inhibitory post-synaptic potentials (ipsps) group of answer choices result in local hyperpolarization prevent the efflux of potassium ions increase membrane permeability to sodium ions result in local depolarization

Answers

Answer 1

Inhibitory post-synaptic potentials (IPSPs) are a group of answer choices that result in local hyperpolarization. The IPSPs help prevent the efflux of potassium ions and increase the membrane permeability to chloride ions.

When a neurotransmitter binds to a receptor on the post-synaptic neuron, the ion channels open to allow ions to pass into or out of the neuron.

The IPSPs are caused by the opening of chloride ion channels or potassium ion channels. This hyperpolarizes the neuron and makes it less likely to fire an action potential.

Potassium ions have a crucial role in the generation of IPSPs. They are responsible for maintaining the resting potential of the neuron.

When the ion channels open, potassium ions leave the cell, making the interior more negative, resulting in hyperpolarization. This makes it harder for the neuron to fire an action potential.

IPSPs are essential in controlling the firing rate of neurons in the central nervous system. They can also help prevent seizures and other unwanted excitatory activity.

IPSPs are often used in combination with other synaptic potentials, such as excitatory post-synaptic potentials (EPSPs), to fine-tune the activity of the neuron.

to know more about hyperpolarization refer here:

https://brainly.com/question/12982897#

#SPJ11


Related Questions

The plum pudding model hypothesized by Thompson shows the scattering of electrons. When was this discovered in relation to other scientist's atomic hypotheses?

After Rutherford but before Chadwick
Before Bohr but after Chadwick
Before Bohr and Rutherford
After Rutherford but before Bohr

Answers

Answer: Before Rutherford

Explanation:

The plum pudding model was proposed by J.J. Thomson in 1904, before the experiments conducted by Ernest Rutherford in 1909 that led to the discovery of the atomic nucleus. Therefore, the correct answer is "Before Rutherford".

Answer:

Before Bohr and Rutherford

Explanation:

The plum pudding model was proposed by J.J. Thomson in 1904, before both Ernest Rutherford's gold foil experiment in 1911 and Niels Bohr's atomic model in 1913. Therefore, the correct answer is before Bohr and Rutherford.

What is the primary safety hazard associated with dichloromethane methylene chloride )?

Answers

The primary safety hazard associated with dichloromethane (methylene chloride) is its potential to cause serious health effects if it is inhaled or absorbed through the skin.

Dichloromethane is a colorless, volatile liquid with a sweet odor. It is commonly used as a solvent in various industrial and laboratory applications. Exposure to high concentrations of dichloromethane vapor can cause dizziness, headache, nausea, and even unconsciousness. Prolonged exposure can lead to more serious effects, including liver and kidney damage, as well as cancer. In addition, dichloromethane can be absorbed through the skin, and contact with the liquid can cause irritation or chemical burns. It can also react with other chemicals to form potentially explosive or toxic compounds. aTherefore, appropriate safety measures such as good ventilation, protective clothing, and gloves should be used when handling dichloromethane. It is also important to dispose of it properly and not to mix it with other chemicals unless under controlled conditions.

To learn more about Dichloromethane click the link below

brainly.com/question/31080842

#SPJ4

write the empirical formula for at least four ionic compounds that could be formed from the following ions: o CIO3^-,
o nh4^ ,
o ch3co2^-,
o pb^4+

Answers

Empirical formulae are the ratios of atoms in a compound that show the lowest possible ratio of atoms per mole of compound.

What is the empirical formula?

In this question, we are to find the empirical formulae for the following ions:

OCl³⁻, NH⁴⁺, CH₃CO₂⁻ and Pb⁴⁺

Empirical formula for OCl³⁻:Oxygen (O) forms an anion by gaining three electrons to form the oxide ion, O²⁻

The ClO₃⁻ ion has one O²⁻ and three Cl⁺ ions. Therefore, the empirical formula is OCl³⁻

Empirical formula for NH₄⁺ :Nitrogen (N) forms a cation by losing three electrons to form N₃⁺ while Hydrogen (H) forms a cation by losing an electron to form H⁺. Therefore, the empirical formula for NH₄⁺ is NH₄⁺

Empirical formula for CH₃CO₂⁻

The ion contains 2 Carbon atoms, 3 Oxygen atoms, and 4 Hydrogen atoms. Divide each number of atoms by the lowest number (2) to give the empirical formula: CH₃CO₂⁻

Empirical formula for Pb⁴⁺:Lead (Pb) forms a cation by losing four electrons to form Pb⁴⁺.Therefore, the empirical formula for Pb⁴⁺+ is Pb⁴⁺.

Learn more about Empirical formula here:

https://brainly.com/question/14044066

#SPJ11

20pcm3 og a gas has a pressure of 510mmhg what will be the volume of the pressure is increased to 780mmhg, assuming there is no change in temperature​

Answers

The volume of the gas will decrease from 20 cm³ to 13.08 cm³.

What is Boyle's law?

Boyle's law is a gas law that states that the product of the pressure and volume of a gas is constant at constant temperature.

What is the significance of assuming no change in temperature in this problem?

Assuming no change in temperature is significant because it allows us to apply Boyle's law to solve the problem. If the temperature were to change, we would need to use a different gas law, such as Charles's law or the combined gas law, to account for the change in temperature.

