how to convert 600 kg to lbs?

Answer:

the 3rd option

Explanation:

3.5 = -3.5

is false in every case, for any value of x we can think of.

there is no value of x that makes this equation true.

so, there is no solution.

The expression for tension T₁ in cable 1 is calculated to be mgcosθ₁/(sinθ₁ + sinθ₂).

The angle made by strings 1 and 2 are θ₁ and θ₂ respectively. Tension in the strings 1 and 2 are T₁ and T₂ respectively.

Considering the diagram attached, the following tension components are written as,

The energy is directed downward by the weight of the block pressing against the body.

Vertical component of T₁ is T₁ sinθ₁ which acts upwards.

Horizontal component of T₁ is T₁ cosθ₁ which acts to the left.

Vertical component of T₂ is T₂ sinθ₂ which acts upwards.

Horizontal component of T₂ is T₂ cosθ₂ acting towards right.

To maintain an equilibrium, the upward forces and downwards forces must be equal even as the forces on the right and left hand side must be balanced.

Therefore, balancing the vertical components we obtain,

T₁ sinθ₁ + T₂ sinθ₂ = mg

For horizontal forces, T₁ cosθ₁ = T₂ cosθ₂

Re-arranging the above equation and making T₂ the subject of the formula, we can write it as,

T₂ = T₁ cosθ₁/cosθ₂

Substituting T₂ into the vertical component we get,

T₁ sinθ₁ + (T₁ cosθ₁/cosθ₂)sinθ₂ = mg

Multiply by cosθ₂ on both sides, we obtain,

T₁ sinθ₁ cosθ₂ + T₁ cosθ₁ sinθ₂ = mg cosθ₂

T₁ (sinθ₁ cosθ₂ + cosθ₁ sinθ₂) = mg cosθ₂

As we know the formula for sin(a + b) as sin(a)cos(b)+sin(b)cos(a), we get the above equation as,

T₁ sin(θ₁ + θ₂) = mg cosθ₂

Making T₁ as subject, we have,

T₁ = mg cosθ₂/sin(θ₁ + θ₂)

Thus, the equation for T₁ is deduced.

The given question is incomplete without the diagram. The diagram is attached in the attachment below.

To know more about tension:

https://brainly.com/question/30264095

#SPJ4

The height of the building is 42.4 meters.

Let's call the height of the building "h". We can use the following kinematic equations to solve for "h":

For the stone that is dropped from the top of the building:

h = (1/2)gt² (Equation 1)

For the stone that is thrown upwards from the ground:

y = vt - (1/2)gt² (Equation 2)

where;

We know that the two stones meet at exactly 5s after their release. This means that the distance travelled by the stone thrown upwards from the ground is equal to the height of the building, i.e.,

y = h

We can substitute this equation into Equation 2 and rearrange it to solve for "t":

h = vt - (1/2)gt²

h = 20t - (1/2)gt²

t = (2h/g - 20)/(-1) (Equation 3)

Now we can substitute Equation 3 into Equation 1 and solve for "h":

h = (1/2)g((2h/g - 20)/(-1))²

h = (1/2)g(2h/g - 20)²

h = (1/2)g(4h²/g² - 80h/g + 400)

Simplifying this equation by multiplying everything by 2g and moving all the terms to one side, we get:

4h² - 160h - 400 = 0

Solving this quadratic equation using the quadratic formula, we get:

h = (160 ± sqrt(160² + 4(4)(400))) / (2(4))

h = (160 ± sqrt(32,000)) / 8

We can ignore the negative solution, so:

h = (160 + 178.88) / 8

h = 42.4 meters

Learn more about height here: https://brainly.com/question/1739912

#SPJ1

Vaporization pressure of water is the pressure exerted by water vapor when it is in equilibrium with liquid water at a specific temperature.

Vaporization pressure of water represents the point at which the rate of evaporation of water equals the rate of condensation of water vapor, and it varies with temperature and atmospheric pressure.

