ASAP I WILL MARK THE BRAINIEST
Answer:
73°, 85°, 62°Step-by-step explanation:
#1Angle formed by two chords is half the sum of the intersepted arcs:
m∠HKI = m∠GKJ = 1/2(105 + 41) = 1/2(146) = 73°#2Angle formed outside by two tangents is half the difference of intercepted arcs:
1/2(55x - 17x) = 9538x = 190x = 190/38x = 5Find the arc measure:
mAC = 17x = 17*5 = 85°#3Angle formed outside by two secants is half the difference of intercepted arcs:
mBCD = 1/2(mAE - mDB) = 1/2(147 - 23) = 1/2(124) = 62°Assessment started: undefined. Item 1 What is the median of this data set? {11, 13, 13, 14, 14, 16, 18, 23, 24} Enter your answer in the box.
{11, 13, 13, 14, 14, 16, 18, 23, 24}
mode: 13, 14median : 14minimum : 11maximum : 24interquartile range : 7.5total numbers : 9As it's odd
Median:-
n+1/29+1/210/25Median is 5th term 14
Use+the+following+data+to+compute+the+relative+market+share+of+each+brand+and+its+position+on+the+growth-share+matrix+if+the+market+growth+rate+is+13. 4%. +which+of+the+following+is+correct?
Market share is simply the percentage of the total revenue or sales in a market which a particular business makes.
What is a market share?
Your information is incomplete. Therefore, an overview of the market share will be given. Market share is a measure of consumers' or businesses' preference for a product over other similar products.
A higher market share means greater sales and less effort is needed to sell more and a strong barrier to entry for other competitors.
For example, if there are 50,000 units sold per year in an industry, a company that has sales of 5,000 of those units would then have a 10 percent share in that market.
Learn more about market share on:
https://brainly.com/question/25309906
please help!!!! thanks
Sonia has only dimes and nickels in her coin jar; they are in a ratio of 3 to 5. IF she had 120 coins in the jar, how many are dimes? PLEASE HELP
Answer:
45 dimes and 75 nickels
Step-by-step explanation:
3 ÷ 8 × 120 = 45
you divide the three by both ratios summed up (8) and then you multiply that by the coins
doing so will you can get 45
and to get the amount of nickels you just subtract 45 from 120 and you get 75
if f(x)=2x^2-3x+4, find f(x+3)
Step-by-step explanation:
well, the approach is totally simple : we use (x+3) everywhere where we have "x" in the function expression.
so,
f(x+3) = 2(x+3)² - 3(x+3) + 4 =
= 2(x² + 6x + 9) - 3x - 9 + 4 =
= 2x² + 12x + 18 - 3x - 9 + 4 =
= 2x² + 9x + 13
4. Is (x + 2)a factor of (x + 5x 3 2 - 4x – 20)? -
Answer:
yes
Step-by-step explanation:
if (x + 2) is a factor of the polynomial , then if x = - 2 gives the polynomial a value of zero it is a factor
(- 2)³ + 5(- 2)² - 4(- 2) - 20
= - 8 + 5(4) + 8 - 20
= - 8 + 20 + 8 - 20
= 0
since polynomial = 0 then (x + 2) is a factor
Determine the ratio of the note B to middle C.
a. 1.8877
b. 1.7983
C. 1.9348
d. 1.3654
Answer:
To determine the ratio of the note B to middle C, we need to find the frequency of note B and then divide it by the frequency of middle C.
The frequency of note B is 493.9 Hz, and the frequency of middle C is 261.6 Hz.
Therefore, the ratio of the frequency of note B to middle C is:
493.9 / 261.6 = 1.8877
So the answer is (A) 1.8877
There are a total of 12 bicycles and tricycles in a parking lot. If there are 31 wheels in all, how many of them are bicycles?
Answer:
5 bicycles
Step-by-step explanation:
5 * 2 = 10 wheels
7 * 3 = 21 wheels
10 + 21 = 31
Hope this helped! Brainliest :)
How many times more is 2 ^ 10 than 2^ 6
Answer choices
8
16
12
Answer:
16
Step-by-step explanation:
2^10 = 1,024
2^6 = 64
1,024/64 = 16
Hope that helps!
A cylinder-shaped container has a radius of 20 centimeters and a height of 100 centimeters.
What is the approximate volume of the cylinder?
Enter your answer in the box. Use 3.14 to approximate pi.
Answer: The volume of the cylinder is 125, 600 cm^3
Step-by-step explanation:
Volume = 3.14 x Radius^2 x Height
Volume = 3.14 x 20^2 x 100
Volume = 3.14 x 400 x 100
Volume = 125,600 cm^3
HELP!
An animal shelter has a total of 20 cats, dogs, and
parrots. There are at least twice as many cats as dogs
and at least 3 times as many parrots as dogs. What is the
maximum number of dogs they could have?