We can use Boyle's law to solve this problem, which states that the product of the pressure and volume of a gas is constant at constant temperature. Mathematically, we can express this as P₁V₁ = P₂V₂, where P₁ and V₁ are the initial pressure and volume, respectively, and P₂ and V₂ are the final pressure and volume, respectively.

Using this equation, we can solve for V₂:

P₁V₁ = P₂V₂

V₂ = (P₁V₁)/P₂

Substituting the given values, we get:

V₂ = (510 mmHg x 20 cm³) / 780 mmHg

V₂ = 13.08 cm³

Therefore, if the pressure is increased from 510 mmHg to 780 mmHg at constant temperature, the volume of the gas will decrease from 20 cm³ to 13.08 cm³.

Learn more about Boyle's law here:

https://brainly.com/question/30367133

#SPJ1

If you wanted to shift the potential of the lead-zinc cell upward,toward 0.70 V, which of the following actions would give thedesired result? Check all that apply. *Ignore the currentchecks.
Anyaction that makes [Zn2+] smaller than[Pb2+].
Any action that makes [Zn2+]larger than [Pb2+].
Adding some concentratedZn(C2H3O2)2 solution tothe Zn2+/Zn couple.
Anyaction that makes Q > 1.0.
Addingsome concentratedPb(C2H3O2)2 solution tothe Pb2+/Pb couple.
Anyaction that makes log Q positive.
Any action that makes log Qnegative.
Any action that makes Q <1.0.

Answers

To shift the potential of the lead-zinc cell upward, toward 0.70 V, the following actions would give the desired result:

Add some concentrated Pb(C2H3O2)2 solution to the Pb2+/Pb couple

Adding some concentrated Zn(C2H3O2)2 solution to the Zn2+/Zn couple

Any action that makes [Zn2+] larger than [Pb2+]

A lead-zinc cell is a galvanic cell consisting of lead and zinc electrodes immersed in a suitable electrolyte. The potential of the lead-zinc cell is the difference in electrode potential between the lead and zinc electrodes, as determined by their concentration gradient.

Therefore, to shift the potential of the lead-zinc cell upward, toward 0.70 V, one should add some concentrated Pb(C2H3O2)2 solution to the Pb2+/Pb couple, add some concentrated Zn(C2H3O2)2 solution to the Zn2+/Zn couple, and any action that makes [Zn2+] larger than [Pb2+].

To learn more about "lead-zinc cell", visit: https://brainly.com/question/31316460

#SPJ11

isotopes are different forms of an element that have different ______.

Answers

Isotopes are different forms of an element that have different atomic masses. The number of protons in each atom of an element will remain the same, but isotopes of an element will have different numbers of neutrons, leading to different atomic masses.

Isotopes are different forms of an element that have different numbers of neutrons in their nuclei. The number of neutrons in an atom can vary from one to several, depending on the element. Isotopes are atoms of an element that differ in the number of neutrons present in their nucleus. The atomic number of an element is determined by the number of protons present in the nucleus. However, the isotopes of the same element differ in their mass numbers. The atomic mass of an element is determined by the number of protons and neutrons present in the nucleus.

The atomic number of an atom is the sum of the number of protons in the nucleus and the number of electrons in a neutral (non-ionized) atom. Each atomic number designates a particular element, but not an isotope; the number of neutrons in an atom of a given element can vary widely. Each isotope of an element has a particular mass number, which is determined by the number of nucleons (both protons and neutrons) in the nucleus. Therefore, the isotopes of an element have different atomic masses.

Isotopes can be radioactive or stable, depending on the number of neutrons present in the nucleus. For instance, carbon-14 is a radioactive isotope of carbon, while carbon-12 is a stable isotope.

For more such questions on Isotopes , Visit:

https://brainly.com/question/14220416

#SPJ11

an aqueous solution is known to contain pb2 , cu2 , and na ions. treatment of the sample with both naoh and licl solution produces a precipitate. which of the metal cations does the solution contain? explain your response

Answers

An aqueous solution is known to contain Pb²⁺ , Cu²⁺ , and Na⁺ ions. Treatment of the sample with both NaOH and LiCl solution produces a precipitate. Pb²⁺ will produce white precipitate. This is Salt analysis.

What is precipitate?

Precipitation in chemistry is the formation of an insoluble chemical by the reaction of two salts or through temperature changes that affect the solubility of the compound. The solid that results from a precipitation process is referred to as a "precipitate" as well.

Precipitation can be a sign that a chemical reaction has taken place, but it can also happen when the concentration of a solute is higher than its solubility. The process of small, insoluble particles aggregating with one another or forming an interface with a surface, such as the container wall or a seed crystal, is the precursor to precipitation and is known as nucleation.

What is salt analysis?

An inorganic salt's cation and anion are identified by salt analysis. Systematic qualitative analysis is another name for it. To ascertain the presence or absence of particular cations and anions in salt, a number of tests and observations are performed.

Initializing the anion of the salt group serves as the first step in the preliminary test for anions. When a preliminary test for an anion is positive, a confirmatory test is necessary to verify the anion's presence in the salt.

To know more about Salt analysis, visit:

https://brainly.com/question/20713514

#SPJ1

Which of the following properties increase as you move from left to right across a period? Select all that apply.
A)Ionization energy
B)None
C)Electronegativity
D)Atomic radius

Answers

Ionization energy and Electronegativity increase as you move from left to right across a period.

A period is a row in the periodic table of elements. It consists of elements with a similar number of atomic orbitals. The table is arranged so that elements with the same number of valence electrons are located in the same group, making it easy to identify the properties of elements.