As temperature increases, the vaporization pressure of water also increases. At sea level, the vaporization pressure of water is approximately 4.6 millimeters of mercury (mmHg) or 0.006 atmospheres at 0 degrees Celsius (32 degrees Fahrenheit) and approximately 23.8 mmHg or 0.031 atmospheres at 25 degrees Celsius (77 degrees Fahrenheit).

The vaporization pressure of water is an important parameter in atmospheric science, climate research, and various industrial and technological applications such as humidity control, air conditioning, and power generation.

Learn more about vaporization pressure here:

https://brainly.com/question/11864750

#SPJ4

Specialized neurons called sensory receptors react to particular kinds of inputs. Sensation occurs when sensed data is received by a sensory receptor.

The ability to learn about our surroundings or the condition of our organizational context is one of the main functions of sensory receptors. Receiving different kinds of inputs from various sources, the nervous system converts them into electrochemical signals. It is known as sensory transduction.

All layers of skin have sensory receptors. Mechanoreceptors surrounding hair follicles, Pacinian corpuscles, Meissner carrier of genetic information, Merkel complexes, Subject to certain constraints corpuscles, and C-fiber LTM are among the six kinds that may detect harmless stimuli in the skin (low threshold mechanoreceptors).

To know more about Sensory receptors visit:

https://brainly.com/question/30227541

#SPJ4

J and V are different units of measurement and cannot be directly converted as they measure different quantities.

J is the unit of measurement for energy or work in the International System of Units (SI), while V is the unit of measurement for electrical potential difference or voltage.

To convert J (joules) to V (volts), you would need to know the amount of energy involved and the electrical charge involved in the process.

One formula that relates energy, charge, and voltage is:

V = E/Q

where V is voltage, E is energy, and Q is electric charge. If you know the values of E and Q, you can use this formula to calculate the voltage.

For example, if you have 1 joule of energy and 1 coulomb of electric charge, you can calculate the voltage using the formula:

V = 1 J / 1 C = 1 V

So, in this example, 1 joule of energy is equivalent to 1 volt of electrical potential difference when there is 1 coulomb of electric charge involved.

To know more about measurement here

https://brainly.com/question/17960368

#SPJ4

The density of water is 1 g per centimetre cube.

A measurement of density contrasts the mass of an object with its volume. High density refers to the amount of matter in a given volume of an object.

The density of a substance indicates how dense it is in a given area. Mass per unit volume is the definition of a material's density.

Density is calculated by comparing an object's mass to its volume. The amount of matter in a specific volume of an object is referred to as high density.

A substance's density describes how dense it is in a specific space. A material's density is defined as its mass per unit volume.

To know about density

https://brainly.com/question/1354972

#SPJ4

According to general relativity, Earth goes around the sun rather than flying straight off into space because of the curvature of spacetime caused by the mass of the sun.

The general theory of relativity explains how gravity is actually caused by the curvature of spacetime and not by any actual force at all. The mass of the sun bends spacetime, which in the case of the Earth orbiting the sun causes the Earth to move on a curved orbit. The orbit of the Earth is visible as a curving path.

The Earth would indeed continue to move in a straight line if it weren't for the sun's mass's effect on the curvature of spacetime. But, general relativity offers a more thorough understanding of gravity and demonstrates that the Earth's and other solar system objects' motions are caused by the curvature of spacetime.

Learn more about curvature of spacetime

brainly.com/question/30003877

#SPJ4

Here, both the momentum and kinetic energy of he ball are conserved. There is no change in the magnitude of the speed thus, its kinetic energy is conserved.

The kinetic energy of an object is the energy generated by virtue  of its motion. It is related to its mass and velocity by the expression written below:

Ke = 1/2 mv²

The momentum of an object is the product of its mass and velocity. For an elastic collision both momentum and kinetic energy is conserved. But in the case of an inelastic collision, there is some energy loss and the kinetic energy is not conserved but momentum is conserved.

Here, the ball bounces by colliding with the floor, where its direction is changing but not the magnitude of speed. Hence, both the momentum and kinetic energy are conserved.

Find more on momentum:

https://brainly.com/question/30487676

#SPJ1

The Electric Potential at a point P for a thin rod with uniform charge density is equal to 50230.4 V.