Answer:
The answer is 4 dogs
Step-by-step explanation:
Let the number of dogs be x
=>The number of cats = 2x
=> The number of parrots = 3x
2x + 3x = 20
=>5x = 20
=>5x ÷ 5 = 20 ÷ 5
=>x = 4
They could have the maximum number of dogs is 4 dogs.
The given is,
An animal shelter has a total of 20 cats, dogs, and parrots.
There are at least twice as many cats as dogs and at least 3 times as many parrots as dogs.
What is a maximum number?
A maximum is a unique number for a given set of data. This number can be repeated, but there is only one maximum for a data set.
Let the number of dogs be x
The number of cats = 2x
The number of parrots = 3x
2x + 3x = 20
5x = 20
5x / 5 = 20 / 5
x = 4
Therefore the are 4 dogs.
To learn more about the maximum numbers visit:
https://brainly.com/question/1938915
What is the rule and how do you find n? 100 points to answer!
Answer:
n = 17
Rule: y = 2x + 1
Step-by-step explanation:
By inspection of the first two ordered pairs in the given table, it appears that for each 1 unit increase in x, y increases by 2 units.
To check this, write the ordered pairs with 5 ≤ x ≤ 10 using this rule:
(5, 11) (6,13) (7, 15) (8, 17) (9, 19) (10, 21)
As the ordered pair (10, 21) appears in the table, then we can confirm that this is the rule and that it is a linear function.
If y increases by 2 units for every 1 unit increase of x, then the slope of the linear function will be 2.
Using the point-slope form of a linear function: [tex]\sf{y-y_1=m(x-x_1)}[/tex]
(where m is the slope and [tex]\sf(x_1,y_1)[/tex] is a point on the line)
Given:
m = 2[tex]\sf(x_1,y_1)=(5,11)[/tex]Substituting these values into the formula:
[tex]\implies \sf{y-11=2(x-5)}[/tex]
[tex]\implies \sf y=2x+1[/tex]
Therefore, the rule is [tex]\sf y=2x+1[/tex]
To find n, simply substitute x = 8 and y = n into the equation:
[tex]\implies \sf n=2(8)+1=17[/tex]
Therefore, n = 17
Take 2 points and form equation
(5,11)(6,13)Slope:-
m=13-11/6-5=2Equation in point slope form
y-11=2(x-5)y-11=2x-10y=2x+1So
for n
n=2(8)+1n=16+1n=17Suppose a polynomial of degree 4 with rational coefficients has the given numbers as zeros. Find the other zero
-2, square root 5, 10/3
Step-by-step explanation:
The root is
-sqr root of 5.
First, we put these roots in the forn of
[tex](x - a)[/tex]
where a is the root
So we have
[tex](x - ( - 2))(x - \sqrt{5} )(x - \frac{10}{3} )[/tex]
[tex](x + 2)(x - \sqrt{5} )(3x - 10)[/tex]
[tex](3 {x}^{2} - 4x - 20)(x - \sqrt{5} )[/tex]
To get rid of that square root, let have another root that js the conjugate posive root of 5.
[tex](3 {x}^{2} - 4x - 20)(x - \sqrt{5} )(x + \sqrt{5} )[/tex]
[tex](3 {x}^{2} - 4x - 20)(x {}^{2} + 5)[/tex]
Which will gives us a rational coeffeicent of degree 4.
Why we didn't do
[tex](x - \sqrt{5} )[/tex]
?
Because
[tex](x - \sqrt{5} ) {}^{2} = {x}^{2} - 2 \sqrt{5} + 5[/tex]
If we foiled out we will still have a irrational coeffceint.
Find the next three terms in the sequence. 24,20,16,12…. (If you could explain it that would be great too. It’s a bit confusing)
Answer:
the next three numbers should be 8, 4, 0
Step-by-step explanation:
it reduces by 4 each time
24 - 4 = 20
20 - 4 = 16
16 - 4 = 12
12 - 4 = 8
8 - 4 = 4
4 - 4 = 0
First term =a=24
common difference=d=20-24=-4
Formula
a_n=24-4(n-1)a_5
24-4(4)8a_6
24-5(4)4a_7
24-6(4)0A 5.2 pound package of chicken costs $11.90. What is the cost per pound?
Answer:
$2.29
Step-by-step explanation:
1. Divide $11.90 by 5.2
2. 11.90➗5.2 = 2.88 but you round the number so it will be 2.29
Hope this helps :)
Find the solution of the system of equations shown on the graph
The solution of the system of the equations shown is where the equations intersect
--> (-7, 1)
Hope that helps!
Answer:
(-7, 1),
Step-by-step explanation:
The solution is the coordinates of the point of intersection.
At this point x = -7 and y = 1.