Ionization energy is the energy required to remove an electron from a neutral atom in its gaseous state.

Electronegativity is the measure of an atom's ability to attract electrons to itself.

As we move from left to right across a period, the effective nuclear charge increases, thus both ionization energy and electronegativity increase.

Therefore, the correct options are A)  Ionization energy and C) Electronegativity.

Learn more about the Periodic table here:

https://brainly.com/question/1173237

#SPJ11

what is the hybridization of the oxygen atom in a water molecule?

Answers

During the formation of a water molecule, we focus on the oxygen atom. In hybridization of H2O, the oxygen atom is sp3hybridized.

if i were to spray perfume at the corner of a classroom, the perfume would gradually spread out evenly until it fills the entire room. which law of thermodynamics does this best exemplify?

Answers

The gradual spread of perfume from a localized area to fill the entire room exemplifies the second law of thermodynamics.

This law states that in any isolated system, the total entropy (a measure of disorder or randomness) always increases over time. In this case, the perfume molecules initially have a high concentration in the corner of the room and low concentration in the rest of the room. However, as time passes, the perfume molecules spread out and become more evenly distributed throughout the room.

This process increases the entropy of the system, as the perfume molecules become more randomly arranged and disordered. The second law of thermodynamics thus predicts the natural tendency of systems to move from a state of lower entropy to higher entropy over time.

To learn more about thermodynamics refer to:

brainly.com/question/30822943

#SPJ4

Iron nail wrapped with copper wire Determine the standard reduction potential of the cathode half-reaction, the standard reduction potential of the anode half-reaction, and the standard potential of the cell. E°cathode ____
(V) E° anode ___ (V) E° cell ___ (V)

Answers

The standard reduction potential of the cathode half-reaction is -0.36V,

The standard reduction potential of the anode half-reaction is +0.34V,

and the standard potential of the cell is -0.02V.

The cathode half-reaction is the reduction of iron (Fe²⁺) to iron (Fe):

Fe²⁺ + 2e⁻ -> Fe; E°cathode = -0.36V.

The anode half-reaction is the oxidation of copper (Cu) to copper (Cu²⁺):

Cu -> Cu²⁺ + 2e⁻; E°anode = +0.34V.
The standard potential of the cell is determined by subtracting the standard reduction potential of the anode from the standard reduction potential of the cathode:

E°cell = E°cathode - E°anode

= -0.36V - (+0.34V)

= -0.02V.

Learn more about the standard potential of the cell here:

https://brainly.com/question/19036092

#SPJ11

A gas with a constant volume had an original pressure of 1150 torr and a temperature of 75.0 ℃. Pressure was decreased to 760 torr. What is the final temperature of the gas?a. -43.0 ℃b. 49.6 ℃c. 230 ℃d. -251 ℃

Answers

Answer:

A gas with a constant volume had an original pressure of 1150 torr and a temperature of 75.0 ℃. Pressure was decreased to 760 torr. What is the final temperature of the gas?a. -43.0 ℃b. 49.6 ℃c. 230 ℃d. -251 ℃

the term pertaining to all the chemical reactions and physical workings of the cell is

Answers

Metabolism is referred as the term pertaining to all the chemical reactions and physical workings of the cell.

Cellular metabolism refers to the set of chemical and physical processes that occur within a cell in order to convert nutrients into energy and other molecules that the cell can use. It also includes the transport of molecules in and out of the cell, as well as the regulation of these processes which helps to maintain the homeostatic balance of the cell, allowing it to function normally and respond to environmental changes. This includes the breakdown of molecules like carbohydrates, proteins, and lipids into their basic components, as well as the synthesis of molecules like enzymes, hormones, and other complex molecules.

To learn more about metabolism click here https://brainly.com/question/29523568

#SPJ4

what is the entropy change when 315 j of energy is reversibly transferred to a sample of water at 25 °c?

Answers

When 315 J of energy is irreversibly transferred to a sample of water at 25°C, the entropy shift is roughly 1.056 J/K.

The entropy change when 315 J of energy is reversibly transferred to a sample of water at 25°C can be calculated using the equation:

ΔS = qrev/T

where ΔS is the change in entropy, qrev is the amount of heat transferred reversibly, and T is the temperature in Kelvin.

Converting the temperature to Kelvin by adding 273.15:

T = 25°C + 273.15 = 298.15 K

Substituting the given values:

ΔS = 315 J / 298.15 K

ΔS ≈ 1.056 J/K

Therefore, the entropy change when 315 J of energy is reversibly transferred to a sample of water at 25°C is approximately 1.056 J/K.

To learn more about entropy refer to

brainly.com/question/13999732

#SPJ4

Which are the factors that favor SN2 react a) Strong nucleophile, good leaving group, polar protic solver b) Strong nucleophile, good leaving group. c) Weak nucleophile, good leaving group, po d) Strong nucleophile, poor leaving group, po ors that favor SN2 reactions, as described during the lab lecture? aving group, polar protic solvent, methyl or primary halide. e, good leaving group, polar aprotic solvent, methyl or primary halide. o, good leaving group, polar aprotic solvent, methyl or primary halide. phile, poor leaving group, polar aprotic solvent, tertiary halide. uong nucleophile, good leaving group, polar aprotic solvent, tertiary halide. 4. Which alkyl halide reacts fastest with trimethylamine in SN2 reaction? a) CI

Answers

The factors that favor SN2 reactions are Strong nucleophile, good leaving group, polar aprotic solvent, methyl or primary halide.