Electric Potential is referred to as the total amount of work that is done by any external element to bring a unit positive charge from infinity to a point where the influence of potential can be felt. The electric potential due to a point charge is represented by

[tex]V = k\frac{q}{r}[/tex]

where V is the electric potential, k is Coulomb's constant which is equal to 9×10⁹ N m²/C², q is the charge and r is the distance.

Now, the Electric potential due to a small element dx at a distance d is given by

[tex]dV = k\frac{\alpha dx}{r}\\dV = k\frac{\alpha dx}{\sqrt{d^2 + x^2}}} \\dV = k\frac{\alpha dx}{\sqrt{D^2 + x^2}}} \\[/tex]

where k is coulomb's constant, α is the charge density.

Now the total electric potential at point P is

[tex]V = \int\limits^L_D \, dV \\V = \int\limits^{5D}_D \, k\frac{\lambda dx}{\sqrt{D^2 + x^2}}} \\\\V = k \lambda \int\limits^{5D}_D \, \frac{\ dx}{\sqrt{D^2 + x^2}}} \\\\ \\V = k\lambda[ln(\sqrt{D^2 + x^2} + x)]\limits^{5D}_D\\[/tex]

V = (9×10⁹)(3.90×10⁻⁶) ln {(5 + √26)/(1 + √2)}

V = 50230.4 V which is the required potential.

Learn more about Electric potential at:

brainly.com/question/28168672

#SPJ4

The branch of science that studies atoms is called atomic physics.

Atomic physics is the branch of physics that studies the structure of atoms and the interactions between them. It also covers the theories and principles behind the behaviour of atomic particles, such as electrons and protons. Atomic physics has many applications in fields such as chemistry, engineering, and medicine.Atomic physics is the study of atoms, their structure, and their interactions with other particles and fields. It is a sub-discipline of physics that deals with the behavior and properties of atoms. Atomic physics is concerned with the arrangement of electrons around the nucleus, the forces that hold them together, the energy levels of the different types of atoms, and the way in which they interact with light and other particles.

learn more about atoms Refer:brainly.com/question/13351604

#SPJ4

Gravitational attraction is the driving force for stellar fusion. So option a. is the correct answer.

Massive clouds were created when gas whirls of both helium and hydrogen cooled. The stuff was attracted together by the gravitational attraction in the middle, and ultimately, a few of the nuclei formed. The heat as well as the light of stars were elicited as a consequence of this. Stellar nucleosynthesis is the method by which elements are produced within stars by integrating the protons and neutrons together from the nuclei of lighter elements. All of the atoms in the universe started as hydrogen. Fusion inside stars transforms hydrogen into helium, heat, and radiation. Heavier elements are produced in distinct kinds of stars as they die or explode.

To learn more about Gravitational attraction visit here:

https://brainly.com/question/30189762

#SPJ4

To find velocity, you need to divide the distance traveled and the time it took to travel that distance.

Velocity is a vector quantity that indicates the rate of change of an object's position in a given direction. It is calculated by dividing the change in position of an object by the time interval over which the change occurred.

The formula for velocity is,

velocity = distance / time

For example, if a car traveled 100 meters in 10 seconds, the velocity would be,

velocity = 100 meters / 10 seconds

velocity = 10 meters per second

To know more about the velocity, here

brainly.com/question/13639113

#SPJ4

The electric force between the two charged objects, if they were 0.6 times more charged, would be 30.6 N.

According to Coulomb's Law, the electric force between two charged objects is directly proportional to the product of their charges and inversely proportional to the square of the distance between them. The equation for Coulomb's Law is: F = kQ₁Q₂/r² where:

In this case, if each object had 0.6 times as much charge, the electric force between them would be:

F' = k(0.6Q₁)(0.6Q₂)/r² =

F' = (0.6)(0.6)kQ₁Q₂/r²

F' = 0.36kQ₁Q₂/r² ´

F' = 0.36F

Therefore, the electric force between the two charged objects would be 0.36 times the original force, or 0.36(85 N) = 30.6 N. So, the electric force between the two charged objects would be 30.6 N.

See more about electric force at https://brainly.com/question/20797960.

#SPJ11

The electric force between them would be 30.6 N.

The electric force between two charged objects can be calculated using Coulomb's Law:
F = kq1q2 / r^2

Where F is the electric force, k is Coulomb's constant (8.99 x 10^9 Nm^2/C^2), q1 and q2 are the charges on the objects, and r is the distance between them.

If each object had 0.6 times as much charge, then the new charges would be:
q1' = 0.6q1
q2' = 0.6q2

Substituting these values into Coulomb's Law gives us:
F' = k(0.6q1)(0.6q2) / r^2
F' = (0.6)^2 * kq1q2 / r^2
F' = 0.36 * F

So the new electric force would be 0.36 times the original electric force:
F' = 0.36 * 85 N
F' = 30.6 N

Therefore, if each object had 0.6 times as much charge, the electric force between them would be 30.6 N.

More questions on calculation of electric force can be obtained here: https://brainly.com/question/29160021

#SPJ11

"A(n) digital logic probe is a special DC voltmeter that detects the presence or absence of a signal."

An inexpensive hand-held test tool called a logic probe is used to examine and troubleshoot the logical states of a digital circuit. A logic analyzer is utilised instead when numerous signals need to be observed or recorded concurrently.

To examine the logic states of digital data, logic probes are used. You need logic probes that can precisely acquire signals from a broad range of electronic designs while preserving signal fidelity in order to verify and debug the high-speed, low-voltage digital signals of today.

The logic probe, also known as a digital tester, is typically a portable, inexpensive probe that resembles a pen and has indicator lights to indicate the status of the line being probed. Logic probes are frequently used to examine digital circuits, such as those that use TTL or CMOS logic.

To know more about DC voltmeter:

https://brainly.com/question/30301245

#SPJ4

Answer:

1200J

Explanation:

m=3,h=40 while g= 10m/s^2

P.E=mgh

= 3 x 40 x10

=1200J

You'll move more quickly and halt farther away thanks to gravity. To slow down to a safe speed and keep control of your car, you might need to downshift or gently apply the breaks.

Gravity aids you in stopping attempts and shortens the stopping distance when you are traveling uphill. When you are descending, gravity also works against you and lengthens your stopping distance. The next factor that can affect your braking distance is the friction between the road and your tires. The amount of time it takes to stop a moving object is related to the square of the starting speed of the vehicle and relies on how quickly it was moving before the brakes were applied. Hence, even little speed increases result in noticeably larger stopping distances. The distance covered while using the brakes is the braking distance. Speed and drag are two variables that influence it.

Learn more about Gravity here:

https://brainly.com/question/13810323

#SPJ4

Rocks with a silica content of around 70% and composed primarily of quartz and feldspars are at the light-colored extreme. Granitic rock refers to these rocks.

Amorphous silicon dioxide, or SiO2, is employed in microsystems as a structural or sacrificial layer in many micro - milling techniques, as a dielectric in capacitors and transistors, as an insulator to isolate various electronic parts, and in other applications.

In order to alter the rheological behaviour of cement systems, increase the reactivity of supplemental cementitious materials, and increase the strength and durability, SiO2 nanoparticles were utilised.

To know more about SiO2 visit:

https://brainly.com/question/26243627

#SPJ4

The speed of wave propagation is found to be 0.875 m/s.

For the stated question:

Amplitude a = 1.35 m

Wavelength λ = 6.3 m

Time period T = 7.2 s

Frequency υ.

From the relation of time- period and frequency:

υ = 1/T

υ = 1/7.2

υ = 0.138 Hz

Speed of the wave v;

speed = wavelength * frequency

v = λ*υ

v = 6.3 * 0.138

v = 0.875 m/s

Thus, the speed of the propagation of the wave is found to be 0.875 m/s.

To know more about the waves, here

https://brainly.com/question/26116832

#SPJ1

The vector A carries you 222.487 units to the right, vector B carries you 86.424 units to the left, and vector C carries you 42.324 units to the left in the x-direction

To determine the x-direction component of each vector, we need to use trigonometry. We can use the cosine function to find the x-component of each vector since cosine gives the adjacent side length of a right triangle.