SN2 reactions require a strong nucleophile, good leaving group, polar aprotic solvent, and a methyl or primary halide. The reason for this is that SN2 reactions occur in a single step, with the nucleophile attacking the substrate and the leaving group departing at the same time. When the nucleophile approaches the substrate, it must be in a good orientation to cause an SN2 reaction.The best orientation for SN2 reactions occurs when the substrate is methyl or primary, the solvent is polar aprotic, the nucleophile is strong, and the leaving group is good. When the leaving group departs, it must be able to do so quickly, so a good leaving group is required. Finally, the solvent must be polar aprotic, which means that it can stabilize negative charges while not inhibiting the reaction by solvating the substrate.

The nucleophile attacks the substrate from the rear in order for this reaction to continue. The angle of the nucleophile's approach to the supplied substrate with respect to the carbon-leaving group bond is 180o. Through a transition state, the carbon-nucleophile bond forms and the carbon-leaving group bond dissolves simultaneously.

The needed product is now created when the leaving group is forced out of the transition state on the other side of the carbon-nucleophile connection. It's crucial to remember that the product is created by inverting the tetrahedral geometry at the central atom.

For more such questions on SN2 reactions , Visit:

https://brainly.com/question/25175580

#SPJ11

a.) Determine whether potassium hydrogen tartrate (KHC4H4O6) is neutral, basic, or acidic. First, what is its Ka when it acts as an acid? The following are for the diprotic acid, H2C4H4O6: Ka1 = 1.0 x 10-3 and Ka2 = 4.6 x 10-5. b.) Second, what is its Kb when it acts as a base? c.) Finally, indicate whether the HC4H4O6- ion is neutral, basic, or acidic in solution.

Answers

a) potassium hydrogen tartrate (KHC4H4O6) is acidic. Ka is calculated for the acidic characteristics of the molecule. When a proton is donated by the molecule to water, it forms the ion HCO4-. b) Kb = [C4H4O6-2][OH-]/[HC4H4O6-], Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]. c) As the ion HC4H4O6- is an acidic ion, it will have acidic characteristics in solution. It is because the ion can donate protons and act as an acid.

Kb is calculated for the basic characteristics of the molecule. The balanced chemical equation for the reaction is as follows:HC4H4O6-(aq) + H2O(l) ⇌ C4H4O6-2(aq) + OH-(aq)The Kb is determined using the equation given below : Kb = [C4H4O6-2][OH-]/[HC4H4O6-]The Ka value is calculated as shown below: Kb = [C4H4O6-2][OH-]/[HC4H4O6-]Kb = (1.0 × 10-11) × [C4H4O6-2][OH-]/[HC4H4O6-]

The balanced chemical equation for the reaction is as follows: HC4H4O6(aq) + H2O(l) ⇌ HCO4-(aq) + H3O+(aq)The Ka is determined using the equation given below : Ka = [HCO4-][H3O+]/[HC4H4O6]Ka = (1.0 × 10-3) × [HCO4-][H3O+]/[HC4H4O6]. Therefore, the Ka value is not given.

Know more about potassium hydrogen tartrate here:

https://brainly.com/question/11127999

#SPJ11

3. Assertion (A): There is a small gap left between the rails of a railway track
Reason (R): Cooling of substances result in contraction.
Both A and R are true but R is not the correct explanation of A
A is false but R is true
b.
c. A is true but R is false
d. Both A and R are true and R is the correct explanation of A

Answers

There is a small gap left between the rails of a railway track Reason (R): Cooling of substances result in contraction. Both A and R are true but R is not the correct explanation of A,

Why cooling causes contraction ?

When a substance is cooled, it means that the heat is removed from the substance. This results in fewer excited molecules and, as a result, less random motion. The force of attraction increases, resulting in fewer spaces between molecules, which causes contraction.

Why there is appearance of gap between railway track?

The gaps left between successive rails on a railway track as a result of the rails expanding in the summer. The gap exists to allow for this expansion. If no gap is left, the summer expansion will cause the rails to bend sideways. This will lead to train accidents.

to know more about contraction , visit ;

brainly.com/question/2669219

#SPJ1

The coupling reaction of two radicals is ______________ and involves ______ arrow(s).
endothermic, one
exothermic, one
endothermic, two
exothermic, two

Answers

The coupling reaction of two radicals is b. exothermic and involves one arrow.

A radical is a chemical entity that contains an unpaired electron in its valence shell, which makes it highly reactive. Molecules that contain an unpaired electron are referred to as "free radicals." Coupling reactions between free radicals involve the interaction of two free radicals, both of which have an unpaired electron. A covalent bond is created when these two free radicals join together, effectively eliminating the unpaired electron. This coupling reaction can be exothermic or endothermic based on the number of arrows present.

For two radicals, only one arrow is needed for the exothermic coupling reaction. The reaction is exothermic, and heat is produced as a result of the reaction. The energy produced by the bond-forming reaction overcomes the energy of the starting materials. This energy that is generated raises the kinetic energy of the product's components. As a result, the temperature of the system increases. For two radicals, the endothermic coupling reaction requires two arrows. The reaction absorbs energy, causing the temperature of the system to decrease.