For vector A:

The length of the adjacent side (x-component) is given by: cos(15°) = 0.9659

The x-component of vector A is therefore: 230 x 0.9659 = 222.487

For vector B:

The length of the adjacent side (x-component) is given by: cos(237°) = -0.7252 (since cosine is negative in the second and third quadrants)

The x-component of vector B is therefore: 120 x -0.7252 = -86.424

For vector C:

The length of the adjacent side (x-component) is given by: cos(188°) = -0.1997 (since cosine is negative in the second and third quadrants)

The x-component of vector C is therefore: 212 x -0.1997 = -42.324

Learn more about vector here

brainly.com/question/13716125

#SPJ4

In Fahrenheit, 35.5 degrees Celsius is equivalent to 127.9 degrees.

Use the formula below for the convert 35.5 degrees Celsius to Fahrenheit:

°F = (°C x 1.8) + 32

The process of translating a temperature from one scale to another is referred to as temperature conversion. Temperature conversions between the several regularly used temperature scales, including Celsius, Fahrenheit, and Kelvin, are frequently required.

where the temperature is expressed in degrees Fahrenheit (°F) and degrees Celsius (°C).

Plugging in 35.5 degrees Celsius yields the following results:

°F = (35.5 x 1.8) + 32 °F

=> 95.9 + 32 °F

=> 127.9

As a result, 35.5 Celsius is equivalent to 127.9 Fahrenheit.

To learn more about Fahrenheit :

https://brainly.com/question/20697375

#SPJ4

Answer:

He collected many specimens of the finches on the Galapagos Islands. These specimens and his notebooks provided Darwin with a record of his observations as he developed the theory of evolution through natural selection.

25 °C is equivalent to 298.15 K. The formula to convert Celsius (°C) to Kelvin (K) is 0°C + 273.15 = 273.15K.

To convert 25 degrees Celsius (°C) to Kelvin (K), you can use the following formula:

0°C + 273.15 = 273.15K

Plugging in the given value of 25 °C, we get:

K = 25 + 273.15 = 298.15 K

Therefore, 25 °C is equivalent to 298.15 K.

The Kelvin (K) scale is an absolute temperature scale where 0 K represents absolute zero, the theoretical temperature at which all matter would have zero thermal energy. On the Kelvin scale, the size of one degree is the same as that of one Celsius degree, but the Kelvin scale starts at absolute zero, while the Celsius scale starts at the freezing point of water.

To convert a temperature from Celsius to Kelvin, you simply need to add 273.15 to the Celsius temperature. This is because the size of one Kelvin degree is the same as one Celsius degree, but the Kelvin scale starts at absolute zero (which is -273.15 °C), so adding 273.15 to a temperature in Celsius converts it to Kelvin.

The Kelvin scale is used in many scientific fields, especially in physics and chemistry, where absolute zero is a critical reference point. It is also used in engineering and technology, particularly in the fields of thermal engineering and materials science

Learn more about temperature here:

https://brainly.com/question/15267055

#SPJ4

Yes, silicon a better conductor of electricity than sulfur. The reasons are explained below.

Due to the outer electrons of pure silicon and germanium being bound in the covalent bonds of the diamond-like framework, these materials are weak electrical conductors.

Through the movement of free electrons, silicon can transmit electricity. Since silicon is an n-type semiconductor, just a small amount of n-type contaminants will produce free electrons. The current that moves through silicon from one place to another is caused by these free electrons.

Pure sulphur is a tasteless, odourless, brittle solid with a pale golden colour that is insoluble in water and a weak conductor of electricity. Sulfur meets three of the basic criteria for non-metals, making it a non-metal. Due to the restriction on the unrestricted movement of electrons, it is a poor conductor of heat and electricity. To undergo ionisation, an element's electrons need space to travel around and generate an electric charge.