Learn more about covalent bond at:

https://brainly.com/question/11674395

#SPJ11

g the half life of 2n-71 is 2.4 minutes. if we started with 50g at the beginning, how many grams would be left after 12 minutes?

Answers


After 12 minutes, the amount of 2N-71 remaining would be 25 grams. This is because the half-life of 2N-71 is 2.4 minutes, meaning that after 2.4 minutes, half of the initial amount (50 grams) will remain. After 12 minutes, half of the remaining 25 grams will have decayed, leaving 25 grams.


The initial amount of 2n-71 is 50 g, and the half-life of 2n-71 is 2.4 minutes. We need to determine how many grams of 2n-71 would be left after 12 minutes. During radioactive decay, the amount of a radioactive substance decreases exponentially over time. The formula for determining the amount remaining of a radioactive substance after time t is:A = A₀(1/2)^(t/h)Where, A₀ = the initial amount of the substance,A = the amount of the substance after time t,h = the half-life of the substance, and t = time elapsedPlugging the given values in the formula, we get:A = 50(1/2)^(12/2.4)A = 50(1/2)^5A = 50(1/32)A = 1.5625Therefore, the amount of 2n-71 left after 12 minutes is 1.5625 g.

For more details follow this link: https://brainly.com/question/31108721

#SPJ11

84 g of baking soda (sodium bicarbonate) reacts with 60 g of vinegar. The reaction produces 18 g of water and 82 g of salt called sodium acetate and some carbon dioxide, that bubbles out of the beaker and could not be measured. Use the law of conservation of mass to determine the mass of oxygen used. explain, in your own words how you solved this problem?

Answers

Answer:

To solve this problem, we need to apply the law of conservation of mass, which states that mass cannot be created or destroyed in a chemical reaction. This means that the total mass of the reactants must be equal to the total mass of the products.

We start by writing a balanced chemical equation for the reaction between baking soda and vinegar:

NaHCO3 + CH3COOH → NaCH3COO + H2O + CO2

This equation tells us that one mole of baking soda (sodium bicarbonate) reacts with one mole of vinegar (acetic acid) to produce one mole of sodium acetate, one mole of water, and one mole of carbon dioxide.

We can use the molar masses of the compounds involved to convert the given masses into moles:

84 g of baking soda is equivalent to 0.8 moles (84 g / 84 g/mol)

60 g of vinegar is equivalent to 1.0 moles (60 g / 60 g/mol)

18 g of water is equivalent to 1.0 moles (18 g / 18 g/mol)

82 g of sodium acetate is equivalent to 1.0 moles (82 g / 82 g/mol)

because co2 combines chemically with water to form a weak acid called ______, water can hold perhaps 1,000 times more co2 than either nitrogen or oxygen at saturation

Answers

Answer:

Because CO2 combines chemically with water to form a weak acid called carbonic acid, water can hold perhaps 1,000 times more CO2 than either nitrogen or oxygen at saturation.

Explanation:

What is carbon dioxide (CO2)?

Carbon dioxide (CO2) is a colorless, odorless gas that occurs naturally in the Earth's atmosphere. Carbon dioxide is a waste gas produced by animals and humans during respiration and combustion. It is also produced by plants and algae during photosynthesis.

Carbon dioxide is an important greenhouse gas that contributes to climate change.CO2 can combine chemically with water to form a weak acid called carbonic acid. Because of this, water can hold perhaps 1,000 times more CO2 than either nitrogen or oxygen at saturation.

Carbonic acid can dissolve calcium carbonate, which is found in marine organisms' shells and is a vital component of coral reefs. As the acidity of the ocean increases as a result of increasing CO2 concentrations, this can have a significant impact on these organisms.

To know more about carbonic acid refer here: https://brainly.com/question/17062319#

#SPJ11

Testing for Alcohols & Carboxylic Acids
1. The presence of a primary or secondary alcohol can be confirmed by reaction with acidified potassium
dichromate solution which changes colour from orange to green.
a) State the name formula of the reagent used to test for the presence of a primary/secondary alcohol.
b) State the colour change observed when this reagent reacts with an alcohol.
c) What type of compound is produced by the oxidation of a primary alcohol?
d) What type of compound is produced by the oxidation of a secondary alcohol?
e) Explain why the dichromate test does not work for tertiary alcohols such as methylpropan-2-ol.
Include the chemical structure of methylpropan-2-ol in your explanation.
2.a) Describe a simple chemical test for the presence of a carboxylic acid group in a molecule.
Reagent:
Observation:
b) Describe how you would confirm that the gas produced in this test is carbon dioxide.
c) Explain why, for a completely unknown compound, the hydrogencarbonate test is not conclusive proof
that a carboxylic acid group is present.

Answers

Answer:

a) Acidified potassium dichromate solution is used to test for the presence of a primary or secondary alcohol.

b) The orange color of the potassium dichromate solution is reduced to green when it reacts with an alcohol.

c) The oxidation of a primary alcohol produces a carboxylic acid.

d) The oxidation of a secondary alcohol produces a ketone.

e) The dichromate test does not work for tertiary alcohols because they cannot be further oxidized. Methylpropan-2-ol is a tertiary alcohol with the chemical structure:

CH3

|

CH3—C—OH

|

CH3

Since there are no hydrogen atoms attached to the carbon atom bearing the hydroxyl group, it cannot be oxidized.

a) A simple test for the presence of a carboxylic acid group is the addition of sodium hydrogencarbonate solution to the compound. The reagent reacts with the carboxylic acid to produce carbon dioxide gas.

Reagent: Sodium hydrogencarbonate solution

Observation: Effervescence (bubbling) due to the release of carbon dioxide gas.

b) To confirm that the gas produced in the hydrogencarbonate test is carbon dioxide, it can be tested with limewater. Carbon dioxide turns limewater milky/cloudy due to the formation of calcium carbonate.

c) The hydrogencarbonate test is not conclusive proof that a carboxylic acid group is present in a completely unknown compound because some other functional groups such as phenols and alcohols can also react with the reagent and produce carbon dioxide. Therefore, additional tests such as the dichromate test or Tollens' test may be needed to confirm the presence of a carboxylic acid group.

(please could you kindly mark my answer as brainliest and a follow would be really nice)

In the table, give specific examples of ecosystem services coral reefs provide for other ecosystems. (3 points)
Provisioning
Supporting
Regulating
Cultural

Answers

Note that the specific examples of ecosystem services that  coral reefs provide for other ecosystems are given in the attached table.

What are ecosystem services?

Ecosystem services are the benefits humans derive from the natural environment, such as food, water, and clean air.

Ecosystem services are important because they provide essential resources for human well-being and support economic development.

Some example explained are:

Provisioning: Fisheries provide a source of food and income for many communities. Timber is a key resource for the construction and paper industries. Crop pollination is necessary for agriculture and food production.

Supporting: Soil formation provides the foundation for plant growth and food production. Nutrient cycling replenishes soil fertility and supports plant growth. Habitat provision supports biodiversity and the provision of other ecosystem services.

Regulating: Pollination is essential for plant reproduction and the production of crops. Water purification removes harmful contaminants from drinking water. Climate regulation helps to mitigate the impacts of climate change.

Cultural: Recreation provides opportunities for people to engage with nature and promotes physical and mental well-being. Aesthetic value refers to the beauty and cultural significance of natural landscapes. Spiritual and religious values are often associated with natural environments and provide cultural and social benefits.

Learn more about ecosystem services:
https://brainly.com/question/28207078
#SPJ1

The descriptions below explain two ways that water is used by plants on a sunny day.

I. In a process called transpiration, some liquid water in leaves changes to water vapor. The water vapor is released into the air through tiny pores in the leaves. This allows more liquid water from the soil to be pulled up the roots and stem to replace water lost from the leaves.

II. Plants use some of this water in leaves in a process called photosynthesis. During photosynthesis, water and carbon dioxide break apart and recombine to form two new substances, oxygen and glucose.

Based on the above description of transpiration and photosynthesis, which type of change happens to water during each process?

In transpiration, because some of its properties change, water undergoes a physical change but keeps its identity. In photosynthesis, because its identity changes, water undergoes a chemical change.
In transpiration, because some of its properties change, water undergoes a chemical change but keeps its identity. In photosynthesis, because its identity changes, water undergoes a physical change.
In transpiration, because its physical properties change, water undergoes a physical change and loses its identity. In photosynthesis, because it keeps its identity, water undergoes a chemical change.
In transpiration, because its chemical properties change, water undergoes a chemical change and loses its identity. In photosynthesis, because it keeps its identity, water undergoes a physical change.

Answers

The correct answer is: In transpiration, because some of its properties change, water undergoes a physical change but keeps its identity.

What are transpiration and photosynthesis?

Transpiration and photosynthesis are both processes that involve the use of water by plants.

Transpiration is the process by which water evaporates from the leaves of a plant and is released into the atmosphere. This occurs through tiny openings on the surface of leaves called stomata. The water that is lost through transpiration is replaced by water absorbed by the roots of the plant from the soil.

Photosynthesis, on the other hand, is the process by which plants use water, along with carbon dioxide and sunlight, to produce oxygen and glucose. During photosynthesis, water is split into hydrogen and oxygen, and the oxygen is released into the atmosphere as a byproduct. The glucose that is produced is used as a source of energy by the plant.

In transpiration, because some of its properties change, water undergoes a physical change but keeps its identity. In photosynthesis, because its identity changes, water undergoes a chemical change.

To know more about photosynthesis, visit:

https://brainly.com/question/29764662

#SPJ1

Answer:

Its A

Explanation:

Got it right on the quiz

Dolostone is composed of the mineral dolomite, which is similar to calcite in limestone, except that dolomite contains_____
a. Iron
b. Aluminium
c. Silica
d. Magnesium

Answers

Dolostone is composed of the mineral dolomite, which is similar to calcite in limestone, except that dolomite contains magnesium.

Dolostone, also known as dolomite rock, is a sedimentary rock composed mainly of the mineral dolomite. Dolomite, a calcium magnesium carbonate mineral, is the primary component of dolostone, making up around 90-95 percent of the rock. Dolostone is a rock that is similar to limestone and is often mistaken for it.

Read more about the topic of carbonate rocks:

https://brainly.com/question/12971138

#SPJ11

an ammonium based buffer contain s0.175 m ammounium bromide and 0.0836 m acetic acid. what is the ph of this solution

Answers

The pH of a solution of ammonium-based buffer containing 0.175 M ammonium bromide and 0.0836 M acetic acid is 9.26.

What is the pH of this solution?

A buffer is a mixture of a weak acid and its conjugate base or a weak base and its conjugate acid. It resists changes in pH when small amounts of acid or base are added to it.