To know more about conductors:

https://brainly.com/question/20257031

#SPJ4

The net force acting on the Zamboni is:

F_net = F_applied - F_friction

where F_applied is the force you apply, and F_friction is the frictional force. Substituting the given values, we get:

F_net = 85 N - 5 N = 80 N

The acceleration of the Zamboni is given by:

a = F_net / m

where m is the mass of the Zamboni. Substituting the given values, we get:

a = 80 N / 500 kg = 0.16 m/s^2

The distance the Zamboni moves is given by:

d = 40 m

The equation for motion with constant acceleration is:

d = 1/2 * a * t^2

where t is the time taken to move the distance d. Rearranging this equation, we get:

t = sqrt(2 * d / a)

Substituting the given values, we get:

t = sqrt(2 * 40 m / 0.16 m/s^2) = 10 s

Therefore, it will take 10 seconds to push the Zamboni the remaining 40 meters.

What is force?

To know more about force, click the link given below:

https://brainly.com/question/13191643

#SPJ1

The velocity of the other pool ball is (3, -1) m/s.

We can solve this problem using the principle of conservation of momentum, which states that the total momentum of a system remains constant if no external forces act on it.

Let the initial velocity of the stationary pool bar be (0,0) m/s. The initial momentum of the system is:

p_initial = m1 * v1 + m2 * v2

where m1 and m2 are the masses of the pool balls, and v1 and v2 are their initial velocities.

Substituting the given values, we have:

p_initial = 0.1 kg * (5, -4) m/s + 0.1 kg * (0,0) m/s

= (0.5, -0.4) kg m/s

After the collision, the total momentum of the system is still conserved, but now we have one ball at rest and the other moving with a velocity of (2, -3) m/s. Let the velocity of the other pool ball be (vx, vy) m/s. Then we have:

p_final = m1 * (2, -3) m/s + m2 * (vx, vy) m/s

where m1 and m2 are still the masses of the pool balls.

Setting the initial and final momenta equal and solving for (vx, vy), we get:

p_initial = p_final

0.5, -0.4 = 0.1 * (2, -3) + 0.1 * (vx, vy)

0.5, -0.4 = (0.2, -0.3) + (0.1vx, 0.1vy)

0.5 - 0.2 = 0.1vx

-0.4 + 0.3 = 0.1vy

vx = 3 m/s

vy = -1 m/s

Therefore, the velocity of the other pool ball is (3, -1) m/s.

Learn more about principle of conservation in brainly.com/question/29627840

#SPJ1

Answer:

The tempature of the room.

Explanation:

Due to the temperature of the room being above the ice freezing point, the ice will melt.

Answer:

Explanation:

Power is defined as the rate at which work is done

Power = work/time and is measured in Watts

The combined masses 0.2000kg * 1 g/0.001kg = 200 g, 524 mg * 1g/ 1000 mg = 0.524 g, 200g + 80.0 g + 0.524 g=280.524 g.

Mass is commonly referred to as the quantity of matter contained within an object. It is most usually assessed as inertial mass, which refers to an object's tension to acceleration given a given net force.

Matter, on the other hand, is defined somewhat loosely in science and cannot be strategically placed. In physics, mass is a statistical expression of inertia, which is a fundamental precept of all matter.

It is, in influence, the highly resistant that a cell of matter provides to a modification in its speed or placement when a force is applied to it. The smaller the start changing created by an applied force, the greater the mass of the body.

learn more about the mass of object here

https://brainly.com/question/6240825?referrer=searchResults

#SPJ4

99.3°F is equivalent to 37.4°C

A temperature unit developed from the SI (International System of Units) is Celsius (symbol: °C).

Prior to the adoption of the metric system, Fahrenheit (symbol: °F) was a commonly used measurement of temperature.

To convert Fahrenheit (°F) to Celsius (°C) we have to first subtract 32 from Fahrenheit and then multiply it by .5556 or 5/9.

We have to convert 99.3 degrees Fahrenheit (°F) to Celsius (°C),

We can use the following formula:

°C = (°F - 32) x 5/9

As per the given information,

°F = 99.3

Substituting the value 99.3 for °F, we get:

°C = (99.3 - 32) x 5/9

= 67.3 x 5/9

= 37.4

Therefore, 99.3°F is equivalent to 37.4°C.

For similar question on Fahrenheit to Celsius conversation,

https://brainly.com/question/23419049

#SPJ4