For the buffer solution to work, its pH should be within the acid dissociation constant, Ka of the weak acid and the weak base, Kb. In this question, the buffer is made up of ammonium bromide and acetic acid. The Ka for the acetic acid, CH3COOH is 1.74 x 10-5. It is a weak acid. The buffer pH can be calculated using the Henderson Hassel-balch equation.

Henderson Hassel-balch equation pH = pKa + log ([A-] / [HA]) Where, A- is the conjugate base and HA is the weak acid, pKa is the negative logarithm of Ka, pKa = -log Ka = -log (1.74 x 10-5), pKa = 4.76. Ammonium bromide will act as a salt in this solution, and its conjugate base will be ammonia.

NH4Br → NH4+ + Br-NH4+ will combine with OH- to form ammonia, NH3 and water.NH4+ + OH- → NH3 + H2OIn this reaction, OH- will be added to the buffer.

To calculate the pH of the buffer, we need to know the concentration of NH4+ and NH3 at equilibrium. NH4+ will come from the ammonium bromide, and NH3 will come from the reaction above.The ammonium bromide dissociates as follows:

NH4Br → NH4+ + Br-

Therefore, [NH4+] = 0.175 M. The concentration of NH3 will depend on the OH- concentration, which will be used up in the reaction. We need to know the Kb of NH3 to calculate the concentration of NH3 at equilibrium.

Kb for NH3 is 1.8 x 10⁻⁵ NH3 + H2O ↔ NH4+ + OH

-Kb = [NH4+] [OH-] / [NH3]

Kb = [NH4+] [OH-] / [NH3]But [NH3] = [NH4+] as they are in equal amounts, so;

Kb = [OH-]

Kb = 1.8 x 10-5[OH-] = 1.8 x 10-5.

The pOH = - log (1.8 x 10-5) = 4.74.

The pH of the buffer = 14 - pOH = 9.26

Learn more about pH on:

https://brainly.com/question/12609985

#SPJ11

Select the correct molecule that is the main product of the Calvin cycle.
1. G3P
2. NADPH
3. Glucose

Answers

The  molecule that is the main product of the Calvin cycle is glucose. The Calvin cycle is also known as the light-independent reactions.

It is a series of biochemical reactions that occur in the stroma of the chloroplast in photosynthetic organisms to produce glucose. The Calvin cycle is made up of three stages: Carbon fixation, Reduction and regeneration of ribulose bisphosphate. Here's a breakdown of each stage:

Carbon fixation: Carbon dioxide enters the Calvin cycle and is converted to organic molecules. During carbon fixation, Rubisco, which is a crucial enzyme in photosynthesis, catalyzes the reaction between carbon dioxide and ribulose bisphosphate, leading to the formation of a six-carbon molecule that splits into two three-carbon molecules. This three-carbon molecule is the starting material for the reduction process.

Reduction: The ATP and NADPH produced during the light-dependent reactions are used to convert the three-carbon molecule produced during carbon fixation into glyceraldehyde-3-phosphate. This process involves a series of biochemical reactions that require the use of energy from ATP and electrons from NADPH.

Regeneration of ribulose bisphosphate: Glyceraldehyde-3-phosphate, which is the main product of the Calvin cycle, is used to regenerate the starting material for carbon fixation, ribulose bisphosphate. During this stage, ATP is used to convert the remaining glyceraldehyde-3-phosphate molecules into ribulose bisphosphate. The Calvin cycle is an essential process in photosynthesis, as it produces glucose, which is the main source of energy for plants and other photosynthetic organisms.

For more such questions on glucose , Visit:

https://brainly.com/question/397060

#SPJ11

Balance and state the type for these equations: _Ca(OH)2 + _HCl —> _CaCl2+ _H2O

Answers

Answer:

1,2,1,2

Explanation:

Predict the product(s) obtained when benzoquinone is treated with excess butadiene:

Answers

When benzoquinone is treated with excess butadiene, the products obtained are 2,5-dimethylcyclohexadiene-1,4-dione and cyclohexene.

What is benzoquinone?

Benzoquinone is also known as 1,4-benzoquinone or cyclohexa-2,5-diene-1,4-dione, is a colorless organic compound. The presence of two carbonyl groups in its structure provides it its characteristic quinone chemistry.

Butadiene, also known as 1,3-butadiene, is a conjugated diene. The reaction between benzoquinone and butadiene is called a Diels-Alder reaction.

The Diels-Alder reaction is a conjugate addition reaction that joins a diene and a dienophile to create a new six-membered ring. The most important characteristic of the Diels-Alder reaction is its stereospecificity. This reaction occurs between a cyclic diene and an alkene or alkyne dienophile.

The products obtained when benzoquinone is treated with excess butadiene are:2,5-dimethylcyclohexadiene-1,4-dioneCyclohexeneThe reaction proceeds with the dienophile (benzoquinone) being attacked by the diene (butadiene) in the Diels-Alder reaction to produce a cyclic adduct. The product is 2,5-dimethylcyclohexadiene-1,4-dione. Cyclohexene is formed as a byproduct of the reaction.

Learn more about Benzoquinone here:

https://brainly.com/question/15014857

#SPJ11

how many years does it take for plastic to decompose

Answers

Answer: how many years does it take for plastic to decompose?

Well, it depends on the plastic,  regular plastic can take up to 20 years to decompose, however, plastic bottles can take up to 450 years to decompose.

Other Questions
Which of the following conditions will tend to make rocks change by ductile deformation rather than by brittle deformation?Choose one:A. granitic compositionB. slowly applied stressC. position fairly close to Earth's surfaceD. cool surroundings the cylinder has a volume of 45 cubic inches and a height of 5 inches what is the raduis of the cylinder Eva is packing for a camping trip. There are 3 sleeping bags and 2 pillows to choose from. For the tent, Eva has 6 options. In how many different ways can Eva pick a set of camping gear that includes one of each item? A survey was given asking whether they watch movies at home from Netflix, Redbox, or a video store. Use the results to determine how many people use Redbox.42 only use Netflix 44 only use Redbox12 only use a video store 11 use only a video store and Redbox42 use only Netflix and Redbox 33 use only a video store and Netflix10 use all three 27 use none of theseHow any people just use RedBox? The ion channel illustrated below would most likely be found in the plasma membrane of the (A) dendrite (B) cell body (C) axon (D) A and B (E) B and C 42) Identify the correct algorithm to use for finding the insertion position of a new item in the linked list studentList.a. ListFindInsertionPosition(studentList, dataValue) {curNodeA = nullcurNodeB = studentListheadwhile (curNodeB == null and dataValue > curNodeBdata) {curNodeA = curNodeBcurNodeB = curNodeBnext}return curNodeA}b. ListFindInsertionPosition(studentList, dataValue) {curNodeA = nullcurNodeB = studentListtailwhile (curNodeB != null and dataValue > curNodeBdata) {curNodeA = curNodeBcurNodeB = curNodeA}return curNodeA}c. ListFindInsertionPosition(studentList, dataValue) {curNodeB = nullcurNodeA = studentListheadwhile (curNodeB == null and dataValue < curNodeBdata) {curNodeA = curNodeBcurNodeB = curNodeBnext}return curNodeB}d. ListFindInsertionPosition(studentList, dataValue) {curNodeA = nullcurNodeB = studentListheadwhile (curNodeB != null and dataValue > curNodeBdata) {curNodeA = curNodeBcurNodeB = curNodeBnext}return curNodeA} team of teachers is meeting to develop a math unit for the first six weeks of school. they have made a list of learning goals and objectives that will be the backbone of the curriculum. they developed a curriculum map to help organize the content to be taught. which approach to the curriculum will be important to the success of this unit? -. If f(x) = x + 3x-2, find f(x) when x = -2 What is the benefit of using a differential stain versus a simple or negative stain use a random sampling distribution of means to determine the probability for different ranges of values of a mean (x-bar). please use the following information to answer questions 1-5. imagine that after graduation, you need to find an apartment to rent. the city in which you intend to live reports that the average rental payment (house or apartment) is $1225.15, with a standard deviation of $777.50. it also reported that the average cost of an apartment rental, rather than a house rental, was $1068.86. for the following questions, treat the average rental payment and standard deviation (house or apartment) as parameters (the population), and treat the average apartment rental cost as a statistic (the sample mean or x-bar) based on a sample of 100. use this information for questions 1-5. 1. what is the mean of the random sampling distribution of means? 2) What is the standard error of the random sampling distribution of means? 3) What is the z statistic for the average cost of an apartment rental? 4) What is the probability of finding an apartment rental with a average cost of $1068.86 or less? if the radius of a circle is increasing and the magnitude of a central angle is held constant, how is the length of the intercepted arc changing? explain your reasoning. venus is a member of the it department at a company that has a moderately-sized network. one of her performance review objectives is to help her department be more proactive relative to being notified, and responding to, certain events that occur in the network. what type of server will help her meet the objective? Performance on tasks depends on arousal level as well as the type of task. For optimal performance on a difficult task: PLEASE HELP!!! THIS IS DUE TODAY! IF IT A GOOD ANSWER I WILL BRAINLIESTHow did the physical characteristics of traditional Native American lands east of the Mississippi River differ from those in the new Indian Territory? Why do you think the federal government chose to relocate Native Americans there? fill in the blank. A summer berm is formed by gentle waves in spring and summer, whereas a(n) ____, or storm berm is formed higher up on the beach by strong storm waves. Which of the following is NOT among the problems faced by online magazines as they attempt to become profitable1. People are used to their web sites being free2.They must produce expensive original content3. They must compete not onlywith other magazines but with all other web sites on the internet4. web and internet users tend to be unsophisticated readers When expressions of the form (x r)(x s) are multiplied out, a quadratic polynomial is obtained. For instance, (x 2)(x (7))= (x 2)(x + 7) = x2 + 5x 14.a. What can be said about the coefficients of the polynomial obtained by multiplying out (x r)(x s) when both r and s are odd integers? when both r and s are even integers? when one of r and s is even and the other is odd?b. It follows from part (a) that x2 1253x + 255 cannot be written as a product of two polynomials with integer coefficients. Explain why this is so. Why is DNA replication considered semiconservative? Initiator proteins bind to replication origins and disrupt hydrogen bonds between the two DNA strands being copied. What contributes to the relative ease of strand separation by initiator proteins? what is the answer to this problem. solve x as a manager, you believe that people will be self-directed and creative if they are committed to company goals. if you subscribe to the theory y approach to management, you also believe that oresponses most people have little aptitude for creativity to bring to company problems. omost people have little aptitude for creativity to bring to company problems. omost people will avoid work whenever possible. most people will avoid work whenever possible. omost people can handle responsibility. most people can handle responsibility. omost people need clear guidance to succeed.